| Compound ID | 2298 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name:Devil's Backbone, Zigzag Plant, Jacob's Ladder |
| Source Family | Euphorbiaceae |
| Origin | Thailand, Tropical America |
| Plant Part Used | Milky juice or latex |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1α, 13β, 14α - trihydroxy - 3β, 7β - dibenzoyloxy - 9β, 15β - diacetoxyjatropha - 5, 11 E - diene |
| PubChem ID | 23642402 |
| Ethnomedicinal Information | Anti - inflammatory, antioxidant, anti - malaria |
| PubMed ID [Source Literature] | 17844996 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Benzoyl, Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 678.304 |
| Molecular Formula | C38H46O11
|
| SMILES | O([C@@]12[C@H]([C@@H](OC(=O)c3ccccc3)[C@H]([C@@H]1O)C)/C=C([C@H](OC(=O)c1ccccc1)C[C@H](OC(=O)C)C(/C=C/[C@](O)([C@H]2O)C)(C)C)/C)C(=O)C |
| XLogP | 6.947 |
| PSA | 165.890 |
| H-bond Donor | 3 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 11 |
| No. of S | 0 |
| Reference(s) | 1) Mongkolvisut W, Sutthivaiyakit S.Antimalarial and antituberculous poly-O-acylated jatrophane diterpenoids from Pedilanthus tithymaloides.J Nat Prod. 2007 Sep;70(9):1434-8
2) http://www.flowersofIndia.net/catalog/slides/Devil%27s%20Backbone.html
|
| Curator | |
| Compound ID | 2299 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name:Devil's Backbone, Zigzag Plant, Jacob's Ladder |
| Source Family | Euphorbiaceae |
| Origin | Thailand, Tropical America |
| Plant Part Used | Milky juice or latex |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1α, 7β, 13β, 14α - tetrahydroxy - 3β - benzoyloxy - 9β, 15β - diacetoxyjatropha - 5,11 E - diene |
| PubChem ID | 23642403 |
| Ethnomedicinal Information | Anti - inflammatory, antioxidant, anti - malaria |
| PubMed ID [Source Literature] | 17844996 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Benzoyl, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 574.278 |
| Molecular Formula | C31H42O10
|
| SMILES | O([C@@]12[C@H]([C@@H](OC(=O)c3ccccc3)[C@H]([C@@H]1O)C)/C=C([C@H](O)C[C@H](OC(=O)C)C(/C=C/[C@](O)([C@H]2O)C)(C)C)/C)C(=O)C |
| XLogP | 3.461 |
| PSA | 159.820 |
| H-bond Donor | 4 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Mongkolvisut W, Sutthivaiyakit S.Antimalarial and antituberculous poly-O-acylated jatrophane diterpenoids from Pedilanthus tithymaloides.J Nat Prod. 2007 Sep;70(9):1434-8
2) http://www.flowersofIndia.net/catalog/slides/Devil%27s%20Backbone.html
|
| Curator | |
| Compound ID | 2300 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name:Devil's Backbone, Zigzag Plant, Jacob's Ladder |
| Source Family | Euphorbiaceae |
| Origin | Thailand, Tropical America |
| Plant Part Used | Milky juice or latex |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1α, 8β, 9β, 14α, 15β - pentaacetoxy - 3β - benzoyloxy - 7 - oxojatropha - 5, 12 - diene |
| PubChem ID | 23642498 |
| Ethnomedicinal Information | Anti - inflammatory, antioxidant, anti - malaria |
| PubMed ID [Source Literature] | 17844996 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Ketone, Benzoyl, Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 698.294 |
| Molecular Formula | C37H46O13
|
| SMILES | O([C@@]12[C@H]([C@@H](OC(=O)c3ccccc3)[C@H]([C@@H]1OC(=O)C)C)/C=C(C(=O)[C@H](OC(=O)C)[C@H](OC(=O)C)C(C/C=C(/[C@H]2OC(=O)C)C)(C)C)/C)C(=O)C |
| XLogP | 5.514 |
| PSA | 174.870 |
| H-bond Donor | 0 |
| H-bond Acceptor | 13 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 13 |
| No. of S | 0 |
| Reference(s) | 1) Mongkolvisut W, Sutthivaiyakit S.Antimalarial and antituberculous poly-O-acylated jatrophane diterpenoids from Pedilanthus tithymaloides.J Nat Prod. 2007 Sep;70(9):1434-8
2) http://www.flowersofIndia.net/catalog/slides/Devil%27s%20Backbone.html
|
| Curator | |
| Compound ID | 2301 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name:Devil's Backbone, Zigzag Plant, Jacob's Ladder |
| Source Family | Euphorbiaceae |
| Origin | Thailand,Tropical America |
