ID | 1406 | |
PMID | 1689665 | |
Year | 1989 | |
Sequence | rPKPQQwFwLL | |
Name | Spantide | |
Length | 11 | |
N-Terminal Modification | Free | |
C-Terminal Modification | Amidation | |
Linear/ Cyclic | Linear | |
Chirality | Mix | |
Chemical Modification | None | |
Origin of Peptide | A tachykinin antagonist | |
Nature of Peptide/Cargo | Effectively prevents the miosis and the disruption of the blood-aqueous barrier consequent to ocular injury. | |
Mechanism | A tachykinin antagonist | |
Cargo Sequence/Structure | None | |
Name of cargo | Not applicable | |
Assay | Radioimmunoassay, HPLC | |
Enhancer | Samples were treated with two volumes of ice-cold acetone to precipitate proteins and subsequently dried and dissolved in chromatography Solvent | |
Properties of enhancer | Not mentioned | |
Concentration | 90nmol in 15µl 0.9% NaCl | |
Incubation time | 180 minutes | |
Tissue permeability (value with units) | Systemic uptake corresponds to a serum concentration peak of 1*10-8M after 15 minutes and intraoccular uptake corresponded to a plateau at 140-150ng/ml for 1-3 hours after completion of application | |
Tissue Sample | Left eye of pigmented rabbits of either sex and weighing 2-3 kg | |
Ex vivo/In vivo/In vitro | in vivo | |
STRUCTURE |
| |
SMILES | N[C@H](CCCNC(=[NH2])N)C(=O)N1CCC [C@H]1C(=O)N[C@@H](CCCC[NH3])C(=O)N1CCC [C@H]1C(=O)N[C@@H](CCC(=O)N)C(=O)N[C@@H](CCC (=O)N)C(=O)N[C@H](Cc1c[nH]c2ccccc12)C (=O)N[C@@H](Cc1ccccc1)C(=O)N[C@H](Cc1c[nH]c2ccccc12) C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H] (CC(C)C)C(=O)N |