| Compound ID | 1102 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1670 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1103 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3130 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1104 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium bovis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1340 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1105 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium chelonae |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1106 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1107 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium flavescens |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1108 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium gastri |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1109 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1110 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium kansasii |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2450 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1111 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium malmoense |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1112 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium marinum |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1113 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium scrofulaceum |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3010 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1114 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium simiae |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1115 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium szulgai |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1116 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium terrae |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2680 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1117 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium triviala |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1118 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium xenopi |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2680 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1429 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Squalene |
| PubChem ID | 638072 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Triterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 410.391 |
| Molecular Formula | C30H50
|
| SMILES | C(C/C=C(/CCC=C(C)C)C)/C(=C/CC/C=C(/CC/C=C(/CCC=C(C)C)C)C)/C |
| XLogP | 11.482 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1430 |
| Compound Structure |  |
| Plant Source | Chamaedora tepejilote Common Name:Pacaya Palm |
| Source Family | Arecaceae (Palmae) |
| Origin | Mexico |
| Plant Part Used | Leaf |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | 99 % |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Farnesol |
| PubChem ID | 445070 |
| Ethnomedicinal Information | Cough, Pneumonia |
| PubMed ID [Source Literature] | 16041726 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Sesquiterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O
|
| SMILES | OC/C=C(/CC/C=C(/CCC=C(C)C)C)C |
| XLogP | 4.346 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Jiménez A, Meckes M, Alvarez V, Torres J, Parra R. Secondary metabolites from Chamaedora tepejilote (Palmae) are active against Mycobacterium tuberculosis.Phytother Res. 2005 Apr;19(4):320-2
|
| Curator | |
| Compound ID | 1474 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Dentatin |
| PubChem ID | 342801 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Benzopyran, Alkene, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 326.152 |
| Molecular Formula | C20H22O4
|
| SMILES | O1c2c(C(C)(C)C=C)c3oc(=O)ccc3c(OC)c2C=CC1(C)C |
| XLogP | 4.812 |
| PSA | 35.530 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1475 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Nor - Dentatin |
| PubChem ID | 5495613 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Benzopyran, Alkene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 312.136 |
| Molecular Formula | C19H20O4
|
| SMILES | O1c2c(C(C)(C)C=C)c3oc(=O)ccc3c(O)c2C=CC1(C)C |
| XLogP | 4.293 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1476 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Clausenidin |
| PubChem ID | 5315947 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Chromone, Alkene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 328.131 |
| Molecular Formula | C19H20O5
|
| SMILES | O1C(CC(=O)c2c1c(C(C)(C)C=C)c1oc(=O)ccc1c2O)(C)C |
| XLogP | 3.411 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1493 |
| Compound Structure |  |
| Plant Source | Clinacanthus siamensis Brem. Common Name:Sophaghni, Vishaghni, Vishalata (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | Thailand |
| Plant Part Used | Fresh leaf |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 - 0.090 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - 3 - Methylthioacrylamide |
| PubChem ID | 11819072 |
| Ethnomedicinal Information | Poison bites, inflammation, traumatic edema and swelling due to poison stings. |
| PubMed ID [Source Literature] | 14646322 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Amide, Thioether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 117.025 |
| Molecular Formula | C4H7NOS
|
| SMILES | S(/C=C/C(=O)N)C |
| XLogP | 0.313 |
| PSA | 68.390 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 0 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 1 |
| Reference(s) | 1) Tuntiwachwuttikul P, Pootaeng-on Y, Pansa P, Srisanpang T, Taylor WC.Sulfur-containing compounds from Clinacanthus siamensis.Chem Pharm Bull (Tokyo). 2003 Dec;51(12):1423-5
2) http://ayurvedicmedicinalplants.com/index.php?option=com_zoom&Itemid=26&page=view&catid=3&key=63&hit=1
|
| Curator | |
| Compound ID | 1738 |
| Compound Structure |  |
| Plant Source | Ferula communis Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Saudi Arabia |
| Plant Part Used | Rhizome |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | |
| Positive Control Used (conc.) | Amikacin (0.25 µg/ml), Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3
|
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Mohammed A. Al-Yahya, Ilias Muhammad, Humayun H. Mirza, Farouk S. El-Feraly.Antibacterial constituents from the rhizomes of Ferula communis.Phytotherapy Research.12/1998;12(5):335-339
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Ferula+communis
|
| Curator | |
| Compound ID | 1932 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - Cinnamic Acid |
| PubChem ID | 444539 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 148.052 |
| Molecular Formula | C9H8O2 |
| SMILES | OC(=O)/C=C/c1ccccc1 |
| XLogP | 3.904 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |