ID | 1304 | |
PMID | 3684299 | |
Year | 1987 | |
Sequence | Nle-EHfRWG | |
Name | [Nle4, D-Phe7]-alpha-MSH4-10 | |
Length | 7 | |
N-Terminal Modification | Acetylation | |
C-Terminal Modification | Amidation | |
Linear/ Cyclic | Linear | |
Chirality | Mix | |
Chemical Modification | Nle=Norleucine | |
Origin of Peptide | Derived from α-MSH | |
Nature of Peptide/Cargo | Not mentioned | |
Mechanism | It stimulates pheomelanin-to-eumelanin shift in the follicular melanocytes | |
Cargo Sequence/Structure | None | |
Name of cargo | Not applicable | |
Assay | Light and electron microscopy | |
Enhancer | Hairs were plucked as a pretreatment control | |
Properties of enhancer | Not mentioned | |
Concentration | 0.5 ml aliquots of melanotropins in poly-ethelene glycol ointment base (26% PEG '400 and 74% PEG 3350 | |
Incubation time | Once in 24 hours for 7 days. | |
Tissue permeability (value with units) | 10-8 to 10-14 concentrations turned yellow hair brown | |
Tissue Sample | Melanotropin dose was applied on the shaved skin of C57BL/6AY mice which stimulated the yellow hair to turn yellow which was observed at other untouched areas proving systemic effect | |
Ex vivo/In vivo/In vitro | in vivo | |
STRUCTURE |
| |
SMILES | CC(=O)N[C@H](CCC(=O)O)C(=O)N[C@@H](Cc1nc[nH]c1)C(=O)N [C@@H](CCCC)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H] (Cc1c[nH]c2ccccc12)C(=O)NCC(=O)N |