| Compound ID | 1280 |
| Compound Structure |  |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | Southeastern USA |
| Plant Part Used | Flower, leaf, stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Fusidic acid (4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (24R)-24,25-epoxycycloartan-3-one |
| PubChem ID | 469544 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 8988597 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Cycloartane, Ketone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against vero cells |
| Molecular Weight | 440.365 |
| Molecular Formula | C30H48O2 |
| SMILES | O=C1C([C@H]2[C@@]3([C@@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CC[C@H]3OC3(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 9.983 |
| PSA | 29.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Lu T, Fronczek FR, Fischer NH, Adams LB, Franzblau SG.Antimycobacterial cycloartanes from Borrichia frutescens.J Nat Prod. 1996 Dec;59(12):1131-6
|
| Curator | |
| Compound ID | 1281 |
| Compound Structure |  |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Flower, leaf, stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Fusidic acid (4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (3β, 24R) - 24, 25 - Epoxycycloartan - 3 - Ol |
| PubChem ID | 469545 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 8988597 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Cycloartane, Epoxy, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 442.381 |
| Molecular Formula | C30H50O2 |
| SMILES | O[C@H]1C([C@H]2[C@@]3([C@@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CC[C@H]3OC3(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 10.590 |
| PSA | 32.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Lu T, Fronczek FR, Fischer NH, Adams LB, Franzblau SG.Antimycobacterial cycloartanes from Borrichia frutescens.J Nat Prod. 1996 Dec;59(12):1131-6
|
| Curator | |
| Compound ID | 1555 |
| Compound Structure |  |
| Plant Source | Croton kongensis Common Name: |
| Source Family | Lamiaceae |
| Origin | China |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ent - 8, 9 - Seco - 8, 14 - Epoxy - 7α - Hydroxy - 11β - Acetoxy - 16 - Kauren - 9, 15 - Dione |
| PubChem ID | NR |
| Ethnomedicinal Information | Antimalarial activity, tuberculosis, dysmenorrheal treatment |
| PubMed ID [Source Literature] | 12828479, 1511068 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Sesquiterpene, Epoxy, Ketone, O-Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero, human epidermoid carcinoma in the mouth (KB) and human breast cancer cells (BC) |
| Molecular Weight | 376.189 |
| Molecular Formula | C21H28O6
|
| SMILES | C1CCC([C@@H]2C1C(=O)[C@H](CC1C3C(C(=O)C1=C)(C(C2)O)O3)OC(=O)C)(C)C |
| XLogP | 1.760 |
| PSA | 93.200 |
| H-bond Donor | 1 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Thongtan J, Kittakoop P, Ruangrungsi N, Saenboonrueng J, Thebtaranonth Y.New antimycobacterial and antimalarial 8,9-secokaurane diterpenes from Croton kongensis.J Nat Prod. 2003 Jun;66(6):868-70
2) Hendrix PG, Hoylaerts MF, Nouwen EJ, Van de Voorde A, De Broe ME.Magnetic beads in suspension enable a rapid and sensitive immunodetection of human placental alkaline phosphatase.Eur J Clin Chem Clin Biochem. 1992 Jun;30(6):343-7
|
| Curator | |
| Compound ID | 2101 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Parthenolide |
| PubChem ID | 7251185 |
| Ethnomedicinal Information | Cytotoxic, anti-tumor, anti-bacterial, anti-fungal, anti-inflammatory, european fever, migraine |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1[C@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC/C(=C/CC2)/C)C |
| XLogP | 2.449 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2102 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1,10-Epoxycostunolide |
| PubChem ID | 6474991 |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1C2([C@H]1CC/C(=C/[C@H]1OC(=O)C(=C)[C@@H]1CC2)/C)C |
| XLogP | 2.082 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2104 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Clarithroycin (1 - 2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Parthenolide |
| PubChem ID | 7251185 |
| Ethnomedicinal Information | Cytotoxic, anti-tumor, anti-bacterial, anti-fungal, anti-inflammatory, european fever, migraine |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1[C@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC/C(=C/CC2)/C)C |
