| ID | 1620 | |
| PMID | 21531792 | |
| Year | 2011 | |
| Sequence | FCIGRLCG | |
| Name | AT1002 | |
| Length | 8 | |
| N-Terminal Modification | Free | |
| C-Terminal Modification | Free | |
| Linear/ Cyclic | Linear | |
| Chirality | L | |
| Chemical Modification | None | |
| Origin of Peptide | Synthetic | |
| Nature of Peptide/Cargo | Not mentioned | |
| Mechanism | Not mentioned | |
| Cargo Sequence/Structure | AUCCGCGCGAUAGUACGUAdTdT,GRLLRRQRRCG | |
| Name of cargo | siRNA,TAT-analog | |
| Assay | Confocal laser microscopy | |
| Enhancer | None | |
| Properties of enhancer | Not mentioned | |
| Concentration | 20µl | |
| Incubation time | 10hours | |
| Tissue permeability (value with units) | In mice treated with siRNA/Tat+AT1002 the fluorescence of FAMsiRNA was observed strongly and widely in the ear skin. | |
| Tissue Sample | Mice skin of ear lobes | |
| Ex vivo/In vivo/In vitro | in vitro | |
| STRUCTURE |
| |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CS)C(=O)N [C@@H]([C@@H](C)CC)C(=O)NCC(=O)N[C@@H] (CCCNC(=[NH2])N)C(=O)N[C@@H](CC (C)C)C(=O)N[C@@H](CS)C(=O)NCC=O | |