| Primary information |
|---|
| SAPdb_ID | 1559 |
| PMID | 21879773 |
| Year | 2011 |
| Name | Phe-Phe |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | SEM (Scanning Electron Microscopy) |
| Solvent | Ethanol |
| Method | Dipeptide was freshly prepared by dissolving the peptides in ethanol at a concentration of 2 or 4 mg/mL at 70 C for 10 min and cooled to room temperature. Each peptide solution (100 μL) was then placed r modified surfaces i.e, silicon surface and dried at ambient temperature until the solvent evaporated. |
| Concentration | 2 mg/ml |
| pH | NA |
Temperature
| NA |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Tubular structure |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