| Plant Part Used | Milky juice or latex |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 7, 8β, 9β, 14α, 15β - Pentaacetoxy - 3β - benzoyloxy - 1α, 5β - dihydroxyjatropha - 6 (7), 12 - diene |
| PubChem ID | 23642499 |
| Ethnomedicinal Information | Anti - inflammatory, antioxidant, anti - malaria |
| PubMed ID [Source Literature] | 17844996 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Benzoyl, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 716.304 |
| Molecular Formula | C37H48O14
|
| SMILES | O([C@@]12[C@H]([C@@H](OC(=O)c3ccccc3)[C@H]([C@@H]1O)C)[C@H](O)/C(=C(/OC(=O)C)[C@H](OC(=O)C)[C@H](OC(=O)C)C(C/C=C(/[C@H]2OC(=O)C)C)(C)C)/C)C(=O)C |
| XLogP | 4.498 |
| PSA | 198.260 |
| H-bond Donor | 2 |
| H-bond Acceptor | 14 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 14 |
| No. of S | 0 |
| Reference(s) | 1) Mongkolvisut W, Sutthivaiyakit S.Antimalarial and antituberculous poly-O-acylated jatrophane diterpenoids from Pedilanthus tithymaloides.J Nat Prod. 2007 Sep;70(9):1434-8
2) http://www.flowersofIndia.net/catalog/slides/Devil%27s%20Backbone.html
|
| Curator | |
| Compound ID | 2302 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name:Devil's Backbone, Zigzag Plant, Jacob's Ladder |
| Source Family | Euphorbiaceae |
| Origin | Thailand,Tropical America |
| Plant Part Used | Milky juice or latex |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.1 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1α, 7, 8β, 9β, 14α, 15β - Hexaacetoxy - 3β - benzoyloxy - 5β - hydroxyjatropha - 6 (7), 12 - diene |
| PubChem ID | 23642500 |
| Ethnomedicinal Information | Anti - inflammatory, antioxidant, anti - malaria |
| PubMed ID [Source Literature] | 17844996 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Benzoyl, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 758.315 |
| Molecular Formula | C39H50O15
|
| SMILES | O([C@@]12[C@H]([C@@H](OC(=O)c3ccccc3)[C@H]([C@@H]1OC(=O)C)C)[C@H](O)/C(=C(/OC(=O)C)[C@H](OC(=O)C)[C@H](OC(=O)C)C(C/C=C(/[C@H]2OC(=O)C)C)(C)C)/C)C(=O)C |
| XLogP | 5.238 |
| PSA | 204.330 |
| H-bond Donor | 1 |
| H-bond Acceptor | 15 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 15 |
| No. of S | 0 |
| Reference(s) | 1) Mongkolvisut W, Sutthivaiyakit S.Antimalarial and antituberculous poly-O-acylated jatrophane diterpenoids from Pedilanthus tithymaloides.J Nat Prod. 2007 Sep;70(9):1434-8
2) http://www.flowersofIndia.net/catalog/slides/Devil%27s%20Backbone.html
|
| Curator | |
| Compound ID | 2562 |
| Compound Structure |  |
| Plant Source | Sapium indicum L. Common Name:Huma (English) |
| Source Family | Euphorbiaceae |
| Origin | India |
| Plant Part Used | Fruit |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3.12 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sapintoxin A |
| PubChem ID | 108085 |
| Ethnomedicinal Information | Purgative, insanity, poisonous in nature, intoxicating fish |
| PubMed ID [Source Literature] | 12713411 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Diterpene, Phorbol, Acetyl, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 523.257 |
| Molecular Formula | C30H37NO7
|
| SMILES | O([C@@]12[C@@H](C1(C)C)[C@H]1[C@](O)([C@@H]([C@H]2OC(=O)c2c(NC)cccc2)C)[C@H]2[C@H](CC(=C1)CO)C(=O)C(=C2)C)C(=O)C |
| XLogP | 2.630 |
| PSA | 122.160 |
| H-bond Donor | 3 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Chumkaew P, Karalai C, Ponglimanont C, Chantrapromma K. Antimycobacterial activity of phorbol esters from the fruits of Sapium indicum. J Nat Prod. 2003 Apr;66(4):540-3
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2563 |
| Compound Structure |  |
| Plant Source | Sapium indicum L. Common Name:Huma (English) |
| Source Family | Euphorbiaceae |
| Origin | India |
| Plant Part Used | Fruit |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sapintoxin C |
| PubChem ID | 157367 |
| Ethnomedicinal Information | Purgative, insanity, poisonous in nature, intoxicating fish |
