Details of SAPdb ID 1565 |
| Primary information | ||
|---|---|---|
| SAPdb_ID | 1565 | |
| PMID | 21948432 | |
| Year | 2011 | |
| Name | 1A | |
| Sequence | FF | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Non-terminal Modication | None | |
| Length | 2 | |
| Peptide/Conjugate/Mixture | Conjugate (Nucleopeptide) | |
| Conjugate Partner | Nucleobase | |
| Technique | TEM (Transmission Electron Microscopy) | |
| Solvent | Water | |
| Method | Peptide that self-assemble in water to form nanofibers and produce hydrogels at a concentration of 2.0 wt% and a pH value around 5 | |
| Concentration | 2 %wt | |
| pH | 5 | |
| Temperature | NA | |
| Incubation Period | NA | |
| Self-Assembly Formation | Yes | |
| Type of Self-Assembly | Hydogel (consists of fibers) | |
| Size of Self-Assembled structure | Width : 16nm | |
| Linear/Cyclic | Linear | |
| Stability of Nanostructure | NA | |
| Comment | NA | |
| Secondary information | ||
| Physico-Chemical properties |
| |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O | |