| Primary information |
|---|
| SAPdb_ID | 1557 |
| PMID | 21833387 |
| Year | 2011 |
| Name | Peptide 2 |
| Sequence | LG |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Each of these peptides (0.06 mmol) was dissolved in 1mLwater of pH 6.96 and allowed to age for 24 h |
| Concentration | 0.06mmol |
| pH | 6.96 |
Temperature
| 37°C |
| Incubation Period | 24 - 48 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Spherical structure |
| Size of Self-Assembled structure | 90 - 100nm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | Stable over wide range of pH 2 - 12 |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](CC(C)C)C(=O)NCC=O |