| PubMed ID [Source Literature] | 12713411 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Diterpene, Benzoyl, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 523.257 |
| Molecular Formula | C30H37NO7
|
| SMILES | O([C@@]12[C@@H](C1(C)C)[C@H]1[C@](O)([C@@H]([C@H]2OC(=O)c2c(NC)cccc2)C)[C@H]2[C@H]([C@H](O)C(=C1)C)C(=O)C(=C2)C)C(=O)C |
| XLogP | 2.903 |
| PSA | 122.160 |
| H-bond Donor | 3 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Chumkaew P, Karalai C, Ponglimanont C, Chantrapromma K. Antimycobacterial activity of phorbol esters from the fruits of Sapium indicum. J Nat Prod. 2003 Apr;66(4):540-3
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 3078 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (8 µg/ml), Isoniazid (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3079 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (4 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3080 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3081 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium smegmatis (ATCC 144680) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (1 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | E - ω - Benzoyloxyferulenol |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol, Benzoyl |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 486.241 |
| Molecular Formula | C31H34O5
|
| SMILES | C1ccc2c(c1)c(c(c(=O)o2)C/C=C(/CC/C=C(/CC/C=C(/COC(=O)c1ccccc1)C)C)C)O |
| XLogP | 8.550 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vikramjitmandal |
| Compound ID | 3225 |
| Compound Structure |  |
| Plant Source | Ceasalpinia pulcherrima (L.) Sw. Common Name:Barbados Pride (English), Padangam, Ratnagandhi, Krishnachuudaa (Sanskrit) |
| Source Family | Caesalpiniaceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 - 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 6β - Benzoyl - 7β - Hydroxyvouacapen - 5 α - Ol |
| PubChem ID | 3009285 |
| Ethnomedicinal Information | Bronchitis, asthma |
| PubMed ID [Source Literature] | 14531033 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Diterpene, Furanoid, Benzoyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against KB, BC, NCI - H187 cell lines |
| Molecular Weight | 438.241 |
| Molecular Formula | C27H34O5 |
| SMILES | O[C@]12[C@@]([C@@H]3[C@@H]([C@@H](O)[C@H]1OC(=O)c1ccccc1)[C@H](c1c(occ1)C3)C)(CCCC2(C)C)C |
| XLogP | 6.265 |
| PSA | 79.900 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Promsawan N, Kittakoop P, Boonphong S, Nongkunsarn P.Antitubercular cassane furanoditerpenoids from the roots of Caesalpinia pulcherrima.Planta Med. 2003 Aug;69(8):776-7
2) Chopra, R.N., Nayar, S.L., Chopra, R.C., 1956. Glossary of Indian Medicinal Plants. Council of Scientific and Industrial Research, New Delhi, India
|
| Curator | Farzana-shamsudeen, vikramjitmandal |
| Compound ID | 3560 |
| Compound Structure |  |
| Plant Source | Sapium indicum L. Common Name:Huma (English) |
| Source Family | Euphorbiaceae |
| Origin | India |
| Plant Part Used | Fruit |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 - 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sapintoxin B |
| PubChem ID | 157762 |
| Ethnomedicinal Information | Purgative, insanity, poisonous in nature, intoxicating fish |
| PubMed ID [Source Literature] | 12713411 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Diterpene, Benzoyl, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 539.252 |
| Molecular Formula | C30H37NO8 |
| SMILES | O([C@@]12[C@@H](C1(C)C)[C@H]1[C@](O)([C@@H]([C@H]2OC(=O)c2c(NC)cccc2)C)[C@H]2[C@H]([C@H](O)C(=C1)CO)C(=O)C(=C2)C)C(=O)C |
| XLogP | 2.295 |
| PSA | 142.390 |
| H-bond Donor | 4 |
| H-bond Acceptor | 9 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) Chumkaew P, Karalai C, Ponglimanont C, Chantrapromma K.Antimycobacterial activity of phorbol esters from the fruits of Sapium indicum.J Nat Prod. 2003 Apr;66(4):540-3
|
| Curator | Rachana, vikramjitmandal |
| Compound ID | 3995 |
| Compound Structure |  |
