Details of SAPdb ID 1557 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1557 | |
| PMID | 21833387 | |
| Year | 2011 | |
| Name | Peptide 2 | |
| Sequence | LG | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Peptide | |
| Conjugate Partner | None | |
| Technique | FE - SEM (Field Emission Scanning Electron Microscopy), TEM (Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) | |
| Solvent | Water | |
| Method | Each of these peptides (0.06 mmol) was dissolved in 1mLwater of pH 6.96 and allowed to age for 24 h | |
| Concentration | 0.06mmol | |
| pH | 6.96 | |
| Temperature | 37°C | |
| Incubation Period | 24 - 48 hours | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Spherical structure | |
| Size of Self-Assembled structure | 90 - 100nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | Stable over wide range of pH 2 - 12 | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](CC(C)C)C(=O)NCC=O | |