| Primary information |
|---|
| SAPdb_ID | 1613 |
| PMID | 22534735 |
| Year | 2012 |
| Name | FF |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | TEM (Transmission Electron Microscopy) and AFM (Atomic Force Microscopy) |
| Solvent | Water |
| Method | Peptide was dissolved in water at a concentration of 2 mg/ml. this solution was then incubated for 2 h at 37 °C. |
| Concentration | 2mg/ml |
| pH | 6.5 |
Temperature
| 37°C |
| Incubation Period | Yes |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Fibrillar structure |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