| Plant Source | Microtropis japonica Common Name: |
| Source Family | Celastraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 27 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 15-acetoxyorbiculin |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Furanoid, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 684.257 |
| Molecular Formula | C39H40O11
|
| SMILES | O=C(c1ccccc1)O[C@H]1[C@]23[C@H](C)C[C@H](OC(=O)c4ccccc4)[C@H](OC(=O)C)[C@@]2(OC(=O)C)[C@@H](OC(=O)c2ccccc2)C[C@H]1C(C)(C)O3 |
| XLogP | 10.473 |
| PSA | 140.730 |
| H-bond Donor | 0 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 11 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 3996 |
| Compound Structure |  |
| Plant Source | Microtropis japonica Common Name: |
| Source Family | Celastraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 15 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Salasol A |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Furanoid, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 518.215 |
| Molecular Formula | C27H34O10
|
| SMILES | O=C(C)O[C@H]1[C@]23[C@H](C)C[C@H](OC(=O)C)[C@H](O)[C@@]2(OC(=O)C)[C@@H](OC(=O)c2ccccc2)C[C@H]1C(C)(C)O3 |
| XLogP | 4.241 |
| PSA | 134.660 |
| H-bond Donor | 1 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 3997 |
| Compound Structure |  |
| Plant Source | Microtropis japonica Common Name: |
| Source Family | Celastraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Celahin C |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Furanoid, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 518.215 |
| Molecular Formula | C27H34O10
|
| SMILES | O=C(C)O[C@H]1[C@]23[C@H](C)C[C@H](O)[C@H](OC(=O)C)[C@@]2(OC(=O)C)[C@@H](OC(=O)c2ccccc2)C[C@H]1C(C)(C)O3 |
| XLogP | 4.241 |
| PSA | 134.660 |
| H-bond Donor | 1 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 3998 |
| Compound Structure |  |
| Plant Source | Microtropis fokienensis Common Name: |
| Source Family | Celastraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (90-221387) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC4 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Furanoid, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 642.246 |
| Molecular Formula | C37H38O10
|
| SMILES | O=C(c1ccccc1)O[C@H]1[C@]23[C@H](C)C[C@H](O)[C@H](OC(=O)C)[C@@]2(OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)C[C@H]1C(C)(C)O3 |
| XLogP | 9.733 |
| PSA | 134.660 |
| H-bond Donor | 1 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 3999 |
| Compound Structure |  |
| Plant Source | Microtropis fokienensis Common Name: |
| Source Family | Celastraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (90-221387) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC5 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Furanoid, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 642.246 |
| Molecular Formula | C37H38O10
|
| SMILES | O=C(c1ccccc1)O[C@H]1[C@]23[C@H](C)C[C@H](OC(=O)C)[C@H](O)[C@@]2(OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)C[C@H]1C(C)(C)O3 |
| XLogP | 9.733 |
| PSA | 134.660 |
| H-bond Donor | 1 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4000 |
| Compound Structure |  |
| Plant Source | Microtropis fokienensis Common Name: |
| Source Family | Celastraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (90-221387) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mutangin |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Furanoid, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 622.241 |
| Molecular Formula | C34H38O11
|
| SMILES | O=C(C)O[C@H]1[C@]23[C@H](C)C[C@H](OC(=O)C)[C@H](OC(=O)C)[C@@]2(OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)C[C@H]1C(C)(C)O3 |
| XLogP | 7.727 |
| PSA | 140.730 |
| H-bond Donor | 0 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 11 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4001 |
| Compound Structure |  |
| Plant Source | Microtropis fokienensis Common Name: |
