| Compound ID | 1391 |
| Compound Structure | |
| Plant Source | Casuarina equisetifolia L. Common Name:Casuarina, She Oak (English), Jhaau (Sanskrit) |
| Source Family | Casuarinaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (1 µg/ml) |
| Inhibition [%] | 57 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diarrhoea, dysentery, stomach ache, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | The plants were dried, at a temperature not exceeding 30°C, in an air - circulating oven. The material was powdered and extracted with 95 % ethanol. The organic solvent was removed by distillation under reduced pressure |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
2) Sudhanshu Kumar Jain.Dictionary of Indian Folk Medicine and Ethnobotany:A Reference Manual of Man-Plant Relationships, Ethnic Groups & Ethnobotanists in India.Deep Publications, 1991 - 311 pages
|
| Curator | |
| Compound ID | 1392 |
| Compound Structure | |
| Plant Source | Casuarina equisetifolia L. Common Name:Casuarina, She Oak (English), Jhaau (Sanskrit) |
| Source Family | Casuarinaceae |
| Origin | India |
| Plant Part Used | Seed |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (1 µg/ml) |
| Inhibition [%] | 63 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diarrhoea, dysentery, stomach ache, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | The plants were dried, at a temperature not exceeding 30°C, in an air - circulating oven. The material was powdered and extracted with 95 % ethanol. The organic solvent was removed by distillation under reduced pressure |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
2) Sudhanshu Kumar Jain.Dictionary of Indian Folk Medicine and Ethnobotany:A Reference Manual of Man-Plant Relationships, Ethnic Groups & Ethnobotanists in India.Deep Publications, 1991 - 311 pages
|
| Curator | |
| Compound ID | 1393 |
| Compound Structure | |
| Plant Source | Casuarina equisetifolia L. Common Name:Casuarina, She Oak (English), Jhaau (Sanskrit) |
| Source Family | Casuarinaceae |
| Origin | India |
| Plant Part Used | Stem |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (1 µg/ml) |
| Inhibition [%] | 34 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Diarrhoea, dysentery, stomach ache, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | The plants were dried, at a temperature not exceeding 30°C, in an air - circulating oven. The material was powdered and extracted with 95 % ethanol. The organic solvent was removed by distillation under reduced pressure |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
2) Sudhanshu Kumar Jain.Dictionary of Indian Folk Medicine and Ethnobotany:A Reference Manual of Man-Plant Relationships, Ethnic Groups & Ethnobotanists in India.Deep Publications, 1991 - 311 pages
|
| Curator | |
| Compound ID | 1597 |
| Compound Structure | |
| Plant Source | Delonix regia (Bojer ex Hook.) Raf. Common Name:Flamboyant Flame Tree, Gold Mohur (English), Gulmohar (Sanskrit) |
| Source Family | Caesalpiniaceae |
| Origin | India, Puerto Rico |
| Plant Part Used | Stem |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (1 µg/ml) |
| Inhibition [%] | 60 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Spider bite, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
2) http://www.tropilab.com/delonix-reg.html
|
| Curator | |
| Compound ID | 1923 |
| Compound Structure | |
| Plant Source | Inula racemosa Hook. f. syn. Inula helenium L. Common Name:Elecampane (English), Pushkaramula, Pushkara, Paushkara, Padmapatra, Kaashmira, Kushtha - bheda (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Root |
| Extract | Hexane, dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 – 0.125 µg/ml) |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis, lung disorders, cough, expectorant, random screening, bronchitis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1924 |
| Compound Structure | |
| Plant Source | Inula racemosa Hook. f. syn. Inula helenium L. Common Name:Elecampane (English), Pushkaramula, Pushkara, Paushkara, Padmapatra, Kaashmira, Kushtha - bheda (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 – 0.125 µg/ml) |
| Inhibition [%] | 83 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis, lung disorders, cough, expectorant, random screening, bronchitis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1928 |
| Compound Structure |  |
| Plant Source | Inula racemosa Hook. f. syn. Inula helenium L. Common Name:Elecampane (English), Pushkaramula, Pushkara, Paushkara, Padmapatra, Kaashmira, Kushtha - bheda (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Root |
| Extract | Hexane, dichloromethane, methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Alantolactone |
| PubChem ID | 72724 |
| Ethnomedicinal Information | Tuberculosis, lung disorders, cough, expectorant,Random screening,bronchitis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2
|
| SMILES | O1[C@@H]2C[C@@]3(C(=C[C@@H]2C(=C)C1=O)[C@H](CCC3)C)C |
| XLogP | 3.443 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1929 |
| Compound Structure |  |
| Plant Source | Inula racemosa Hook. f. syn. Inula helenium L. Common Name:Elecampane (English), Pushkaramula, Pushkara, Paushkara, Padmapatra, Kaashmira, Kushtha - bheda (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India, USA |
| Plant Part Used | Root |
| Extract | Hexane, dichloromethane, methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Isoalantolactone |