| XLogP | 2.449 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2105 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | |
| Positive Control Used (conc.) | Clarithroycin (1 - 2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1,10-Epoxycostunolide |
| PubChem ID | 6474991 |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening, Other u - methylene - g - lactone - bearing sesquiterpene lactones are moderately active against MT with MICs of 64, |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1C2([C@H]1CC/C(=C/[C@H]1OC(=O)C(=C)[C@@H]1CC2)/C)C |
| XLogP | 2.082 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2114 |
| Compound Structure |  |
| Plant Source | Magnolia virginiana Common Name: |
| Source Family | Magnoliaceae |
| Origin | USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Parthenolide |
| PubChem ID | 7251185 |
| Ethnomedicinal Information | Cytotoxic, anti-tumor, anti-bacterial, anti-fungal, anti-inflammatory, european fever, migraine |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1[C@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC/C(=C/CC2)/C)C |
| XLogP | 2.449 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 3056 |
| Compound Structure |  |
| Plant Source | Ajuga remota Benth. Common Name:NR |
| Source Family | Lamiaceae |
| Origin | NR |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Clerodin |
| PubChem ID | 124059 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10630115 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic,Terpene, Diterpene, Epoxy, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 434.230 |
| Molecular Formula | C24H34O7
|
| SMILES | O1[C@]2([C@]3([C@@H]([C@]([C@@H](C[C@@H]3OC(=O)C)C)([C@H]3OC4OC=CC4C3)C)CCC2)COC(=O)C)C1 |
| XLogP | 3.678 |
| PSA | 83.590 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Rajab MS, Franzblau SG, Fronczek FR, Fischer NH.Antimycobacterial ergosterol-5,8-endoperoxide from Ajuga remota.Planta Med. 1999 Dec;65(8):732-4
|
| Curator | |
| Compound ID | 3058 |
| Compound Structure |  |
| Plant Source | Ajuga remota Benth. Common Name:NR |
| Source Family | Lamiaceae |
| Origin | NR |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ajugarin - II |
| PubChem ID | 3085250 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10630115 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, O-Acetyl, Lactone, Epoxy, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 392.220 |
| Molecular Formula | C22H32O6
|
| SMILES | O1[C@]2([C@]3([C@@H]([C@]([C@@H](C[C@@H]3O)C)(CCC3=CC(=O)OC3)C)CCC2)COC(=O)C)C1 |
| XLogP | 3.122 |
| PSA | 85.360 |
| H-bond Donor | 1 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Rajab MS, Franzblau SG, Fronczek FR, Fischer NH.Antimycobacterial ergosterol-5,8-endoperoxide from Ajuga remota.Planta Med. 1999 Dec;65(8):732-4
|
| Curator | |
| Compound ID | 3065 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4-α-(15)-Epoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | C1(=C)[C@H]2[C@@H]([C@@H]3[C@@H](CC1)C(=C)C(=O)O3)[C@]1(CC2)CO1 |
| XLogP | 1.715 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuñez IS, Castañeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3066 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 10β(14)-Epoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | C12([C@H]3[C@@H]([C@@H]4[C@@H](CC1)C(=C)C(=O)O4)C(=C)CC3)OC2 |
| XLogP | 1.504 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuñez IS, Castañeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3067 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 10α(14)-Epoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | C12([C@H]3[C@@H]([C@@H]4[C@@H](CC1)C(=C)C(=O)O4)C(=C)CC3)OC2 |
| XLogP | 1.504 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuñez IS, Castañeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3068 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4β(15),10α(14)-diepoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic,Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 262.121 |
| Molecular Formula | C15H18O4 |
| SMILES | C12([C@H]3[C@@H]([C@@H]4[C@@H](CC1)C(=C)C(=O)O4)C1(CC3)OC1)OC2 |
| XLogP | 0.979 |