| Source Family | Celastraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (90-221387) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 9.3 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Orbiculin G |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Furanoid, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 640.267 |
| Molecular Formula | C38H40O9
|
| SMILES | O=C(c1ccccc1)O[C@H]1[C@]23[C@H](C)C[C@H](OC(=O)c4ccccc4)[C@H](OC(=O)C)[C@@]2(C)[C@@H](OC(=O)c2ccccc2)C[C@H]1C(C)(C)O3 |
| XLogP | 11.038 |
| PSA | 114.430 |
| H-bond Donor | 0 |
| H-bond Acceptor | 9 |
| No. of Rotatable Bond Count | 11 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4002 |
| Compound Structure |  |
| Plant Source | Microtropis fokienensis Common Name: |
| Source Family | Celastraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (90-221387) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 11 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Triptogelin G-2 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Furanoid, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 428.256 |
| Molecular Formula | C26H36O5
|
| SMILES | C[C@H]1[C@]23[C@H](C)C[C@H](C)[C@H](OC(=O)C)[C@@]2(C)[C@@H](OC(=O)c2ccccc2)C[C@H]1C(C)(C)O3 |
| XLogP | 6.720 |
| PSA | 61.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4019 |
| Compound Structure |  |
| Plant Source | Plectranthus grandidentatus Common Name: |
| Source Family | Lamiaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (MDR strain) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.39 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC36 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Quinone, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 524.241 |
| Molecular Formula | C30H36O8
|
| SMILES | C[C@@]12[C@H](C(C)(CCC1)C)[C@H](O)[C@H](C1=C2C(=O)C(=C(C1=O)C(C)C)OC(=O)c1ccc(OC)cc1)OC(=O)C |
| XLogP | 5.299 |
| PSA | 116.200 |
| H-bond Donor | 1 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4020 |
| Compound Structure |  |
| Plant Source | Plectranthus grandidentatus Common Name: |
| Source Family | Lamiaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (MDR strain) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.78 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC37 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Terpene, Diterpene, Quinone, Haloginated, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 528.191 |
| Molecular Formula | C29H33ClO7
|
| SMILES | C[C@@]12[C@H](C(C)(CCC1)C)[C@H](O)[C@H](C1=C2C(=O)C(=C(C1=O)C(C)C)OC(=O)c1ccc(Cl)cc1)OC(=O)C |
| XLogP | 5.839 |
| PSA | 106.970 |
| H-bond Donor | 1 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4029 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name: |
| Source Family | Euphorbiaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC48 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Benzoyl, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 678.304 |
| Molecular Formula | C38H46O11
|
| SMILES | C[C@@H]1[C@H](OC(=O)c2ccccc2)[C@H]2[C@@]([C@H]1O)(OC(=O)C)[C@H]([C@@](/C=CC([C@H](C[C@H](/C(=C2)/C)OC(=O)c1ccccc1)OC(=O)C)(C)C)(C)O)O |
| XLogP | 6.947 |
| PSA | 165.890 |
| H-bond Donor | 3 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 11 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4030 |
| Compound Structure |  |
| Plant Source | Pedilanthus tithymaloides Common Name: |
| Source Family | Euphorbiaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC49 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Jatrophane, Benzoyl, Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 698.294 |
| Molecular Formula | C37H46O13
|
| SMILES | C[C@@H]1[C@H](OC(=O)c2ccccc2)[C@H]2[C@]([C@H]1OC(=O)C)([C@@H](OC(=O)C)/C(=CCC(C)(C)[C@@H](OC(=O)C)[C@@H](OC(=O)C)C(=O)/C(=C2)/C)/C)OC(=O)C |
| XLogP | 5.514 |
| PSA | 174.870 |
| H-bond Donor | 0 |
| H-bond Acceptor | 13 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 13 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |