| Primary information |
|---|
| SAPdb_ID | 1617 |
| PMID | 18837544 |
| Year | 2008 |
| Name | Diphenylalanine |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | EFM (Electrostatic Force Microscopy) |
| Solvent | HFIP (1,1,1,3,3,3-hexafluoro-2-Isopropanol) + water |
| Method | The peptide solution was prepared by dissolving the lyophilized form of the diphenylalanine in 1,1,1,3,3,3-hexafluoro-2-propanol (HFIP) at a final concentration of 100 mg/mL. Peptide stock solution was diluted in distilled water to a final concentration of 2 mg/mL. |
| Concentration | 2mg/ml |
| pH | NA |
Temperature
| NA |
| Incubation Period | NA |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Hollow fibers |
| Size of Self-Assembled structure | Height: 2-12nm |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