| PSA | 51.360 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuñez IS, Castañeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3069 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4α(15),10α(14)Diepoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 262.121 |
| Molecular Formula | C15H18O4 |
| SMILES | C12([C@H]3[C@@H]([C@@H]4[C@@H](CC1)C(=C)C(=O)O4)C1(CC3)CO1)OC2 |
| XLogP | 0.979 |
| PSA | 51.360 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuñez IS, Castañeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3070 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4α(15),10β(14)-diepoxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic,Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 262.121 |
| Molecular Formula | C15H18O4 |
| SMILES | C12([C@H]3[C@@H]([C@@H]4[C@@H](CC1)C(=C)C(=O)O4)C1(CC3)OC1)OC2 |
| XLogP | 0.979 |
| PSA | 51.360 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuñez IS, Castañeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |
| Compound ID | 3405 |
| Compound Structure |  |
| Plant Source | Montanoa speciosa Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | India, USA |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5α - Epoxyalantolactone |
| PubChem ID | 474521 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3 |
| SMILES | O1[C@]23[C@@](C[C@H]4OC(=O)C(=C)[C@H]4[C@H]12)(CCC[C@@H]3C)C |
| XLogP | 2.414 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 3664 |
| Compound Structure |  |
| Plant Source | Chrysanthemum morifolium RAMAT. Common Name:Chrysanthemum |
| Source Family | Asteraceae (Compositae) |
| Origin | Asia and Northeastern Europe |
| Plant Part Used | Flower |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 6 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4, 5α - Epoxyhelianol |
| PubChem ID | 5273651 |
| Ethnomedicinal Information | Anti - inflammatory, analgesic, antipyretic |
| PubMed ID [Source Literature] | 15635183 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Triterpene, Prenylated, Epoxy, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 444.397 |
| Molecular Formula | C30H52O2 |
| SMILES | O1C2([C@H]([C@]3([C@@H]([C@@]4([C@]([C@@H](CC4)[C@H](CCC=C(C)C)C)(CC3)C)C)CC2)C)CCCO)C1(C)C |
| XLogP | 10.779 |
| PSA | 32.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Akihisa T, Franzblau SG, Ukiya M, Okuda H, Zhang F, Yasukawa K, Suzuki T, Kimura Y.Antitubercular activity of triterpenoids from Asteraceae flowers.Biol Pharm Bull. 2005 Jan;28(1):158-60
|
| Curator | Vikramjitmandal |
| Compound ID | 3677 |
| Compound Structure |  |
| Plant Source | Micromelum hirsutum Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | Stem bark |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis Erdman (ATCC 35 801) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin |
| Inhibition [%] | > 90 % |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 5α - Epoxyalantolactone |
| PubChem ID | 474521 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15770548 |
| Extract Preparation | The dried, milled stem bark of Micromelum hirsutum was extracted with CH2Cl2 to yield 45.5 g extract, of which 32.1 g were chromatographed by vacuum liquid chromatography over a silica gel column |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3 |
| SMILES | O1[C@]23[C@@](C[C@H]4OC(=O)C(=C)[C@H]4[C@H]12)(CCC[C@@H]3C)C |
| XLogP | 2.414 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Ma C, Case RJ, Wang Y, Zhang HJ, Tan GT, Van Hung N, Cuong NM, Franzblau SG, Soejarto DD, Fong HH, Pauli GF.Anti-tuberculosis constituents from the stem bark of Micromelum hirsutum.Planta Med. 2005 Mar;71(3):261-7
|
| Curator | Vikramjitmandal |
| Compound ID | 3717 |
| Compound Structure |  |
| Plant Source | Harrisonia perforata Common Name: |
| Source Family | Simaroubaceae |
| Origin | Hainan, Cambodia, Cochin, China, Burma and West Malaysia |
| Plant Part Used | Branch |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml), Kanamycin sulphate (2.0 - 5.3 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Perforamone A |
| PubChem ID | 11572850 |
| Ethnomedicinal Information | Antimalarial activity |
| PubMed ID [Source Literature] | 16394547 |
