| Primary information |
|---|
| SAPdb_ID | 1634 |
| PMID | 24895323 |
| Year | 2014 |
| Name | Diphenylalanine |
| Sequence | FF |
| N-Terminal Modification | Free |
| C-Terminal Modification | Free |
| Non-terminal Modication | None |
| Length | 2 |
| Peptide/Conjugate/Mixture | Peptide |
| Conjugate Partner | None |
| Technique | ESEM (Environmental Scanning Electron Microscope) |
| Solvent | HFP (1,1,1,3,3,3-hexafluoro-2-propanol) |
| Method | FF-peptide nanotubes (PNT) were prepared by dissolving the L-diphenylalanine peptide in 1,1,1,3,3,3-hexafluoro-2-propanol an initial concentration of 100mg/ml further diluted in deionized water. Drops of the above solutions at a final concentrationof 2mg/ml were placed onto clean silicon substrates and dried at room temperature. The thermally induced PNT samples were heated in an oven for 180 min at 180 °C. |
| Concentration | 2mg/ml |
| pH | NA |
Temperature
| Room temperature |
| Incubation Period | 180 minutes |
| Self-Assembly Formation | Yes |
| Type of Self-Assembly | Nanotubes |
| Size of Self-Assembled structure | NA |
| Linear/Cyclic | Linear |
| Stability of Nanostructure | NA |
| Comment | NA |
| Secondary information |
|---|
| Physico-Chemical properties | |
| STRUCTURE | |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C=O |
