| ID | 1619 | |
| PMID | 25681719 | |
| Year | 2015 | |
| Sequence | KVPRNQDWLEEEE | |
| Name | hgp-10025–3 | |
| Length | 13 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Derived from human cancer. | |
| Nature of Peptide/Cargo | Provide prolonged residence time and increase the ocular availability of loaded drugs. By forming suitably sized complex with proteins or by acting as artificial chaperones, they thus help to keep the proteins and enzymes in proper confirmation necessary | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | None | |
| Name of cargo | Not applicable | |
| Assay | Confocal laser scanning microscopy | |
| Enhancer | Poly(ethyleneglycol) (PEG)-modified Nanogels | |
| Properties of enhancer | Not mentioned | |
| Concentration | 46.5ul of the antigen peptide solution(10mg/ml) was added to 307ul of the nanogel suspension (45mg/ml) | |
| Incubation time | 3 hrs | |
| Tissue permeability (value with units) | Iontophoresis resulted in the accumulation of gp-100 peptide and nanogels in the epidermis, and subsequent increase in the number of Langerhans cells in the epidermis. Moreover, tumor growth was significantly suppressed by iontophoresis of the antigen peptide-loaded nanogels. | |
| Tissue Sample | Mouse Skin | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](CCCC[NH3])C(=O)N[C@@H](C(C)C)C(=O) N1CCC[C@H]1C(=O)N[C@@H](CCCNC(=[NH2])N)C(=O) N[C@@H](CC(=O)N)C(=O)N[C@@H](CCC(=O)N)C(=O)N [C@@H](CC(=O)O)C(=O)N[C@@H](Cc1c[nH] c2ccccc12)C(=O)N[C@@H](CC(C)C)C(=O) N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O) C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CCC(=O)O)C=O | |