| Compound ID | 1122 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (Susceptible) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 160 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1123 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis TRC - C1193 (Isoniazid resistant) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1169 |
| Compound Structure | |
| Plant Source | Ammi visnaga (L.) Lam. syn.aucus visnaga L. Common Name:Khella (English) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Kidney stones, renal colic, antispasmodic, vasodilators, random screening |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
|
| Curator | |
| Compound ID | 1200 |
| Compound Structure | |
| Plant Source | Apium graveolens L. Common Name:Celery (English), Ajmodaa, Ajmoda, Ajmodikaa, Dipyaka (Sanskrit) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India |
| Plant Part Used | N/A |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, asthma, chest pain, cough, anthelmintic, antifungal, fever, urinary calculi, obesity, musculoskeletal disorder, dropsy, chronic diarrhoea |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) http://parisaramahiti.kar.nic.in/Medicinal_plants_new/med%20plants/p18.html
|
| Curator | |
| Compound ID | 1205 |
| Compound Structure | |
| Plant Source | Areca catechu L. Common Name:Arecanut, Betel Nut (English), Puuga, Puugi, Kramuka, Ghontaa, Guwaak, Ghorant (Sanskrit) |
| Source Family | Arecaceae (Palmae) |
| Origin | India, Malaysia |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilutions |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, diuretic, digestive, small pox, dysentery, colic, cholera, leucorrhoea, random screening, cough and sore throat |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) http://www.filipinoherbshealingwonders.filipinovegetarianrecipe.com/bunga.htm
|
| Curator | |
| Compound ID | 1209 |
| Compound Structure | |
| Plant Source | Artemisia absinthium L. Common Name:Wormwood, Maderwood, Absinthe (English), Indhana, Damar (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Chronic fever, swellings, inflammation of liver, rheumatism, wounds, dandruff, vermifuge, random screening |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
|
| Curator | |
| Compound ID | 1289 |
| Compound Structure | |
| Plant Source | Brassica nigra (L.) Koch. Common Name:Black Mustard (English), Banarasi Raai, Raajika (Sanskrit) |
| Source Family | Brassicaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, cough, sore throat |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
|
| Curator | |
| Compound ID | 1340 |
| Compound Structure | |
| Plant Source | Calotropis gigantea (L.) R. Br. ex Ait. Common Name:Madar (white-flowered), Giant Milk-weed (English), Alarka, Raajaarka, Shvetaarka (Sanskrit) |
| Source Family | Asclepiadaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy, asthma, expectorant, cough, asthma, leprosy |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1354 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangiferin |
| PubChem ID | 5281647 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 422.085 |
| Molecular Formula | C19H18O11 |
| SMILES | O1[C@H]([C@H](O)[C@@H](O)[C@H](O)[C@H]1CO)c1c(O)c2c(oc3c(c2=O)cc(O)c(O)c3)cc1O |
| XLogP | -2.646 |
| PSA | 188.140 |
| H-bond Donor | 8 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 11 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1355 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1,3,5-Trihydroxyxanthone |
| PubChem ID | 25200626 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 243.029 |
| Molecular Formula | C13H7O5 |
| SMILES | O1c2c(c(=O)c3c1c([O-])ccc3)c(O)cc(O)c2 |
| XLogP | 0.296 |
| PSA | 80.590 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1356 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3 - Dihydroxy - 5 - Methoxy - 9H - Xanthen - 9 - One |
| PubChem ID | 12026489 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 258.053 |
| Molecular Formula | C14H10O5 |
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)cccc2OC |
| XLogP | 0.815 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1357 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - Hydroxy - 3, 5 - Dimethoxyxanthen - 9 - One |
| PubChem ID | 5479773 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 272.068 |
| Molecular Formula | C15H12O5 |
| SMILES | O1c2c(c(=O)c3c1c(OC)ccc3)c(O)cc(OC)c2 |
| XLogP | 1.334 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1358 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 5, 6 - Tetrahydroxyxanthen - 9 - One |
| PubChem ID | 5479774 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 260.032 |
| Molecular Formula | C13H8O6
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)ccc(O)c2O |
| XLogP | -0.238 |
| PSA | 97.990 |
| H-bond Donor | 4 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1359 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 6 - Trihydroxy - 5 - Methoxyxanthen - 9 - One |
| PubChem ID | 5493675 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 274.048 |
