| Primary information |
|---|
| SAPdb_ID | 1615 |
| PMID | 22535547 |
| Year | 2012 |
| Name | Diphenylalanine bis-mannose conjugate |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Conjugate |
| Conjugate Partner | Bis-Mannose linked through lys |
| Technique | SEM (Scanning Electron Microscopy) and AFM (Atomic force Microscopy) |
| Solvent | Water |
| Method | Fresh solutions of glycopeptides (1mM) in appropriate solvents were prepared and incubated at 37°C for 12 hours to form self assembled structures. |
| Concentration | 1mM |
| pH | NA |
Temperature
| 37°C |
| Incubation Period | 12 hours |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Spherical structure |
| Size of Self-Assembled structure | Diameter: 500 - 700nm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | More stable |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
