Details of SAPdb ID 1545 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1545 | |
| PMID | 21221462 | |
| Year | 2011 | |
| Name | Phe-Cha (Phenylalanine-Cyclohexylalanine ) | |
| Sequence | F-Cha | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | Cha=Cyclohexylalanine | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | TEM (Transmission Electron Microscopy) and DLS (Dynamic Light scattering) | |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) + water | |
| Method | 1mg of a purified peptide in 50 ml of HFIP and by subsequent addition of 1 ml of double distilled water. Samples were aged for 2– 24 hours. | |
| Concentration | 1 mg/ml | |
| pH | NA | |
| Temperature | Room temperature | |
| Incubation Period | 2 -24 hours | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Pleomorphic vesicles (diameter: 10 -80nm) | |
| Size of Self-Assembled structure | Diameter: 10 -80nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC1CCCCC1)C=O | |