| Compound ID | 1057 |
| Compound Structure |  |
| Plant Source | Adhatoda vasica Nees Common Name:Malabar Nut Tree (English), Vasaka (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ambroxol |
| PubChem ID | 2132 |
| Ethnomedicinal Information | Treatment of tuberculosis, asthma and also as expectorants, bronchial disorders such as acute and chronic cough, bronchitis |
| PubMed ID [Source Literature] | 8778507 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Cyclohexane, Amine, Haloginated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 375.979 |
| Molecular Formula | C13H18Br2N2O
|
| SMILES | Brc1c(N)c(CNC2CCC(O)CC2)cc(Br)c1 |
| XLogP | 2.524 |
| PSA | 58.280 |
| H-bond Donor | 3 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Grange JM, Snell NJ.Activity of bromhexine and ambroxol, semi-synthetic derivatives of vasicine from the Indian shrub Adhatoda vasica, against Mycobacterium tuberculosis in vitro.J Ethnopharmacol. 1996 Jan;50(1):49-53
|
| Curator | |
| Compound ID | 1084 |
| Compound Structure |  |
| Plant Source | Ailanthus altissima (Mill.) Swingle syn. Altissima glandulsa Desf. Common Name:Tree of Heaven, Ailanto (English), Aralu (Sanskrit) |
| Source Family | Simaroubaceae |
| Origin | India, China |
| Plant Part Used | Mother tinture |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin (0.031 µg/ml) |
| Inhibition [%] | 19 % |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Shinjulactone K |
| PubChem ID | 460541 |
| Ethnomedicinal Information | Used for treating mental illness, nausea and headache, treating cardiac palpitation, asthma and epilepsy |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Quassinoid, Lactone, O-Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 408.215 |
| Molecular Formula | C22H32O7 |
| SMILES | O1[C@H]2[C@@]3([C@@H]([C@@]4([C@@H](C2)[C@@H](C[C@H](O)C4=O)C)C)[C@H](O)[C@H](OC(=O)C)[C@@H]([C@@H]3CC1=O)C)C |
| XLogP | 1.595 |
| PSA | 110.130 |
| H-bond Donor | 2 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) Rahman S, Fukamiya N, Okano M, Tagahara K, Lee KH.Anti-tuberculosis activity of quassinoids.Chem Pharm Bull (Tokyo). 1997 Sep;45(9):1527-9
|
| Curator | |
| Compound ID | 1085 |
| Compound Structure |  |
| Plant Source | Ailanthus altissima (Mill.) Swingle syn. Altissima glandulsa Desf. Common Name:Tree of Heaven, Ailanto (English), Aralu (Sanskrit) |
| Source Family | Simaroubaceae |
| Origin | India, China |
| Plant Part Used | Mother tinture |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin (0.031 µg/ml) |
| Inhibition [%] | 17 % |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ailanthone |
| PubChem ID | 72965 |
| Ethnomedicinal Information | Used for treating mental illness, nausea and headache, treating cardiac palpitation, asthma and epilepsy |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Quassinoid, Furanoid, Lactone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 376.152 |
| Molecular Formula | C20H24O7 |
| SMILES | O1[C@]2(O)[C@H]3[C@]4([C@H](OC(=O)C[C@H]4C(=C)[C@H]2O)C[C@@H]2[C@@]3([C@H](O)C(=O)C=C2C)C)C1 |
| XLogP | -0.429 |
| PSA | 113.290 |
| H-bond Donor | 3 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) Rahman S, Fukamiya N, Okano M, Tagahara K, Lee KH.Anti-tuberculosis activity of quassinoids.Chem Pharm Bull (Tokyo). 1997 Sep;45(9):1527-9
|
| Curator | |
| Compound ID | 1281 |
| Compound Structure |  |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Flower, leaf, stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Fusidic acid (4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (3β, 24R) - 24, 25 - Epoxycycloartan - 3 - Ol |
| PubChem ID | 469545 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 8988597 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Cycloartane, Epoxy, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@H]1C([C@H]2[C@@]3([C@@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CC[C@H]3OC3(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 10.590 |
| PSA | 32.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Lu T, Fronczek FR, Fischer NH, Adams LB, Franzblau SG.Antimycobacterial cycloartanes from Borrichia frutescens.J Nat Prod. 1996 Dec;59(12):1131-6
|
| Curator | |
| Compound ID | 1301 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Disk Diffusion Assay |
| Positive Control Used (conc.) | Rifampin (2.5 µg/disk) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 5 µg/Disk |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1302 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1303 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium avium (ATCC 25291) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1304 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium scrofulaceum (ATCC 19981) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1305 |
| Compound Structure |  |
| Plant Source | Buddleja saligna L. Common Name:Squarestem Butterflybush |
| Source Family | Buddlejaceae |
| Origin | Africa |
| Plant Part Used | Leaf, stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium microti (ATCC 19422) |
| Assay / Test Done | Bioautography on TLC plates |
| Positive Control Used (conc.) | Rifampin (2.5 µg/spot) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/spot |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleanolic acid |
| PubChem ID | 10494 |
| Ethnomedicinal Information | Tuberculosis symptoms |
| PubMed ID [Source Literature] | 18384988 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 9.052 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bamuamba K, Gammon DW, Meyers P, Dijoux-Franca MG, Scott G.Anti-mycobacterial activity of five plant species used as traditional medicines in the Western Cape Province (South Africa).J Ethnopharmacol. 2008 May 8;117(2):385-90
|
| Curator | |
| Compound ID | 1316 |
| Compound Structure |  |
| Plant Source | Byrsonima crassa Common Name: |
| Source Family | Malpighiaceae |
| Origin | Brazil |
| Plant Part Used | Leaf |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 62.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Lupeol |
| PubChem ID | 44586882 |
| Ethnomedicinal Information | Treatment of gastric disorders, diarrhea and infections |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C([C@@H]5[C@@](CC4)(CC[C@H]5C(=C)C)C)CC3)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.901 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Leite, C.Q.F., Sato, D.N., Higuchi, C.T., Sannomiya, M., Pavan, F.R. and Vilegas W (2008).Antimycobacterial activity of Byrsonima crassa Nied leaf extracts. Revista Brasileira de PIantas Medicinais 10 (4):63-66
|
| Curator | |
| Compound ID | 1317 |
| Compound Structure |  |
| Plant Source | Byrsonima crassa Common Name: |
| Source Family | Malpighiaceae |
| Origin | Brazil |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 62.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Amyrin |
| PubChem ID | 73170 |
| Ethnomedicinal Information | Treatment of gastric disorders, diarrhea and infections |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CC[C@H]([C@@H]3C)C)C)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.448 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Leite, C.Q.F., Sato, D.N., Higuchi, C.T., Sannomiya, M., Pavan, F.R. and Vilegas W (2008).Antimycobacterial activity of Byrsonima crassa Nied leaf extracts. Revista Brasileira de PIantas Medicinais 10 (4):63-66
|
| Curator | |
| Compound ID | 1318 |
| Compound Structure |  |
| Plant Source | Byrsonima crassa Common Name: |
| Source Family | Malpighiaceae |
| Origin | Brazil |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 62.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | β-Amyrin |
| PubChem ID | 73145 |
| Ethnomedicinal Information | Treatment of gastric disorders, diarrhea and infections |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene. Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O |
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CCC(C3)(C)C)C)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 11.546 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Leite, C.Q.F., Sato, D.N., Higuchi, C.T., Sannomiya, M., Pavan, F.R. and Vilegas W (2008).Antimycobacterial activity of Byrsonima crassa Nied leaf extracts. Revista Brasileira de PIantas Medicinais 10 (4):63-66
|
| Curator | |
| Compound ID | 1335 |
| Compound Structure |  |
| Plant Source | Caesalpinia pulcherrima (L.) Sw. Common Name:Barbados Pride (English), Padangam, Ratnagandhi, Krishnachuudaa (Sanskrit) |
