| Primary information |
|---|
| SAPdb_ID | 1614 |
| PMID | 22535547 |
| Year | 2012 |
| Name | Diphenylalanine mono-mannose conjugate |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Conjugate |
| Conjugate Partner | Mannose |
| Technique | SEM (Scanning Electron Microscopy) and AFM (Atomic force Microscopy) |
| Solvent | Water |
| Method | Fresh solutions of glycopeptides (1mM) in appropriate solvents were prepared and incubated at 37°C for 24 hours to form self assembled structures. |
| Concentration | 1mM |
| pH | NA |
Temperature
| 37°C |
| Incubation Period | 24 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Tubular structure |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)CO |
