| Compound ID | 3711 |
| Compound Structure |  |
| Plant Source | Anethum graveolens L. Common Name:NR |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | NR |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium abscessus (ATCC 19977) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16317649 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Gibbons S.The antimycobacterial constituents of dill (Anethum graveolens).Phytother Res. 2005 Nov;19(11):938-41
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3712 |
| Compound Structure |  |
| Plant Source | Anethum graveolens L. Common Name:NR |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | NR |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16317649 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Gibbons S.The antimycobacterial constituents of dill (Anethum graveolens).Phytother Res. 2005 Nov;19(11):938-41
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3713 |
| Compound Structure |  |
| Plant Source | Anethum graveolens L. Common Name:NR |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | NR |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16317649 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Gibbons S.The antimycobacterial constituents of dill (Anethum graveolens).Phytother Res. 2005 Nov;19(11):938-41
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3714 |
| Compound Structure |  |
| Plant Source | Anethum graveolens L. Common Name:NR |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | NR |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Falcarindiol |
| PubChem ID | 6436239 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16317649 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 260.178 |
| Molecular Formula | C17H24O2 |
| SMILES | O[C@@H](/C=CCCCCCCC)C#CC#C[C@@H](O)C=C |
| XLogP | 4.573 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Gibbons S.The antimycobacterial constituents of dill (Anethum graveolens).Phytother Res. 2005 Nov;19(11):938-41
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3975 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name: |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium abcessus (ATCC 19977) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (128 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O
|
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | |
| Compound ID | 3974 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name: |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (4 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O
|
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | |
| Compound ID | 3756 |
| Compound Structure |  |
| Plant Source | Tetradium danielli Benn. Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Fruit |
| Extract | Hexane |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Dimethyl Octadienyloxy Furobenzopyran - 7 - One |
| PubChem ID | 5471349 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16981128 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Furanoid, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4 |
| SMILES | O(c1c2c(occ2)cc2oc(=O)ccc12)C/C=C(/CCC=C(C)C)C |
| XLogP | 5.237 |
| PSA | 39.440 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Adams M, Ettl S, Kunert O, Wube AA, Haslinger E, Bucar F, Bauer R.Antimycobacterial activity of geranylated furocoumarins from Tetradium daniellii.Planta Med. 2006 Oct;72(12):1132-5. Epub 2006 Sep 18
|
| Curator | Rachana, vikramjitmandal |
| Compound ID | 3796 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O |
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3799 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.25 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O |
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |
| Compound ID | 3800 |
| Compound Structure |  |
| Plant Source | Allium neapolitanum Common Name:NR |
| Source Family | Amaryllidaceae |
| Origin | Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | Columbia Blood Agar |
| Positive Control Used (conc.) | Ethambutol (0.25 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Canthin-6-one |
| PubChem ID | 97176 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17421058 |
| Extract Preparation | 6.3 kg of macerated bulb material underwent cold extraction with hexane, chloroform and methanol (3 l) |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Carbazole, Quinoline, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 220.064 |
| Molecular Formula | C14H8N2O |
| SMILES | O=c1n2c3c(c4c2cccc4)ccnc3cc1 |
| XLogP | 2.809 |
| PSA | 34.890 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) O'Donnell G, Gibbons S.Antibacterial activity of two canthin-6-one alkaloids from Allium neapolitanum.Phytother Res. 2007 Jul;21(7):653-7
|
| Curator | Najiya-beegum, vikramjitmandal |