| Compound ID | 1102 |
| Compound Structure |  |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1670 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1103 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3130 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1104 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium bovis |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1340 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1105 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium chelonae |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1106 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1107 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium flavescens |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1108 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium gastri |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1109 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1110 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium kansasii |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2450 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1111 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium malmoense |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1112 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium marinum |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1113 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium scrofulaceum |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3010 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1114 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium simiae |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1115 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium szulgai |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3350 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1116 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium terrae |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2680 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1117 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium triviala |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2000 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 1118 |
| Compound Structure | |
| Plant Source | Allium sativum L. Common Name:Garlic (English), Lashuna (Sanskrit) |
| Source Family | Amaryllidaceae |
| Origin | India, Africa, Malaysia |
| Plant Part Used | Bulb |
| Extract | Water |
| Target Bacteria | Mycobacterium xenopi |
| Assay / Test Done | Agar - Dilution Test |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2680 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Allicin |
| PubChem ID | 65036 |
| Ethnomedicinal Information | Bronchitis, asthma, expectorant, cough, pulmonary phthisis, consumption, chronic diseases of lungs, whooping cough, laryngeal tuberculosis |
| PubMed ID [Source Literature] | 4004189 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 162.017 |
| Molecular Formula | C6H10OS2 |
| SMILES | S(=O)(SCC=C)CC=C |
| XLogP | 0.237 |
| PSA | 61.580 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) Delaha EC, Garagusi VF.Inhibition of mycobacteria by garlic extract (Allium sativum).Antimicrob Agents Chemother. 1985 Apr;27(4):485-6
|
| Curator | |
| Compound ID | 3960 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 2 - (Methyldithio) Pyrimidine |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Pyrimidine, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 157.997 |
| Molecular Formula | C5H6N2S2
|
| SMILES | C1ccnc(n1)SSC |
| XLogP | 1.511 |
| PSA | 76.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | |
| Compound ID | 3902 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3903 |
| Compound Structure | |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3904 |
| Compound Structure | |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (32 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3905 |
| Compound Structure | |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | ND |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3906 |
| Compound Structure | |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3907 |
| Compound Structure | |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3914 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2, 2' - Dithio - Bis - Pyridine - N - Oxide (Dipyrithione) |
| PubChem ID | 3109 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Disulfide, Dipyrithione |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 252.003 |
| Molecular Formula | C10H8N2O2S2 |
| SMILES | S(Sc1[n+]([O-])cccc1)c1[n+]([O-])cccc1 |
| XLogP | 1.726 |
| PSA | 104.480 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
