| Compound ID | 1523 |
| Compound Structure |  |
| Plant Source | Combretum molle R. Br. Ex G. Don Common Name:Velvet Leaf Willow, Velvet Leaf Combretum, Velvet Bush Willow |
| Source Family | Combretaceae |
| Origin | Africa |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.6 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Punicalagin |
| PubChem ID | 16149716 |
| Ethnomedicinal Information | Cough, tuberculosis, juice drunk to treat chest complaints |
| PubMed ID [Source Literature] | 15110681 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polyphenol, Ellagitannin, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 0.000 |
| Molecular Formula | C48H28O30
|
| SMILES | O1[C@H]2[C@@H](OC(=O)c3c(c4c5c6c7c(c(c8c(C(=O)OC2)cc(O)c(O)c8O)c(O)c(O)c7oc5=O)c(=O)oc6c(O)c4O)c(O)c(O)c(O)c3)[C@@H]2OC(=O)c3c(c4c(C(=O)O[C@H]2[C@H]1O)cc(O)c(O)c4O)c(O)c(O)c(O)c3 |
| XLogP | 0.000 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Okunade AL, Elvin-Lewis MP, Lewis WH.Natural antimycobacterial metabolites: current status.Phytochemistry. 2004 Apr;65(8):1017-32
|
| Curator | |