| PubChem ID | 73285 |
| Ethnomedicinal Information | Tuberculosis, lung disorders, cough, expectorant, random screening, bronchitis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2
|
| SMILES | O1[C@@H]2C[C@@]3([C@@H](C[C@@H]2C(=C)C1=O)C(=C)CCC3)C |
| XLogP | 3.681 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1930 |
| Compound Structure |  |
| Plant Source | Inula racemosa Hook. f. syn. Inula helenium L. Common Name:Elecampane (English), Pushkaramula, Pushkara, Paushkara, Padmapatra, Kaashmira, Kushtha - bheda (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Root |
| Extract | Hexane, dichloromethane, methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 11, 13 - Dihydroisoalantolactone |
| PubChem ID | 474517 |
| Ethnomedicinal Information | Tuberculosis, lung disorders, cough, expectorant, random screening, bronchitis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 234.162 |
| Molecular Formula | C15H22O2
|
| SMILES | O1[C@H]2[C@H](C[C@@H]3[C@@](C2)(CCCC3=C)C)C(C1=O)C |
| XLogP | 3.863 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1943 |
| Compound Structure | |
| Plant Source | Jatropha gossypifolia L. Common Name:Tua - Tua (English), Rakta Vyaaghrairanda (Sanskrit) |
| Source Family | Euphorbiaceae |
| Origin | India, Puerto Rico |
| Plant Part Used | Aerial |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (1 g/ml) |
| Inhibition [%] | 51 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
2) Anonymous, 1986. The Useful Plants of India. Council of Scientific and Industrial Research, New Delhi, India
|
| Curator | |
| Compound ID | 2058 |
| Compound Structure | |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Stem |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (1 µg/ml) |
| Inhibition [%] | 19 % |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
|
| Curator | |
| Compound ID | 2059 |
| Compound Structure | |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (1) |
| Inhibition [%] | 82 % |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 11746852 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Antoun MD, Ramos Z, Vazques J, Oquendo I, Proctor GR, Gerena L, Franzblau SG.Evaluation of the flora of Puerto Rico for in vitro antiplasmodial and antimycobacterial activities.Phytother Res. 2001 Nov;15(7):638-42
|
| Curator | |
| Compound ID | 2100 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Costunolide |
| PubChem ID | 5281437 |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2
|
| SMILES | O1[C@H]2[C@@H](CC/C(=C/CC/C(=C/2)/C)/C)C(=C)C1=O |
| XLogP | 3.308 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2101 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Parthenolide |
| PubChem ID | 7251185 |
| Ethnomedicinal Information | Cytotoxic, anti-tumor, anti-bacterial, anti-fungal, anti-inflammatory, european fever, migraine |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1[C@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC/C(=C/CC2)/C)C |
| XLogP | 2.449 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2103 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Clarithroycin (1 - 2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Costunolide |
| PubChem ID | 5281437 |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2
|
| SMILES | O1[C@H]2[C@@H](CC/C(=C/CC/C(=C/2)/C)/C)C(=C)C1=O |
| XLogP | 3.308 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2104 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Clarithroycin (1 - 2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Parthenolide |
| PubChem ID | 7251185 |
| Ethnomedicinal Information | Cytotoxic, anti-tumor, anti-bacterial, anti-fungal, anti-inflammatory, european fever, migraine |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1[C@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC/C(=C/CC2)/C)C |
| XLogP | 2.449 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2106 |
| Compound Structure | |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | Flower |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Clarithromycin (32 µg/ml) |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening, Other u - methylene - g - lactone - bearing sesquiterpene lactones are moderately active against MT with MICs of 64, |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2 , Pages 137-145, April 1998
|
| Curator | |
| Compound ID | 2107 |
| Compound Structure | |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | Flower |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Clarithromycin (32 µg/ml) |
| Inhibition [%] | 91 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening, Other u - methylene - g - lactone - bearing sesquiterpene lactones are moderately active against MT with MICs of 64, |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2 , Pages 137-145, April 1998
|
| Curator | |
| Compound ID | 2108 |
| Compound Structure | |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | Fruit |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Clarithromycin (32 µg/ml) |
| Inhibition [%] | 80 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening, Other u - methylene - g - lactone - bearing sesquiterpene lactones are moderately active against MT with MICs of 64, |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2 , Pages 137-145, April 1998
|
| Curator | |
| Compound ID | 2109 |