| Molecular Formula | C14H10O6
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)ccc(O)c2OC |
| XLogP | -0.148 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1360 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 5 - Trihydroxy - 6 - Methoxyxanthen - 9 - One |
| PubChem ID | 5479775 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 274.048 |
| Molecular Formula | C14H10O6
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)ccc(OC)c2O |
| XLogP | -0.148 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1361 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3, 5 - Dimethoxy - 1, 6 - Dihydroxyxanthone |
| PubChem ID | 5281630 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 288.063 |
| Molecular Formula | C15H12O6
|
| SMILES | O1c2c(c(=O)c3c1cc(OC)cc3O)ccc(O)c2OC |
| XLogP | 0.371 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1362 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 5, 6, 7 - Pentahydroxyxanthen - 9 - One |
| PubChem ID | 10333643 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 276.027 |
| Molecular Formula | C13H8O7
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)cc(O)c(O)c2O |
| XLogP | -0.772 |
| PSA | 118.220 |
| H-bond Donor | 5 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1363 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 6, 7 - Trihydroxy - 3, 5 - Dimethoxyxanthen - 9 - One |
| PubChem ID | 5479777 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 304.058 |
| Molecular Formula | C15H12O7
|
| SMILES | O1c2c(c(=O)c3c1cc(OC)cc3O)cc(O)c(O)c2OC |
| XLogP | -0.163 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1364 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 7 - Dihydroxy - 3, 5, 6 - Trimethoxyxanthen - 9 - One |
| PubChem ID | 5491588 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 318.074 |
| Molecular Formula | C16H14O7
|
| SMILES | O1c2c(c(=O)c3c1cc(OC)cc3O)cc(O)c(OC)c2OC |
| XLogP | -0.073 |
| PSA | 85.220 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1447 |
| Compound Structure | |
| Plant Source | Cicuta virosa L Common Name:Water Hemlock (English) |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Spasmodic, random screening |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) Anon., 1986. The Useful Plants of India. Council of Scientific and Industrial Research, New Delhi, India
|
| Curator | |
| Compound ID | 1448 |
| Compound Structure | |
| Plant Source | Cinnamomum camphora (L.) Nees & Eberm Common Name:Camphor tree (English), Karpura, Ghanasaara, Chandra (Sanskrit) |
| Source Family | Lauraceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:80 and 1:1280 dilutions |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Leprosy |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) Sharma, S.K., 1998. Medicinal Plants Used in Ayurveda. National Academy of Ayurveda, Ministry of Health and Family Welfare, Govt. of India, New Delhi, India
|
| Curator | |
| Compound ID | 1460 |
| Compound Structure | |
| Plant Source | Citrullus colocynthis Schrad. Common Name:Colocynth Bitter Apple (English), Indravaaruni, Indravalli (Sanskrit) |
| Source Family | Cucurbitaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:80 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculous glands of neck, asthma, bronchitis, leprosy |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) Sharma, S.K., 1998. Medicinal Plants Used in Ayurveda. National Academy of Ayurveda, Ministry of Health and Family Welfare, Govt. of India, New Delhi, India
3) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1501 |
| Compound Structure | |
| Plant Source | Cocculus indicus Common Name: Indian Cockle (English) |
| Source Family | Menispermaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:40 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | The allied species C. hirsutus Diels for tubercular glands and cough, random screening |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1531 |
| Compound Structure | |
| Plant Source | Convolvulus arvensis L. Common Name:Deers Foot (English), Bhadrabalaa, Hiranpadi (Sanskrit) |
| Source Family | Convolvulaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | |
| Activity (In terms of dilution) | 1:80 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Fever, purgative, cathartic, random screening |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1564 |
| Compound Structure | |
| Plant Source | Croton tiglium L. Common Name:Purging Croton (English), Jayapaala, Dravanti, Dantibija, Tintidiphala (Sanskrit) |
| Source Family | Euphorbiaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (human) |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | |
| PubChem ID | NR |
| Ethnomedicinal Information | Bronchitis, expectorant |
| PubMed ID [Source Literature] | 2118130 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | N/A |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Reference(s) | 1) Grange JM, Davey RW.Detection of antituberculous activity in plant extracts.J Appl Bacteriol. 1990 Jun;68(6):587-91
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |