| Compound ID | 1738 |
| Compound Structure |  |
| Plant Source | Ferula communis Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Saudi Arabia |
| Plant Part Used | Rhizome |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | |
| Positive Control Used (conc.) | Amikacin (0.25 µg/ml), Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3
|
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Mohammed A. Al-Yahya, Ilias Muhammad, Humayun H. Mirza, Farouk S. El-Feraly.Antibacterial constituents from the rhizomes of Ferula communis.Phytotherapy Research.12/1998;12(5):335-339
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Ferula+communis
|
| Curator | |
| Compound ID | 1788 |
| Compound Structure |  |
| Plant Source | Galipea officinalis Common Name:Angustura Vera |
| Source Family | Rutaceae |
| Origin | South America |
| Plant Part Used | Bark |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Isoniazid (0.12 µg/ml), Rifampin (0.001 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 4 - Methoxy - 2 - N - Pentylquinoleine |
| PubChem ID | 3009247 |
| Ethnomedicinal Information | Used to treat diarrhoea and fevers |
| PubMed ID [Source Literature] | 10232071 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkaloid, Quinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 229.147 |
| Molecular Formula | C15H19NO
|
| SMILES | O(c1cc(nc2c1cccc2)CCCCC)C |
| XLogP | 5.146 |
| PSA | 22.120 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Houghton PJ, Woldemariam TZ, Watanabe Y, Yates M.Activity against Mycobacterium tuberculosis of alkaloid constituents of Angostura bark, Galipea officinalis.Planta Med. 1999 Apr;65(3):250-4
|
| Curator | |
| Compound ID | 2355 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | P - Cymene (0.2 %) |
| PubChem ID | 7463 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Alkyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 134.110 |
| Molecular Formula | C10H14
|
| SMILES | C(c1ccc(cc1)C)(C)C |
| XLogP | 5.785 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2367 |
| Compound Structure | |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | P - Cymene (4.4 %) |
| PubChem ID | 7463 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Alkyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 134.110 |
| Molecular Formula | C10H14
|
| SMILES | C(c1ccc(cc1)C)(C)C |
| XLogP | 5.785 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2380 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Guineensine |
| PubChem ID | 6442405 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Amide, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 383.246 |
| Molecular Formula | C24H33NO3
|
| SMILES | O1c2cc(/C=C/CCCCCC/C=C/C=C/C(=O)NCC(C)C)ccc2OC1 |
| XLogP | 7.275 |
| PSA | 47.560 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2381 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Brachyamide B |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 327.183 |
| Molecular Formula | C20H25NO3 |
| SMILES | C1N(CCC1)C(=O)/C=C/CCCC/C=C/c1cc2c(cc1)OCO2 |
| XLogP | 5.013 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2382 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentosine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | The pulverized, dried fruits of Piper sarmentosum (2.39 kg) were extracted successively with hexane and MeOH in a Soxhlet apparatus. After removal of solvent in vacuo, the hexane extract (70.7 g) was subjected to quick CC (silica gel) eluting with hexane, hexane–CHCl3, CHCl3, CHCl3–MeOH and MeOH to give 6 main fractions |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 299.152 |
| Molecular Formula | C18H21NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 3.875 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2388 |
| Compound Structure | |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Brachyamide B |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 327.183 |
| Molecular Formula | C20H25NO3 |
| SMILES | C1N(CCC1)C(=O)/C=C/CCCC/C=C/c1cc2c(cc1)OCO2 |
| XLogP | 5.013 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2389 |
| Compound Structure | |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentosine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 299.152 |
| Molecular Formula | C18H21NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 3.875 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2457 |
| Compound Structure |  |
| Plant Source | Psoralea corylifoila L. Common Name:Babchi, Purple Fleabane (English), Somaraaji, Somavalli, Somavallik (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India |
| Plant Part Used | Seed |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (1.14 ± 0.02 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 15.79 ± 10.66 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bakuchiol |
| PubChem ID | 5468522 |
| Ethnomedicinal Information | Leprosy, asthma, bronchitis, respiratory diseases, various fevers, pulmonary disorders |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 256.183 |
| Molecular Formula | C18H24O |
| SMILES | Oc1ccc(/C=C/[C@](CCC=C(C)C)(C)C=C)cc1 |
| XLogP | 7.589 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2458 |
| Compound Structure | |
| Plant Source | Psoralea corylifoila L. Common Name:Babchi, Purple Fleabane (English), Somaraaji, Somavalli, Somavallik (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India |
| Plant Part Used | Seed |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Streptomycin (0.17 ± 0.04 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 500 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bakuchiol |
| PubChem ID | 5468522 |
| Ethnomedicinal Information | Leprosy, asthma, bronchitis, respiratory diseases, various fevers, pulmonary disorders |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 256.183 |
| Molecular Formula | C18H24O |
| SMILES | Oc1ccc(/C=C/[C@](CCC=C(C)C)(C)C=C)cc1 |
| XLogP | 7.589 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2459 |
| Compound Structure | |
| Plant Source | Psoralea corylifoila L. Common Name:Babchi, Purple Fleabane (English), Somaraaji, Somavalli, Somavallik (Sanskrit) |
| Source Family | Fabaceae |
| Origin | India |
| Plant Part Used | Seed |
| Extract | |
| Target Bacteria | Mycobacterium bovis |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 21.4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bakuchiol |
| PubChem ID | 5468522 |
| Ethnomedicinal Information | Leprosy, asthma, bronchitis, respiratory diseases, various fevers, pulmonary disorders |
