| Primary information |
|---|
| SAPdb_ID | 1499 |
| PMID | 19198495 |
| Year | 2008 |
| Name | Phe-Phe |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy) |
| Solvent | Water |
| Method | Dipeptide dissolved by sonicating for 20 min, subsequently stirring it with a magnetic bar at 60°C and on cooling to room temperature, nanostructures were formed |
| Concentration | 4mg/ml |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Nanotube |
| Size of Self-Assembled structure | Diameter: 100 nm to 5 μm; length: 100nm to micrometers |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)CO |
