| Compound ID | 1301 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Rifampin (2.5 µg/disk) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5 µg/Disk |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1302 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1303 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium avium (ATCC 25291) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1304 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium scrofulaceum (ATCC 19981) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1305 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium microti (ATCC 19422) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1400 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3α - Hydroxy - 7, 24Z - dien - tirucalla - 26 - oic acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | C1C[C@@H](C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C)O |
| XLogP | 9.500 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1401 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3 - Oxo - 7, 24Z - Dien - Tirucalla - 26 - Oic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, ketone, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 454.345 |
| Molecular Formula | C30H46O3
|
| SMILES | C1CC(=O)C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C |
| XLogP | 8.893 |
| PSA | 54.370 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1402 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3α - Hydroxy - 7, 24Z - Dien - Tirucalla - 26 - Oic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | C1C[C@@H](C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C)O |
| XLogP | 9.500 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1403 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin(< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3 - Oxo - 7, 24Z - Dien - Tirucalla - 26 - Oic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, ketone, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 454.345 |
| Molecular Formula | C30H46O3
|
| SMILES | C1CC(=O)C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C |
| XLogP | 8.893 |
| PSA | 54.370 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1404 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3α - Hydroxy - 7, 24Z - Dien - Tirucalla - 26 - Oic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | C1C[C@@H](C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C)O |
| XLogP | 9.500 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1405 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3 - Oxo - 7, 24Z - Dien - Tirucalla - 26 - Oic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, ketone, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 454.345 |
| Molecular Formula | C30H46O3
|
| SMILES | C1CC(=O)C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C |
| XLogP | 8.893 |
| PSA | 54.370 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1406 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3α - Hydroxy - 7, 24Z - Dien - Tirucalla - 26 - Oic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | C1C[C@@H](C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C)O |
| XLogP | 9.500 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1407 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3 - Oxo - 7, 24Z - Dien - Tirucalla - 26 - Oic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, ketone, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 454.345 |
| Molecular Formula | C30H46O3
|
| SMILES | C1CC(=O)C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C |
| XLogP | 8.893 |
| PSA | 54.370 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1428 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ursolic acid |
| PubChem ID | 64945 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CC[C@H]([C@@H]3C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 8.954 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1481 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Clauszoline J |
| PubChem ID | NR |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Carbazole, Ether, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 271.084 |
| Molecular Formula | C15H13NO4
|
| SMILES | [nH]1c2c(cc(c(c2)OC)C(=O)O)c2c1cc(cc2)OC |
| XLogP | 2.559 |
| PSA | 71.550 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1514 |
| Compound Structure |  |
| Plant Source | Combretum imberbe Wawra Common Name:Leadwood |
| Source Family | Combretaceae |
| Origin | Africa |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.56 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Imberbic acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Combretum species used for chest coughs, fever, infections |
| PubMed ID [Source Literature] | 12657301 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Triterpene, Hydroxy, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 472.355 |
| Molecular Formula | C30H48O4 |
| SMILES | C1([C@H]2[C@@]([C@@H]3[C@@](CC2)([C@]2(C(=CC3)[C@H]3[C@@](CC2)(CC[C@](C3)(C(=O)O)C)C)C)C)([C@H](C[C@@H]1O)O)C)(C)C |
| XLogP | 7.389 |
| PSA | 77.760 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Katerere DR, Gray AI, Nash RJ, Waigh RD.Antimicrobial activity of pentacyclic triterpenes isolated from African Combretaceae.Phytochemistry. 2003 May;63(1):81-8
|
| Curator | |
| Compound ID | 1624 |
| Compound Structure |  |
| Plant Source | Elateriospermum tapos Blume Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Thailand |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.05 µg/ml), Kanamycin (1.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3.13 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 2, 3 - Seco - Taraxer - 14 - Ene - 2, 3, 28 - Trioic Acid 2, 3 - Dimethyl Ester |