| PubMed ID [Source Literature] | 11744296 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Terpene, Meroterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 256.183 |
| Molecular Formula | C18H24O |
| SMILES | Oc1ccc(/C=C/[C@](CCC=C(C)C)(C)C=C)cc1 |
| XLogP | 7.589 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Newton SM, Lau C, Gurcha SS, Besra GS, Wright CW.The evaluation of forty-three plant species for in vitro antimycobacterial activities; isolation of active constituents from Psoralea corylifolia and Sanguinaria canadensis.J Ethnopharmacol. 2002 Jan;79(1):57-67
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2825 |
| Compound Structure |  |
| Plant Source | Zanthoxylum wutaiense Common Name: |
| Source Family | Rutaceae |
| Origin | China |
| Plant Part Used | Root, wood |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 35 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 7 - Methoxywutaifuranal |
| PubChem ID | 24970511 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 18564877 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Aldehyde, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 202.063 |
| Molecular Formula | C12H10O3
|
| SMILES | O1c2c(cc(cc2OC)/C=C/C=O)cc1 |
| XLogP | 1.914 |
| PSA | 39.440 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Huang HY, Ishikawa T, Peng CF, Tsai IL, Chen IS.Constituents of the root wood of Zanthoxylum wutaiense with antitubercular activity.J Nat Prod. 2008 Jul;71(7):1146-51
|
| Curator | |
| Compound ID | 2833 |
| Compound Structure |  |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 10 - Gingerol |
| PubChem ID | 168115 |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Ketone, Ether, Phenol, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 350.246 |
| Molecular Formula | C21H34O4 |
| SMILES | O[C@@H](CCCCCCCCC)CC(=O)CCc1cc(OC)c(O)cc1 |
| XLogP | 5.163 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) R.D. Hiserodt,S.G. Franzblau and R.T. Rosen.Isolation of 6-, 8-, and 10-Gingerol from Ginger Rhizome by HPLC and Preliminary Evaluation of Inhibition of Mycobacterium avium and Mycobacterium tuberculosis.J. Agric. Food Chem., 1998, 46 (7), pp 2504–2508
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
3) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278.
|
| Curator | |
| Compound ID | 2834 |
| Compound Structure | |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 10 - Gingerol |
| PubChem ID | 168115 |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Ketone, Ether, Phenol, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 350.246 |
| Molecular Formula | C21H34O4 |
| SMILES | O[C@@H](CCCCCCCCC)CC(=O)CCc1cc(OC)c(O)cc1 |
| XLogP | 5.163 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) R.D. Hiserodt,S.G. Franzblau and R.T. Rosen.Isolation of 6-, 8-, and 10-Gingerol from Ginger Rhizome by HPLC and Preliminary Evaluation of Inhibition of Mycobacterium avium and Mycobacterium tuberculosis.J. Agric. Food Chem., 1998, 46 (7), pp 2504–2508
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
3) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278.
|
| Curator | |
| Compound ID | 2835 |
| Compound Structure |  |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 8 - Gingerol |
| PubChem ID | 5275725 |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Ketone, Ether, Alcohol, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 322.214 |
| Molecular Formula | C19H30O4 |
| SMILES | OC(CCCCCCC)CC(=O)CCc1cc(OC)c(O)cc1 |
| XLogP | 4.025 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) R.D. Hiserodt,S.G. Franzblau and R.T. Rosen.Isolation of 6-, 8-, and 10-Gingerol from Ginger Rhizome by HPLC and Preliminary Evaluation of Inhibition of Mycobacterium avium and Mycobacterium tuberculosis.J. Agric. Food Chem., 1998, 46 (7), pp 2504–2508
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
3) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278.
|
| Curator | |
| Compound ID | 2862 |
| Compound Structure |  |
| Plant Source | Helichrysum aureonitens Common Name:Golden Everlasting |
| Source Family | Asteraceae (Compositae) |
| Origin | Africa |
| Plant Part Used | Callus tissue from young leaf |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27264) |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | Isoniazid (0.2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4 - Chloro - 2 - (Hepta - 1, 3, 5 - Triyn - 1 - yl) - Phenol |
| PubChem ID | NR |
| Ethnomedicinal Information | Anticancer activity, inhibition on DNA topoisomerase I |
| PubMed ID [Source Literature] | 19881282 |
| Extract Preparation | Cell suspension culture |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkyne, Phenol, Haloginated |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against Vero and Human prostate epithelial carcinoma DU 145 cell lines |
| Molecular Weight | 214.019 |
| Molecular Formula | C13H7ClO |
| SMILES | C1(cc(c(cc1)O)C#CC#CC#CC)Cl |
| XLogP | 3.971 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Ziaratnia SM, Ohyama K, Hussein AA, Muranaka T, Lall N, Kunert KJ, Meyer JJ.Isolation and identification of a novel chlorophenol from a cell suspension culture of Helichrysum aureonitens.Chem Pharm Bull (Tokyo). 2009 Nov;57(11):1282-3
|
| Curator | Gppreetha, keyamukherjee, reshmi |
| Compound ID | 3074 |
| Compound Structure | |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3 |
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3075 |
| Compound Structure | |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (8 µg/ml), Isoniazid (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3 |
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3076 |
| Compound Structure | |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (4 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3 |
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3077 |
| Compound Structure | |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 0.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3 |
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vsheeba, vikramjitmandal |
| Compound ID | 3078 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (8 µg/ml), Isoniazid (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3079 |
| Compound Structure | |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (4 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3080 |
| Compound Structure | |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3081 |
| Compound Structure | |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium smegmatis (ATCC 144680) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
