| Compound ID | 2202 |
| Compound Structure | |
| Plant Source | Morinda citrifolia L. Common Name:Indian Mulberry (English), Ashyuka, Akshi, Atchy (Sanskrit) |
| Source Family | Rubiaceae |
| Origin | Malaysia, India |
| Plant Part Used | Leaf |
| Extract | Ethanol, hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth dilution assay using BACTEC system |
| Positive Control Used (conc.) | Rifampin (0.125 µg/ml) |
| Inhibition [%] | 89 and 95 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, joint pains, immune problems, pain relief, cellular regeneration, tuberculosis, respiratory disorders |
| PubMed ID [Source Literature] | 12410555 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Saludes JP, Garson MJ, Franzblau SG, Aguinaldo AM.Antitubercular constituents from the hexane fraction of Morinda citrifolia Linn. (Rubiaceae).Phytother Res. 2002 Nov;16(7):683-5
2) http://www.motherherbs.com/morinda-citrifolia.html
|
| Curator | |
| Compound ID | 2203 |
| Compound Structure |  |
| Plant Source | Morinda citrifolia L. Common Name:Indian Mulberry (English), Ashyuka, Akshi, Atchy (Sanskrit) |
| Source Family | Rubiaceae |
| Origin | Malaysia, India |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth dilution assay using BACTEC system |
| Positive Control Used (conc.) | Rifampin (0.125 µg/ml) |
| Inhibition [%] | Crude: 89% and Hexane: 95 % |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (E)-Phytol |
| PubChem ID | 5280435 |
| Ethnomedicinal Information | Asthma, joint pains, immune problems, pain relief, cellular regeneration, tuberculosis, respiratory disorders |
| PubMed ID [Source Literature] | 12410555 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Diterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 296.308 |
| Molecular Formula | C20H40O
|
| SMILES | OC/C=C(/CCC[C@@H](CCC[C@@H](CCCC(C)C)C)C)C |
| XLogP | 8.949 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Saludes JP, Garson MJ, Franzblau SG, Aguinaldo AM.Antitubercular constituents from the hexane fraction of Morinda citrifolia Linn. (Rubiaceae).Phytother Res. 2002 Nov;16(7):683-5
2) http://www.motherherbs.com/morinda-citrifolia.html
|
| Curator | |
| Compound ID | 2204 |
| Compound Structure |  |
| Plant Source | Morinda citrifolia L. Common Name:Indian Mulberry (English), Ashyuka, Akshi, Atchy (Sanskrit) |
| Source Family | Rubiaceae |
| Origin | Indo - Pacific region |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth dilution assay using BACTEC system |
| Positive Control Used (conc.) | Rifampin (0.125 µg/ml) |
| Inhibition [%] | Crude ethanol extract - 89 % and hexane fraction - 95 % |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cycloartenol |
| PubChem ID | 17750995 |
| Ethnomedicinal Information | Asthma, joint pains, immune problems, pain relief, cellular regeneration, tuberculosis, respiratory disorders |
| PubMed ID [Source Literature] | 12410555 |
| Extract Preparation | Dried leaves were extracted with ethanol to give a green, syrupy extract which was further partitioned into hexane DCM , EtOAc and n - BuOH fractions |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Cycloartane, Prenylated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Bactec 12B broth |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O
|
| SMILES | O[C@@H]1C([C@H]2[C@@]3([C@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CCC=C(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 11.921 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Saludes JP, Garson MJ, Franzblau SG, Aguinaldo AM.Antitubercular constituents from the hexane fraction of Morinda citrifolia Linn. (Rubiaceae).Phytother Res. 2002 Nov;16(7):683-5
2) http://www.motherherbs.com/morinda-citrifolia.html
|
| Curator | |