| ID | 1023 | |
| PMID | 23311648 | |
| Year | 2013 | |
| Sequence | GRKKRRQRRRPPQRKC | |
| Name | Tat | |
| Length | 16 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | HIV-1 | |
| Nature of Peptide/Cargo | Cell penetrating peptide | |
| Mechanism | Tat enters cells by macropinocytosis, a specialized form of fluid-phase endocytosis that occurs in all cells | |
| Cargo Sequence/Structure | Not mentioned | |
| Name of cargo | Human tyrosinase plasmid (pAH7/Tyr, P) | |
| Assay | Vertical Franz diffusion cell | |
| Enhancer | None | |
| Properties of enhancer | Not applicable | |
| Concentration | 1ml solution containing 30 µg of tyrosinase plasmid,20µl of trypsin solution to hydrolyze the Tat | |
| Incubation time | 6 hours | |
| Tissue permeability (value with units) | TP could not pass through the skin due to the charge repulsion effect between the negative charge of the TP and the negative charge of the skin | |
| Tissue Sample | Abdominal skin of Sprague–Dawley rats | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@H](CCCNC(=[NH2])N)C(=O) N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCC [NH3])C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O) N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCC(=O) N)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N1CCC[C@H]1C(=O)N1CCC [C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CCCC[NH3])C (=O)N[C@@H](CS)C=O | |