ID | 1625 | |
PMID | 2203894 | |
Year | 1989 | |
Sequence | PyroGlu-HWSYGLRPG | |
Name | GnRH (gonadotropin releasing hormone) | |
Length | 10 | |
N-Terminal Modification | Free | |
C-Terminal Modification | pyroGlutamine | |
Linear/ Cyclic | Linear | |
Chirality | L | |
Chemical Modification | None | |
Origin of Peptide | Growth hormone | |
Nature of Peptide/Cargo | Gonadotropin releasing hormone | |
Mechanism | Not mentioned | |
Cargo Sequence/Structure | No cargo | |
Name of cargo | Not applicable | |
Assay | HPLC | |
Enhancer | Sorensen's phosphate buffer, currents employed ranged from 0.1 to 0.5 mA cm -2 | |
Properties of enhancer | Currents employed ranged from 0.1 to 0.5 mA cm -2 | |
Concentration | 400 ul | |
Incubation time | 1 hr-5 hrs | |
Tissue permeability (value with units) | Concentration of GnRH in the receptor after 1 hour was 4,2 uM and after 4 hrs was 6,4 uM. | |
Tissue Sample | Hairless mouse skin | |
Ex vivo/In vivo/In vitro | in vitro | |
STRUCTURE |
| |
SMILES | N[C@@H](C[C@H]1NCNC1)C(=O)N[C@@H] (Cc1c[nH]c2ccccc12)C(=O)N[C@@H](CO) C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)NCC(=O)N [C@@H](CC(C)C)C(=O)N[C@@H](CCCNC (=[NH2])N)C(=O)N1CCC[C@H]1C(=O)NCC=O |