| Compound ID | 1036 |
| Compound Structure | |
| Plant Source | Achyranthus aspera Linn. Common Name:Prickly Chaff Flower (English), Apaamaarga (Sanskrit) |
| Source Family | Amaranthaceae |
| Origin | India |
| Plant Part Used | Fruit, whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, bronchitis, expectorant, asthma, cough, pulmonary infections, skin diseases |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1037 |
| Compound Structure | |
| Plant Source | Achyranthus aspera Linn. Common Name:Prickly Chaff Flower (English), Apaamaarga (Sanskrit) |
| Source Family | Amaranthaceae |
| Origin | India |
| Plant Part Used | Fruit, whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, bronchitis, expectorant, asthma, cough, pulmonary infections, skin diseases |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1119 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1120 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1201 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Malaysia, Worldwide |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | 1:40 dilutions |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1202 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India, Malaysia, Worldwide |
| Plant Part Used | Seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | 1:40 dilutions |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1229 |
| Compound Structure | |
| Plant Source | Azadirachta indica A.juss. Common Name:Neem Tree, Margosa Tree (English), Nimba, Nimbaka (Sanskrit) |
| Source Family | Meliaceae |
| Origin | India, Kenya |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, asthma, consumption, phthisis, tuberculosis, anthelmintic, antiseptic. Used to treat chronic leprosy, skin diseases, intestinal worms, chronic malaria fevers, small pox, syphylictic sores |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Rao, R.R.Ethnobotanical studies on the flora of Meghalaya -- Some interesting reports of herbal medicines.1981, S.K. Jain (Ed.), 137-148
|
| Curator | |
| Compound ID | 1230 |
| Compound Structure | |
| Plant Source | Azadirachta indica A.juss. Common Name:Neem Tree, Margosa Tree (English), Nimba, Nimbaka (Sanskrit) |
| Source Family | Meliaceae |
| Origin | India, Kenya |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, asthma, consumption, phthisis, tuberculosis, anthelmintic, antiseptic. Used to treat chronic leprosy, skin diseases, intestinal worms, chronic malaria fevers, small pox, syphylictic sores |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Rao, R.R.Ethnobotanical studies on the flora of Meghalaya -- Some interesting reports of herbal medicines.1981, S.K. Jain (Ed.), 137-148
|
| Curator | |
| Compound ID | 1328 |
| Compound Structure | |
| Plant Source | Caesalpinia digyna Rottl. Common Name:Teri Pods (English), Vaakeri (Sanskrit) |
| Source Family | Caesalpiniaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:80 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Phthisis, glandular, intestinal and bone tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Patel, M.R., R.A. Bellare and C.V. Deliwala.Antitubercular action of Caesalpinia digyna Rottl. roots.IJEB 4, 4, 214-215
2) Anon., 1967. Antibacterial action of Vakeri root. Indian Journal of Pharmacy 29, 103–104.
|
| Curator | |
| Compound ID | 1329 |
| Compound Structure | |
| Plant Source | Caesalpinia digyna Rottl. Common Name:Teri Pods (English), Vaakeri (Sanskrit) |
| Source Family | Caesalpiniaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:80 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Phthisis, glandular, intestinal and bone tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Patel, M.R., R.A. Bellare and C.V. Deliwala.Antitubercular action of Caesalpinia digyna Rottl. roots.IJEB 4, 4, 214-215
2) Anon., 1967. Antibacterial action of Vakeri root. Indian Journal of Pharmacy 29, 103–104.
|
| Curator | |
| Compound ID | 1330 |
| Compound Structure | |
| Plant Source | Caesalpinia digyna Rottl. Common Name:Teri Pods (English), Vaakeri (Sanskrit) |
| Source Family | Caesalpiniaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Water:Ethanol (80:20) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | 1:80 dilution (It was 7 times more active than Ethanol extract and 5 times more active than aqueous extract) |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Phthisis, glandular, intestinal and bone tuberculosis |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) Patel, M.R., R.A. Bellare and C.V. Deliwala.Antitubercular action of Caesalpinia digyna Rottl. roots.IJEB 4, 4, 214-215
3) Anon., 1967. Antibacterial action of Vakeri root. Indian Journal of Pharmacy 29, 103–104.
|
| Curator | |
| Compound ID | 1410 |
| Compound Structure | |
| Plant Source | Centella asiatica (L.) Urban Common Name:Asiatic Pennywort, Indian Pennywort (English), Mandukaparni, Mandukaparnikaa (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Malaysia, India |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, treatment of leprosy and skin diseases |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://www.himalayahealthcare.com/herbfinder/h_centel.htm
|
| Curator | |
| Compound ID | 1411 |
| Compound Structure | |
| Plant Source | Centella asiatica (L.) Urban Common Name:Asiatic Pennywort, Indian Pennywort (English), Mandukaparni, Mandukaparnikaa (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Malaysia, India |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Asthma, treatment of leprosy and skin diseases |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) http://www.himalayahealthcare.com/herbfinder/h_centel.htm
|
| Curator | |
| Compound ID | 1525 |
| Compound Structure | |
| Plant Source | Commiphora mukul Engl. Common Name:Indian Bdellium tree (English), Guggulu (Sanskrit) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Resin |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 62.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculous glands of neck, asthma, troubles of chest, expectorant, bronchitis, whooping cough, pulmonary tuberculosis |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1526 |
| Compound Structure | |
| Plant Source | Commiphora mukul Engl. Common Name:Indian Bdellium Tree (English), Guggulu (Sanskrit) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Resin |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculous glands of neck, asthma, troubles of chest, expectorant, bronchitis, whooping cough, pulmonary tuberculosis |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1631 |
| Compound Structure | |
| Plant Source | Equisetum arvense L. Common Name:Field Horsetail (English), Ashwa - Puchha (Sanskrit) |
| Source Family | Equisetaceae |
| Origin | India, Britain and Northern temperate region |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Recommended and effective in treatment of tuberculosis by older herbalists. Proved very effectual in spitting of blood. |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1632 |
| Compound Structure | |
| Plant Source | Equisetum arvense L. Common Name:Field Horsetail (English), Ashwa - Puchha (Sanskrit) |
| Source Family | Equisetaceae |
| Origin | India, Britain and Northern temperate region |
| Plant Part Used | Leaf |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17 µg.ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Recommended and effective in treatment of tuberculosis by older herbalists. Proved very effectual in spitting of blood. |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1816 |
| Compound Structure | |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 1.14) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1817 |
| Compound Structure | |
| Plant Source | Glycyrrhiza glabra L. Common Name:Licorice, Liquorice (English), Yashtimadhu (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India, Africa |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (IC50 value 0.17) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Expectorant, consumption, bronchitis, chest complaint, cough |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1925 |
| Compound Structure | |
| Plant Source | Inula racemosa Hook. f. syn. Inula helenium L. Common Name:Elecampane (English), Pushkaramula, Pushkara, Paushkara, Padmapatra, Kaashmira, Kushtha - bheda (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium avium, Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis, lung disorders, cough, expectorant, random screening, bronchitis |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
|
| Curator | |
| Compound ID | 1960 |
| Compound Structure | |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 15.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1961 |
| Compound Structure | |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 17 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1962 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 14.4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Juniperexcelsic acid |
| PubChem ID | 490535 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alkene, Acetyl, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB cells |
| Molecular Weight | 362.246 |
| Molecular Formula | C22H34O4 |
| SMILES | O(C1[C@](C2[C@@](C(C(CC2)C)CCC(=C)C=C)(CC1)C)(C)C(=O)O)C(=O)C |
| XLogP | 6.661 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1963 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 15 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sandaracopimaric acid |
| PubChem ID | 221580 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB cells |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2
|
| SMILES | OC(=O)[C@]1([C@H]2[C@@]([C@@H]3C(=C[C@@](CC3)(C)C=C)CC2)(CCC1)C)C |
| XLogP | 6.935 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1964 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sclareol |
| PubChem ID | 73114 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alcohol, Alkene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB cells |
| Molecular Weight | 308.272 |
| Molecular Formula | C20H36O2
|
| SMILES | O[C@]1([C@@H]([C@@]2(C(C(CCC2)(C)C)CC1)C)CC[C@](O)(C)C=C)C |
| XLogP | 5.989 |
| PSA | 40.460 |
| H-bond Donor | 2 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
