| Compound ID | 2826 |
| Compound Structure |  |
| Plant Source | Zanthoxylum wutaiense Common Name: |
| Source Family | Rutaceae |
| Origin | China |
| Plant Part Used | Root, wood |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 30 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Wutaiensal |
| PubChem ID | 25015068 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 18564877 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Benzofuranoid, Aldehyde, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 262.121 |
| Molecular Formula | C15H18O4 |
| SMILES | O1[C@H](C(O)(C)C)Cc2c1c(OC)cc(c2)/C=C/C=O |
| XLogP | 1.873 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Huang HY, Ishikawa T, Peng CF, Tsai IL, Chen IS.Constituents of the root wood of Zanthoxylum wutaiense with antitubercular activity.J Nat Prod. 2008 Jul;71(7):1146-51
|
| Curator | |
| Compound ID | 2865 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2866 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35822) (Isoniazid resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2867 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35838) (Rifampin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2868 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35820) (Streptomycin resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2869 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 35837) (Ethambutol resistant) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2870 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate MMDO) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 L of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2871 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY650) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2872 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY663) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2873 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY675) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2874 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY282) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2875 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate HG8) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2876 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate SIN3) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2877 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY234) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2878 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY112) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2879 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY559) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2880 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (Clinical isolate SIN4) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | J774A.1 murine macrophage cell line (ATCC HB - 197) using the trypan blue exclusion test |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4 |
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | Vikramjitmandal |
| Compound ID | 2881 |
| Compound Structure |  |
| Plant Source | Aristolochia taliscana Hook. Common Name:Dutchman's Pipes |
| Source Family | Aristolochiaceae |
| Origin | Mexico |
| Plant Part Used | Root |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium tuberculosis (clinical isolate MTY172) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin (0.5 µg/ml), Isoniazid (0.06 µg/ml), Rifampin (0.1 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Licarin B |
| PubChem ID | 5384942 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 20209328 |
| Extract Preparation | Powdered air - dried roots (1.5 kg) were macerated (3 × 48 h) with 12 l of n - Hexane. The extract was filtered and evaporated in vacuo to yield 33 g of the crude extract |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzofuranoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4 |
| SMILES | O1C([C@H](c2c1c(OC)cc(c2)/C=C/C)C)c1cc2OCOc2cc1 |
| XLogP | 4.809 |
| PSA | 36.920 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) León-Díaz R, Meckes M, Said-Fernández S, Molina-Salinas GM, Vargas-Villarreal J, Torres J, Luna-Herrera J, Jiménez-Arellanes A.Antimycobacterial neolignans isolated from Aristolochia taliscana.Mem Inst Oswaldo Cruz. 2010 Feb;105(1):45-51
|
| Curator | |
| Compound ID | 3361 |
| Compound Structure |  |
| Plant Source | Amyris elemifera Common Name:NR |
| Source Family | Rutaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 100 µg/ml, 7H11 agar: 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Heraclenol |
| PubChem ID | 328236 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Benzofuranoid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 304.095 |
| Molecular Formula | C16H16O6 |
| SMILES | O(CC(O)C(O)(C)C)c1c2occc2cc2c1oc(=O)cc2 |
| XLogP | 1.710 |
| PSA | 79.900 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3362 |
| Compound Structure |  |
| Plant Source | Amyris elemifera Common Name:NR |
| Source Family | Rutaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium 733 |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 100 µg/ml, 7H11 agar: 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Heraclenol |
| PubChem ID | 328236 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Benzofuranoid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 304.095 |
| Molecular Formula | C16H16O6 |
| SMILES | O(CC(O)C(O)(C)C)c1c2occc2cc2c1oc(=O)cc2 |
| XLogP | 1.710 |
| PSA | 79.900 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3363 |
| Compound Structure |  |
| Plant Source | Amyris elemifera Common Name:NR |
| Source Family | Rutaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium kansasii (Clinical isolate 94 - 069) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: > 100 µg/ml, 7H11 agar: 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Heraclenol |
| PubChem ID | 328236 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Benzofuranoid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 304.095 |
| Molecular Formula | C16H16O6 |
| SMILES | O(CC(O)C(O)(C)C)c1c2occc2cc2c1oc(=O)cc2 |
| XLogP | 1.710 |
| PSA | 79.900 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3392 |
| Compound Structure |  |
| Plant Source | Erythrina gibbosa Common Name:NR |
| Source Family | Fabaceae |
| Origin | Panamanian |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 - 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Phaseolidine |
| PubChem ID | 119268 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Benzopyran, Benzofuranoid, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4 |
| SMILES | O1[C@@H]2[C@H](c3c1c(c(O)cc3)CC=C(C)C)COc1c2ccc(O)c1 |
| XLogP | 3.265 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
|
| Curator | Wvarsha, keyamukherjee, rachanake |
| Compound ID | 3759 |
| Compound Structure |  |
| Plant Source | Artcarpus rigidus BLUME subsp. rigidus Common Name:NR |
| Source Family | Moraceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Artonin F |
| PubChem ID | 14680593 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 17015984 |
| Extract Preparation | The dried root bark (1.5 kg) was milled and extracted successively with n - hexane, CHCl3 and MeOH in a Soxhlet extraction apparatus. The extracts were evaporated to dryness under reduced pressure at about 40°C. The hexane extract (brownish syrup, 8.4 g), the CHCl3 extract (dark brownish sticky solid, 16.1 g) and the methanolic extract (dark brownish mass, 45.6 g) were obtained, respectively |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Flavonoid, Benzopyran, Benzofuranoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against human epidermoid carcinoma in the mouth (KB), human breast cancer cells (BC), human lung cancer cells (NCI - H187) |
| Molecular Weight | 502.199 |
| Molecular Formula | C30H30O7 |
| SMILES | O1C(C2c3c1c(O)cc(O)c3c1oc3c(c(=O)c1C2)c(O)c(c1OC(C=Cc31)(C)C)CC=C(C)C)(C)C |
| XLogP | 3.394 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Namdaung U, Aroonrerk N, Suksamrarn S, Danwisetkanjana K, Saenboonrueng J, Arjchomphu W, Suksamrarn A.Bioactive constituents of the root bark of Artocarpus rigidus subsp. rigidus.Chem Pharm Bull (Tokyo). 2006 Oct;54(10):1433-6
|
| Curator | Reshmi, vikramjitmandal, rachanake |