| Compound ID | 2531 |
| Compound Structure |  |
| Plant Source | Salvia Africana-lutea Common Name:Beach Salvia, Dune Salvia |
| Source Family | Lamiaceae |
| Origin | Africa |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Carnosic acid |
| PubChem ID | 65126 |
| Ethnomedicinal Information | Infections, tuberculosis, fever |
| PubMed ID [Source Literature] | 17256988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acetoxy, Acid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.199 |
| Molecular Formula | C20H28O4
|
| SMILES | OC(=O)[C@@]12[C@H](C(CCC1)(C)C)CCc1c2c(O)c(O)c(c1)C(C)C |
| XLogP | 5.183 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Hussein AA, Meyer JJ, Jimeno ML, Reodríguez B.Bioactive diterpenes from Orthosiphon labiatus and Salvia africana-luta.J Nat Prod. 2007 Feb;70(2):293-5
2) Seaman, T., 2005. The antimicrobial and antimycobacterial activity of plants used for the treatment of respiratory ailments in Southern Africa and the isolation of anacardic acid from Ozoroa paniculosa. M.Sc. Dissertation. University of the Witwatersrand, South Africa
|
| Curator | |
| Compound ID | 2532 |
| Compound Structure |  |
| Plant Source | Salvia Africana-lutea Common Name:Beach Salvia, Dune Salvia |
| Source Family | Lamiaceae |
| Origin | Africa |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 9 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Carnosic acid |
| PubChem ID | 65126 |
| Ethnomedicinal Information | Infections, tuberculosis, fever |
| PubMed ID [Source Literature] | 17256988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acetoxy, Acid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.199 |
| Molecular Formula | C20H28O4
|
| SMILES | OC(=O)[C@@]12[C@H](C(CCC1)(C)C)CCc1c2c(O)c(O)c(c1)C(C)C |
| XLogP | 5.183 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Hussein AA, Meyer JJ, Jimeno ML, Rodríguez B.Bioactive diterpenes from Orthosiphon labiatus and Salvia africana-lutea.J Nat Prod. 2007 Feb;70(2):293-5
|
| Curator | |
| Compound ID | 2533 |
| Compound Structure |  |
| Plant Source | Salvia Africana-lutea Common Name:Beach Salvia, Dune Salvia |
| Source Family | Lamiaceae |
| Origin | Africa |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Carnosic acid |
| PubChem ID | 65126 |
| Ethnomedicinal Information | Infections, tuberculosis, fever |
| PubMed ID [Source Literature] | 17256988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acetoxy, Acid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 332.199 |
| Molecular Formula | C20H28O4
|
| SMILES | OC(=O)[C@@]12[C@H](C(CCC1)(C)C)CCc1c2c(O)c(O)c(c1)C(C)C |
| XLogP | 5.183 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Hussein AA, Meyer JJ, Jimeno ML, Rodríguez B.Bioactive diterpenes from Orthosiphon labiatus and Salvia africana-lutea.J Nat Prod. 2007 Feb;70(2):293-5
2) Seaman, T., 2005. The antimicrobial and antimycobacterial activity of plants used for the treatment of respiratory ailments in Southern Africa and the isolation of anacardic acid from Ozoroa paniculosa. M.Sc. Dissertation. University of the Witwatersrand, South Africa
|
| Curator | |
| Compound ID | 3706 |
| Compound Structure |  |
| Plant Source | Kaempferia marginata Common Name:Tup Mup |
| Source Family | Zingiberaceae |
| Origin | Thailand |
| Plant Part Used | Whole plant |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml), Rifampin (0.0023 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2α - Acetoxysandaracopimaradien - 1α - Ol |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16309313 |
| Extract Preparation | The dried and milled whole plant (619 g) was extracted three times (3 × 2 l) by maceration with MeOH at room temperature. After filtration and evaporation of the solvent under reduced pressure, the combined crude MeOH extract was partitioned between CH2Cl2 and H2O to afford CH2Cl2 (41 g) and H2O - MeOH (22.8 g) extracts. The CH2Cl2 - soluble extract was subjected to silica gel column chromatography to yield the fractions |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acetoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2
|
| SMILES | C1(=O)CCC([C@H]2[C@]1([C@@H]1C(=C[C@@](CC1)(C)C=C)C[C@H]2O)C)(C)C |
| XLogP | 4.441 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Thongnest S, Mahidol C, Sutthivaiyakit S, Ruchirawat S.Oxygenated pimarane diterpenes from Kaempferia marginata.J Nat Prod. 2005 Nov;68(11):1632-6
|
| Curator | Gppreetha |