| PubChem ID | 44448123 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 18179177 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Ester, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 530.361 |
| Molecular Formula | C32H50O6
|
| SMILES | OC(=O)[C@]12C([C@]3(C(=CC1)[C@]1(C([C@](C(CC1)C(C)(C)C(=O)OC)(CC(=O)OC)C)CC3)C)C)CC(CC2)(C)C |
| XLogP | 7.979 |
| PSA | 89.900 |
| H-bond Donor | 1 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Pattamadilok D, Suttisri R.Seco-terpenoids and other constituents from Elateriospermum tapos.J Nat Prod. 2008 Feb;71(2):292-4
|
| Curator | |
| Compound ID | 1931 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR (inactive) |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Operculinic acid |
| PubChem ID | 44584575 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 1018.520 |
| Molecular Formula | C46H82O24 |
| SMILES | O([C@@H]1O[C@H]([C@H](O[C@@H]2O[C@H]([C@H](O)[C@@H](O)[C@H]2O)C)[C@@H](O)[C@H]1O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)C)[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[C@H]1C)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]1O[C@H](CCCCCCCCCC(=O)O)CCCCC)C |
| XLogP | 1.041 |
| PSA | 372.360 |
| H-bond Donor | 13 |
| H-bond Acceptor | 24 |
| No. of Rotatable Bond Count | 25 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 24 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1932 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - Cinnamic Acid |
| PubChem ID | 444539 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 148.052 |
| Molecular Formula | C9H8O2 |
| SMILES | OC(=O)/C=C/c1ccccc1 |
| XLogP | 3.904 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1933 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Propanoic acid |
| PubChem ID | 1032 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Acid
|
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 74.037 |
| Molecular Formula | C3H6O2 |
| SMILES | OC(=O)CC |
| XLogP | 0.173 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1934 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Lauric acid |
| PubChem ID | 3893 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 200.178 |
| Molecular Formula | C12H24O2 |
| SMILES | OC(=O)CCCCCCCCCCC |
| XLogP | 5.294 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1959 |
| Compound Structure |  |
| Plant Source | Juniperus communis Linn. Common Name:Common Juniper (English), Hapushaa, Havushaa, Haauber, Matsyagandha (Sanskrit) |
| Source Family | Cupressaceae |
| Origin | Worldwide, Mexico, India, British Columbia, particularly in Europe |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - Communic Acid |
| PubChem ID | 637125 |
| Ethnomedicinal Information | Antiseptic properties. In France berries used in treatment of scrofula and chest complaints |
| PubMed ID [Source Literature] | 19755141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alkene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2 |
| SMILES | OC(=O)[C@@]1([C@H]2[C@@]([C@H](C(=C)CC2)C/C=C(C)/C=C)(CCC1)C)C |
| XLogP | 6.407 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Gordien AY, Gray AI, Franzblau SG, Seidel V.Antimycobacterial terpenoids from Juniperus communis L. (Cuppressaceae).J Ethnopharmacol. 2009 Dec 10;126(3):500-5
2) http://plants.usda.gov/java/profile?symbol=JUCO6
|
| Curator | |
| Compound ID | 1962 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 14.4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Juniperexcelsic acid |
| PubChem ID | 490535 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Alkene, Acetyl, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB cells |
| Molecular Weight | 362.246 |
| Molecular Formula | C22H34O4 |
| SMILES | O(C1[C@](C2[C@@](C(C(CC2)C)CCC(=C)C=C)(CC1)C)(C)C(=O)O)C(=O)C |
| XLogP | 6.661 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1963 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 15 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sandaracopimaric acid |
| PubChem ID | 221580 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10234860 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB cells |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2
|
| SMILES | OC(=O)[C@]1([C@H]2[C@@]([C@@H]3C(=C[C@@](CC3)(C)C=C)CC2)(CCC1)C)C |
| XLogP | 6.935 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Topçu G, Erenler R, Cakmak O, Johansson CB, Celik C, Chai HB, Pezzuto JM.Diterpenes from the berries of Juniperus excelsa.Phytochemistry. 1999 Apr;50(7):1195-9
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |
| Compound ID | 1966 |
| Compound Structure |  |
| Plant Source | Juniperus excelsa M. Bieb. Common Name:Grecian Juniper |
| Source Family | Cupressaceae |
| Origin | India, Saudi Arabia |
| Plant Part Used | Leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (-) - Sandaracopimaric acid |
| PubChem ID | 221580 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 302.225 |
| Molecular Formula | C20H30O2
|
| SMILES | OC(=O)[C@]1([C@H]2[C@@]([C@@H]3C(=C[C@@](CC3)(C)C=C)CC2)(CCC1)C)C |
| XLogP | 6.935 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) I. Muhammad*, J.S. Mossa, F.S. El-Feraly.Antibacterial diterpenes from the leaves and seeds of Juniperus excelsa M. Bieb.Phytotherapy Research, Volume 6, Issue 5, pages 261–264, September/October 1992
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Juniperus+excelsa
|
| Curator | |