| Compound ID | 1809 |
| Compound Structure | |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin (0.533 ± 0.08 µg/ml), Isoniazid (0.116 ± 0.03 µg/ml), Streptomycin (2.7 ± 0.36 µg/ml), Ethambutol (2.7 ± 0.36 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 18182260 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta VK, Fatima A, Faridi U, Negi AS, Shanker K, Kumar JK, Rahuja N, Luqman S, Sisodia BS, Saikia D, Darokar MP, Khanuja SP.Antimicrobial potential of Glycyrrhiza glabra roots.J Ethnopharmacol. 2008 Mar 5;116(2):377-80
|
| Curator | |
| Compound ID | 1810 |
| Compound Structure | |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin (0.23 ± 0.06 µg/ml), Isoniazid (0.116 ± 0.03 µg/ml), Streptomycin (2.7 ± 0.36 µg/ml), Ethambutol (0.116 ± 0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 18182260 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta VK, Fatima A, Faridi U, Negi AS, Shanker K, Kumar JK, Rahuja N, Luqman S, Sisodia BS, Saikia D, Darokar MP, Khanuja SP.Antimicrobial potential of Glycyrrhiza glabra roots.J Ethnopharmacol. 2008 Mar 5;116(2):377-80
|
| Curator | |
| Compound ID | 1811 |
| Compound Structure | |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | Ethyl acetate fraction |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin (0.533 ± 0.08 µg/ml), Isoniazid (0.116 ± 0.03 µg/ml), Streptomycin (2.7 ± 0.36 µg/ml), Ethambutol (2.7 ± 0.36 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 116.67 ± 14.43 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 18182260 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta VK, Fatima A, Faridi U, Negi AS, Shanker K, Kumar JK, Rahuja N, Luqman S, Sisodia BS, Saikia D, Darokar MP, Khanuja SP.Antimicrobial potential of Glycyrrhiza glabra roots.J Ethnopharmacol. 2008 Mar 5;116(2):377-80
|
| Curator | |
| Compound ID | 1812 |
| Compound Structure | |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | Ethyl acetate fraction |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin (0.23 ± 0.06 µg/ml), Isoniazid (0.116 ± 0.03 µg/ml), Streptomycin (2.7 ± 0.36 µg/ml), Ethambutol (0.116 ± 0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 18182260 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta VK, Fatima A, Faridi U, Negi AS, Shanker K, Kumar JK, Rahuja N, Luqman S, Sisodia BS, Saikia D, Darokar MP, Khanuja SP.Antimicrobial potential of Glycyrrhiza glabra roots.J Ethnopharmacol. 2008 Mar 5;116(2):377-80
|
| Curator | |
| Compound ID | 1813 |
| Compound Structure | |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | Column fraction |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin (0.533 ± 0.08 µg/ml), Isoniazid (0.116 ± 0.03 µg/ml), Streptomycin (2.7 ± 0.36 µg/ml), Ethambutol (2.7 ± 0.36 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 58.33 ± 7.21 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 18182260 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta VK, Fatima A, Faridi U, Negi AS, Shanker K, Kumar JK, Rahuja N, Luqman S, Sisodia BS, Saikia D, Darokar MP, Khanuja SP.Antimicrobial potential of Glycyrrhiza glabra roots.J Ethnopharmacol. 2008 Mar 5;116(2):377-80
|
| Curator | |
| Compound ID | 1814 |
| Compound Structure | |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | Column fraction |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin (0.23 ± 0.06 µg/ml), Isoniazid (0.116 ± 0.03 µg/ml), Streptomycin (2.7 ± 0.36 µg/ml), Ethambutol (0.116 ± 0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 116.67 ± 14.43 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 18182260 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gupta VK, Fatima A, Faridi U, Negi AS, Shanker K, Kumar JK, Rahuja N, Luqman S, Sisodia BS, Saikia D, Darokar MP, Khanuja SP.Antimicrobial potential of Glycyrrhiza glabra roots.J Ethnopharmacol. 2008 Mar 5;116(2):377-80
|
| Curator | |
| Compound ID | 1815 |
| Compound Structure |  |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin (0.23 ± 0.06 µg/ml), Isoniazid (0.116 ± 0.03 µg/ml), Streptomycin (2.7 ± 0.36 µg/ml), Ethambutol (0.116 ± 0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 29.16 ± 3.61 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Glabridin |
| PubChem ID | 124052 |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 18182260 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzopyran, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C[C@H](Cc2c1c1c(OC(C=C1)(C)C)cc2)c1c(O)cc(O)cc1 |
| XLogP | 3.207 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gupta VK, Fatima A, Faridi U, Negi AS, Shanker K, Kumar JK, Rahuja N, Luqman S, Sisodia BS, Saikia D, Darokar MP, Khanuja SP.Antimicrobial potential of Glycyrrhiza glabra roots.J Ethnopharmacol. 2008 Mar 5;116(2):377-80
|
| Curator | |
| Compound ID | 2646 |
| Compound Structure |  |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |
| Compound ID | 2648 |
| Compound Structure |  |
| Plant Source | Strobilanthes cusia Common Name: |
| Source Family | Acanthaceae |
| Origin | China, Taiwan |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium complex |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Tryptanthrin |
| PubChem ID | 73549 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Quinazolinone, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.059 |
| Molecular Formula | C15H8N2O2 |
| SMILES | O=C1c2n(c3c1cccc3)c(=O)c1c(n2)cccc1 |
| XLogP | 3.519 |
| PSA | 46.500 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
2) L. A. Mitscher and W. R. Baker.A search for novel chemotherapy against tuberculosis amongst natural products.Pure Appl. Chem., 1998, Vol. 70, No. 2, pp. 365-371
|
| Curator | |
| Compound ID | 2838 |
| Compound Structure | |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Methylene chloride |
| Target Bacteria | |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 85 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N/A |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | 21094237 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Mohamad S, Zin NM, Wahab HA, Ibrahim P, Sulaiman SF, Zahariluddin AS, Noor SS.Antituberculosis potential of some ethnobotanically selected Malaysian plants.J Ethnopharmacol. 2011 Feb 16;133(3):1021-6
|
| Curator | |
| Compound ID | 3971 |
| Compound Structure |  |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin (0.23 ± 0.06 µg/ml), Isoniazid (0.116 ± 0.03 µg/ml), Streptomycin (2.7 ± 0.36 µg/ml), Ethambutol (0.116 ± 0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 29.16 ± 3.61 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Glabridin |
| PubChem ID | 124052 |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzopyran, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C[C@H](Cc2c1c1c(OC(C=C1)(C)C)cc2)c1c(O)cc(O)cc1 |
| XLogP | 3.207 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gupta VK, Fatima A, Faridi U, Negi AS, Shanker K, Kumar JK, Rahuja N, Luqman S, Sisodia BS, Saikia D, Darokar MP, Khanuja SP.Antimicrobial potential of Glycyrrhiza glabra roots.J Ethnopharmacol. 2008 Mar 5;116(2):377-80
|
| Curator | |
| Compound ID | 3412 |
| Compound Structure |  |
| Plant Source | Glycyrrhiza inflata Common Name:Chinese Licorice |
| Source Family | Fabaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | < 20 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Licochalcone A |
| PubChem ID | 5318998 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 12058317 |
| Extract Preparation | Soxhlet extraction, concentrated in vacuo to dryness |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Chalcone, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4 |
| SMILES | Oc1c(C(C)(C)C=C)cc(c(OC)c1)/C=C/C(=O)c1ccc(O)cc1 |
| XLogP | 4.443 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Friis-Møller A, Chen M, Fuursted K, Christensen SB, Kharazmi A.In vitro antimycobacterial and antilegionella activity of licochalcone A from Chinese licorice roots.Planta Med. 2002 May;68(5):416-9
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3569 |
| Compound Structure |  |
| Plant Source | Haplopappus sonorensis (A. Gray) S.F. Blake Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | Mexico |
| Plant Part Used | Whole plant |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin |
| Inhibition [%] | 98 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ermanin |
| PubChem ID | 5352001 |
| Ethnomedicinal Information | Antiviral, anti-inflammatory |
| PubMed ID [Source Literature] | 12727485 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against HCT - 116 (ATCC CCL - 247) |
| Molecular Weight | 314.079 |
| Molecular Formula | C17H14O6 |
| SMILES | O1c(c(OC)c(=O)c2c1cc(O)cc2O)c1ccc(OC)cc1 |
| XLogP | 2.045 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Murillo JI, Encarnación-Dimayuga R, Malmstrøm J, Christophersen C, Franzblau SG.Antimycobacterial flavones from Haplopappus sonorensis.Fitoterapia. 2003 Apr;74(3):226-30
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3570 |
| Compound Structure | |
| Plant Source | Haplopappus sonorensis (A. Gray) S.F. Blake Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | Mexico |
| Plant Part Used | Whole plant |
| Extract | Light petroleum, dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | BACTEC Assay |
| Positive Control Used (conc.) | Rifampin |
| Inhibition [%] | 60 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Antiviral, anti-inflammatory |
| PubMed ID [Source Literature] | 12727485 |
| Extract Preparation | Soxhlet extraction, concentrated in vacuo to dryness |
| Chemical Classification [Active Compound] | |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against HCT - 116 (ATCC CCL - 247) |
| Reference(s) | 1) Murillo JI, Encarnación-Dimayuga R, Malmstrøm J, Christophersen C, Franzblau SG.Antimycobacterial flavones from Haplopappus sonorensis.Fitoterapia. 2003 Apr;74(3):226-30
|
| Curator | Gppreetha, vikramjitmandal |