| Compound Structure | |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | Fruit |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Clarithromycin (32 µg/ml) |
| Inhibition [%] | 84 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening, Other u - methylene - g - lactone - bearing sesquiterpene lactones are moderately active against MT with MICs of 64, |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2 , Pages 137-145, April 1998
|
| Curator | |
| Compound ID | 2110 |
| Compound Structure | |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | Leaf |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Clarithromycin (32 µg/ml) |
| Inhibition [%] | 88 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening, Other u - methylene - g - lactone - bearing sesquiterpene lactones are moderately active against MT with MICs of 64, |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2 , Pages 137-145, April 1998
|
| Curator | |
| Compound ID | 2111 |
| Compound Structure | |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | Leaf |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Clarithromycin (32 µg/ml) |
| Inhibition [%] | 92 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening, Other u - methylene - g - lactone - bearing sesquiterpene lactones are moderately active against MT with MICs of 64, |
| PubMed ID [Source Literature] | 23195767 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) C.L. Cantrell, N.H. Fischer, L. Urbatsch, M.S. McGuire, S.G. Franzblau.Antimycobacterial crude plant extracts from South, Central, and North America.Phytomedicine, Volume 5, Issue 2, April 1998, Pages 137–145
|
| Curator | |
| Compound ID | 2205 |
| Compound Structure |  |
| Plant Source | Morinda citrifolia L. Common Name:Indian Mulberry (English), Ashyuka, Akshi, Atchy (Sanskrit) |
| Source Family | Rubiaceae |
| Origin | Indo - Pacific region |
| Plant Part Used | Leaf |
| Extract | Ethanol, Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.125 µg/ml) |
| Inhibition [%] | Crude ethanol extract - 89 % and hexane fraction - 95 % |
| Activity [MIC] µg/ml | < 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Stigmasta - 4 - 22 - Dien - 3 - One |
| PubChem ID | 6479802 |
| Ethnomedicinal Information | Asthma, joint pains, immune problems, pain relief, cellular regeneration, tuberculosis, respiratory disorders |
| PubMed ID [Source Literature] | 12410555 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Ketone |
| Media / Broth Used [Antimicrobial Assay/Test] | Bactec 12B broth |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 424.371 |
| Molecular Formula | C30H48O
|
| SMILES | O=C1CC[C@@]2(C3C([C@]4([C@@]([C@H](CC4)C(C)/C=C/[C@H](C(C)C)CC)(CC3)C)C)CCC2=C1)C |
| XLogP | 11.670 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Saludes JP, Garson MJ, Franzblau SG, Aguinaldo AM.Antitubercular constituents from the hexane fraction of Morinda citrifolia Linn. (Rubiaceae).Phytother Res. 2002 Nov;16(7):683-5
2) http://www.motherherbs.com/morinda-citrifolia.html
|
| Curator | |
| Compound ID | 2206 |
| Compound Structure |  |
| Plant Source | Morinda citrifolia L. Common Name:Indian Mulberry (English), Ashyuka, Akshi, Atchy (Sanskrit) |
| Source Family | Rubiaceae |
| Origin | Indo - Pacific region |
| Plant Part Used | Leaf |
| Extract | Ethanol, Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.125 µg/ml) |
| Inhibition [%] | Crude ethanol extract - 89 % and hexane fraction - 95 % |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | β - sitosterol |
| PubChem ID | 222284 |
| Ethnomedicinal Information | Asthma, joint pains, immune problems, pain relief, cellular regeneration, tuberculosis, respiratory disorders |
| PubMed ID [Source Literature] | 12410555 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 414.386 |
| Molecular Formula | C29H50O
|
| SMILES | O[C@@H]1CC2=CC[C@H]3[C@H]4[C@@]([C@H](CC4)[C@@H](CC[C@H](C(C)C)CC)C)(CC[C@@H]3[C@]2(CC1)C)C |
| XLogP | 11.595 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Saludes JP, Garson MJ, Franzblau SG, Aguinaldo AM.Antitubercular constituents from the hexane fraction of Morinda citrifolia Linn. (Rubiaceae).Phytother Res. 2002 Nov;16(7):683-5
2) http://www.motherherbs.com/morinda-citrifolia.html
|
| Curator | |
| Compound ID | 2207 |
| Compound Structure |  |
| Plant Source | Morinda citrifolia L. Common Name:Indian Mulberry (English), Ashyuka, Akshi, Atchy (Sanskrit) |
| Source Family | Rubiaceae |
| Origin | Indo - Pacific region |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.125 µg/ml) |
| Inhibition [%] | Crude ethanol extract - 89 % and hexane fraction - 95 % |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Stigmasterol |
| PubChem ID | 5280794 |
| Ethnomedicinal Information | Asthma, joint pains, immune problems, pain relief, cellular regeneration, tuberculosis, respiratory disorders |
| PubMed ID [Source Literature] | 12410555 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 412.371 |
| Molecular Formula | C29H48O
|
| SMILES | O[C@@H]1CC2=CC[C@H]3[C@H]4[C@@]([C@H](CC4)[C@H](C)/C=C/[C@H](C(C)C)CC)(CC[C@@H]3[C@]2(CC1)C)C |
| XLogP | 11.071 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Saludes JP, Garson MJ, Franzblau SG, Aguinaldo AM.Antitubercular constituents from the hexane fraction of Morinda citrifolia Linn. (Rubiaceae).Phytother Res. 2002 Nov;16(7):683-5
2) http://www.motherherbs.com/morinda-citrifolia.html
|
| Curator | |