| ID | 1372 | |
| PMID | 21297299 | |
| Year | 2011 | |
| Sequence | GRKKRRQRRRCG | |
| Name | Tat analog | |
| Length | 12 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Analogue of Tat | |
| Nature of Peptide/Cargo | Cell penetrating peptide | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | Sense- 5' GGU GCA GAA AGA AGA CAU UTT 3' Antisense- 5' AAU GUC UUC UUU CUG CAC CTT 3' | |
| Name of cargo | siRNA for GL3 | |
| Assay | Confocal laser microscopy | |
| Enhancer | Skin was shaved | |
| Properties of enhancer | Hairless skin eases transdermal delivery | |
| Concentration | 5 µg siRNA+ 32 µg peptide | |
| Incubation time | 10 hours | |
| Tissue permeability (value with units) | Fluorescent signals of siRNA in the Tat applied skin were observed faintly at the stratum corneum in 10 times tape-stripped skin. In 20 times tape-stripped skin siRNA was observed widely and strikingly at the stratum corneum, hair follicle, epidermal and dermal layers. | |
| Tissue Sample | PAM212 cells (mouse keratinocytes) | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | NCC(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCC[NH3])C (=O)N[C@@H](CCCC[NH3])C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N)C (=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N[C@@H](CS)C(=O)NCC=O | |