| Primary information |
|---|
| SAPdb_ID | 1538 |
| PMID | 21132174 |
| Year | 2010 |
| Name | Diphenylalanine |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water |
| Method | The stock solution was prepared by dissolving the FF peptide powder in HFP and further with Distilled water to get final conc 2mg/ml and kept for 1day to form nanotube. |
| Concentration | 2mg/ml |
| pH | pH 5-6 |
Temperature
| NA |
| Incubation Period | 24 hours or a day |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Nanotube |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable in acetonitrile and PBS |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
