| ID | 1593 | |
| PMID | 25786877 | |
| Year | 2013 | |
| Sequence | EHWSYwLRPG | |
| Name | Triptorelin | |
| Length | 10 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | Mix | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic gonadotropin- releasing hormone | |
| Nature of Peptide/Cargo | Marketed as a sustained release injection for treatment of infertility, endometriosios and hormone responsive cancers | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | electroosmotic volume flux was observed to study peptide penetration | |
| Enhancer | The donor solution pH was maintained at physiological pH 7.4 or at pH levels 6.0, 5.5, 5.0 and 3 using 0.1 or 0.01 M sodium hydroxide (NaOH) and/or 0.1 or 0.01 M hydrochloric acid (HCl) solutions. | |
| Properties of enhancer | Not mentioned | |
| Concentration | 1-10 mg/ml | |
| Incubation time | Not mentioned | |
| Tissue permeability (value with units) | Skin permeability of peptide increased 30 times more than passive permeation by ionophoresis | |
| Tissue Sample | Human epidermal membrane | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCC(=O)O)C(=O)N[C@@H](Cc1nc [nH]c1)C(=O)N[C@@H](Cc1c[nH]c2ccccc12)C(=O)N [C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)N[C@H] (Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CC(C)C)C (=O)N[C@@H](CCCNC(=[NH2])N)C(=O)N1C CC[C@H]1C(=O)NCC=O | |