ID | 1138 | |
PMID | 18426410 | |
Year | 2008 | |
Sequence | SLIGR | |
Name | SLIGR | |
Length | 5 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Amidation | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | Peptide of the mouse PAR-2-cleaved sequence | |
Nature of Peptide/Cargo | Activation of the human PAR-2 receptor, increase melanin depositionin vitro and in vivo | |
Mechanism | SLIGR sequence mimic the tethered ligand Sequence of PAR-2 receptor | |
Cargo Sequence/Structure | Not mentioned | |
Name of cargo | Not applicable | |
Assay | Fontana-Mason (F&M) stain | |
Enhancer | None | |
Properties of enhancer | Not applicable | |
Concentration | 251 µM | |
Incubation time | 6 weeks | |
Tissue permeability (value with units) | The increase in pigment deposition induced by peptide can be seen in the Fontana-Mason (F&M) stained microscopic images of Human skin section skin sections | |
Tissue Sample | Human skin samples grafted onto SCID mice | |
Ex vivo/In vivo/In vitro | in vitro | |
STRUCTURE |
| |
SMILES | N[C@@H](CO)C(=O)N[C@@H](CC(C)C)C (=O)N[C@@H]([C@@H](C)CC)C(=O)NCC(=O) N[C@@H](CCCNC(=[NH2])N)C(=O)N |