| Source Family | Caesalpiniaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml) and Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6β - Cinnamoyl - 7β - Hydroxyvouacapen - 5α - Ol |
| PubChem ID | 6479669 |
| Ethnomedicinal Information | Tuberculosis, bronchitis, asthma |
| PubMed ID [Source Literature] | 14531033 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Diterpene, Furanoid, Cinnamoyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB, BC, NCI - H187 cell lines |
| Molecular Weight | 464.256 |
| Molecular Formula | C29H36O5 |
| SMILES | O[C@]12[C@@]([C@@H]3[C@@H]([C@@H](O)[C@H]1OC(=O)/C=C/c1ccccc1)[C@H](c1c(occ1)C3)C)(CCCC2(C)C)C |
| XLogP | 7.503 |
| PSA | 79.900 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Promsawan N, Kittakoop P, Boonphong S, Nongkunsarn P.Antitubercular cassane furanoditerpenoids from the roots of Caesalpinia pulcherrima.Planta Med. 2003 Aug;69(8):776-7
2) Chopra, R.N., Nayar, S.L., Chopra, R.C., 1956. Glossary of Indian Medicinal Plants. Council of Scientific and Industrial Research, New Delhi, India
|
| Curator | |
| Compound ID | 1400 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3α - Hydroxy - 7, 24Z - dien - tirucalla - 26 - oic acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | C1C[C@@H](C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C)O |
| XLogP | 9.500 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1402 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3α - Hydroxy - 7, 24Z - Dien - Tirucalla - 26 - Oic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | C1C[C@@H](C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C)O |
| XLogP | 9.500 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1404 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3α - Hydroxy - 7, 24Z - Dien - Tirucalla - 26 - Oic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | C1C[C@@H](C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C)O |
| XLogP | 9.500 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1406 |
| Compound Structure |  |
| Plant Source | Celaenodendron mexicanum Common Name: |
| Source Family | Euphorbiaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3α - Hydroxy - 7, 24Z - Dien - Tirucalla - 26 - Oic Acid |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Nortriterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | C1C[C@@H](C(C2[C@]1([C@H]1C(=CC2)[C@@]2(C(CC1)(C(CC2)C(C)CC/C=C(/C)C(=O)O)C)C)C)(C)C)O |
| XLogP | 9.500 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1428 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ursolic acid |
| PubChem ID | 64945 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | O[C@@H]1C([C@H]2[C@@]([C@@H]3[C@]([C@]4(C(=CC3)[C@H]3[C@@](CC4)(CC[C@H]([C@@H]3C)C)C(=O)O)C)(CC2)C)(CC1)C)(C)C |
| XLogP | 8.954 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1430 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Farnesol |
| PubChem ID | 445070 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Sesquiterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O
|
| SMILES | OC/C=C(/CC/C=C(/CCC=C(C)C)C)C |
| XLogP | 4.346 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1555 |
| Compound Structure |  |
| Plant Source | Croton kongensis Common Name: |
| Source Family | Lamiaceae |
| Origin | China |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ent - 8, 9 - Seco - 8, 14 - Epoxy - 7α - Hydroxy - 11β - Acetoxy - 16 - Kauren - 9, 15 - Dione |
| PubChem ID | NR |
| Ethnomedicinal Information | Antimalarial activity, tuberculosis, dysmenorrheal treatment |
| PubMed ID [Source Literature] | 12828479, 1511068 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Sesquiterpene, Epoxy, Ketone, O-Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero, human epidermoid carcinoma in the mouth (KB) and human breast cancer cells (BC) |
| Molecular Weight | 376.189 |
| Molecular Formula | C21H28O6
|
| SMILES | C1CCC([C@@H]2C1C(=O)[C@H](CC1C3C(C(=O)C1=C)(C(C2)O)O3)OC(=O)C)(C)C |
| XLogP | 1.760 |
| PSA | 93.200 |
| H-bond Donor | 1 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Thongtan J, Kittakoop P, Ruangrungsi N, Saenboonrueng J, Thebtaranonth Y.New antimycobacterial and antimalarial 8,9-secokaurane diterpenes from Croton kongensis.J Nat Prod. 2003 Jun;66(6):868-70
2) Hendrix PG, Hoylaerts MF, Nouwen EJ, Van de Voorde A, De Broe ME.Magnetic beads in suspension enable a rapid and sensitive immunodetection of human placental alkaline phosphatase.Eur J Clin Chem Clin Biochem. 1992 Jun;30(6):343-7
|
| Curator | |
| Compound ID | 1556 |
| Compound Structure |  |
| Plant Source | Croton kongensis Common Name: |
| Source Family | Lamiaceae |
| Origin | China |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ent - 8, 9 - Seco - 7α - Hydroxy - 11β - Acetoxykaura - 8 (14), 16 - Dien - 9, 15 - Dione |
| PubChem ID | 3010861 |
| Ethnomedicinal Information | Antimalarial activity, tuberculosis, dysmenorrheal treatment |
| PubMed ID [Source Literature] | 12828479, 1511068 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Ketone, Alcohol, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero, human epidermoid carcinoma in the mouth (KB) and human breast cancer cells (BC) |
| Molecular Weight | 374.209 |
| Molecular Formula | C22H30O5
|
| SMILES | O=C1[C@]2([C@@H](C(CCC2)(C)C)C[C@@H](O)C2=C[C@@H](C[C@@H]1OC(=O)C)C(=C)C2=O)C |
| XLogP | 2.928 |
| PSA | 80.670 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Thongtan J, Kittakoop P, Ruangrungsi N, Saenboonrueng J, Thebtaranonth Y.New antimycobacterial and antimalarial 8,9-secokaurane diterpenes from Croton kongensis.J Nat Prod. 2003 Jun;66(6):868-70
2) Hendrix PG, Hoylaerts MF, Nouwen EJ, Van de Voorde A, De Broe ME.Magnetic beads in suspension enable a rapid and sensitive immunodetection of human placental alkaline phosphatase.Eur J Clin Chem Clin Biochem. 1992 Jun;30(6):343-7
|
| Curator | |
| Compound ID | 1687 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (2.93 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 57.29 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Shinanolone |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 192.079 |
| Molecular Formula | C11H12O3
|
| SMILES | C1(CCC(=O)c2c(cc(cc12)C)O)O |
| XLogP | 0.653 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1691 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (1.95 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 125 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Shinanolone |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 192.079 |
| Molecular Formula | C11H12O3
|
| SMILES | C1(CCC(=O)c2c(cc(cc12)C)O)O |
| XLogP | 0.653 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1695 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (3.26 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 166.67 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Shinanolone |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 192.079 |
| Molecular Formula | C11H12O3
|
| SMILES | C1(CCC(=O)c2c(cc(cc12)C)O)O |
| XLogP | 0.653 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |
| Compound ID | 1699 |
| Compound Structure |  |
| Plant Source | Euclea natalensis A. DC. Common Name:Natal Guarri, Natal Ebony, Large Leaved Guarri |
| Source Family | Ebenaceae |
| Origin | Africa |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium bovis ATCC |
| Assay / Test Done | Modified two - fold serial dilution assay |
| Positive Control Used (conc.) | Isoniazid (1.49 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3.74 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Shinanolone |
| PubChem ID | NR |
| Ethnomedicinal Information | Respiratory chest problems, coughs, tuberculosis |
| PubMed ID [Source Literature] | 18591787 |
| Extract Preparation | Powdered plant material was combined in a 1 : 10 ratio with solvent and shaken vigorously for 30 min using a mechanical shaker before being filtered through Whatman No. 1 filter paper. The solvent was removed in a stream of air and the residues redissolved in DMSO to a concentration of 200 mg/ml |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth supplemented with 10 % OADC medium |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 192.079 |
| Molecular Formula | C11H12O3
|
| SMILES | C1(CCC(=O)c2c(cc(cc12)C)O)O |
| XLogP | 0.653 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) McGaw LJ, Lall N, Hlokwe TM, Michel AL, Meyer JJ, Eloff JN.Purified compounds and extracts from Euclea species with antimycobacterial activity against Mycobacterium bovis and fast-growing mycobacteria.Biol Pharm Bull. 2008 Jul;31(7):1429-33
|
| Curator | |