| Extract Preparation | The branches of Harrisonia perforata (5.1 kg) were extracted with 95 % EtOH at room temperature. The ethanolic extract was filtered and evaporated to a dark brown viscous oil (186.3 g). The extract was partitioned between water (500 ml) and EtOAc (3 x 500 ml) and the water layer was further extracted with n-BuOH (3 x 400 ml). After evaporation, the EtOAc-, n-BuOH- and water - soluble fractions gave a brown viscous oil (69.8 g), a dark brown viscous oil (25.7 g) and a light brown viscous oil (50.8 g), respectively. The ethyl acetate soluble fraction is separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Chromone, Epoxy, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 290.115 |
| Molecular Formula | C16H18O5 |
| SMILES | O1C(C1Cc1c2oc(cc(=O)c2c(O)cc1OC)C)(C)C |
| XLogP | 1.056 |
| PSA | 59.060 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chromones from the branches of Harrisonia perforata.Chem Pharm Bull (Tokyo). 2006 Jan;54(1):44-7
|
| Curator | Vikramjitmandal, Reshmi |
| Compound ID | 3755 |
| Compound Structure |  |
| Plant Source | Calliandra californica Benth. Common Name:NR |
| Source Family | Fabaceae |
| Origin | NR |
| Plant Part Used | Root |
| Extract | Ethyl acetate |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (CIBIN / UMF15 : 099) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Escobarine A |
| PubChem ID | 11983334 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16755469 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Epoxy, Aldehyde, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against 5 human tumor cell lines |
| Molecular Weight | 330.183 |
| Molecular Formula | C20H26O4 |
| SMILES | O1[C@@]2([C@H]3[C@@H]([C@@]4([C@H](C(CCC4)(C)C)C[C@@H]3O)C)CC(=O)[C@]12C#C)C=O |
| XLogP | 3.288 |
| PSA | 66.900 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Encarnación-Dimayuga R, Agúndez-Espinoza J, García A, Delgado G, Molina-Salinas GM, Said-Fernández S.Two new cassane-type diterpenes from Calliandra californica with antituberculosis and cytotoxic activities.Planta Med. 2006 Jun;72(8):757-61. Epub 2006 Jun 1
|
| Curator | Reshmi, vikramjitmandal |
| Compound ID | 3808 |
| Compound Structure |  |
| Plant Source | Angelica sinensis Common Name:Dang Gui |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Northwest China |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.06 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 60 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Heptadeca - 1 - Ene - 9, 10 - Epoxy - 4, 6 - Diyne - 3, 8 - Diol |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18567055 |
| Extract Preparation | 8 kg of the pulverized roots of Angelica sinensis Diels were extracted with methanol and the extract sequentially partitioned with petroleum ether, CHCl3, and BuOH |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Epoxy, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 276.173 |
| Molecular Formula | C17H24O3 |
| SMILES | C(#CC(C=C)O)C#CC(O)C1C(CCCCCCC)O1 |
| XLogP | 3.663 |
| PSA | 52.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Deng S, Wang Y, Inui T, Chen SN, Farnsworth NR, Cho S, Franzblau SG, Pauli GF.Anti-TB polyynes from the roots of Angelica sinensis.Phytother Res. 2008 Jul;22(7):878-82
|
| Curator | KeyaMukherjee, reshmi, Farzana Shamsudeen, Vikramjitmandal |
| Compound ID | 3813 |
| Compound Structure |  |
| Plant Source | Angelica sinensis Common Name:Dang Gui |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Northwest China |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis (Erdman) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.05 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 60 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Heptadeca - 1 - Ene - 9, 10 - Epoxy - 4, 6 - Diyne - 3, 8 - Diol |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18567055 |
| Extract Preparation | 8 kg of the pulverized roots of Angelica sinensis Diels were extracted with methanol and the extract sequentially partitioned with petroleum ether, CHCl3, and BuOH |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Epoxy, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H12 medium |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 276.173 |
| Molecular Formula | C17H24O3 |
| SMILES | C(#CC(C=C)O)C#CC(O)C1C(CCCCCCC)O1 |
| XLogP | 3.663 |
| PSA | 52.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Deng S, Wang Y, Inui T, Chen SN, Farnsworth NR, Cho S, Franzblau SG, Pauli GF.Anti-TB polyynes from the roots of Angelica sinensis.Phytother Res. 2008 Jul;22(7):878-82
|
| Curator | KeyaMukherjee, reshmi, Farzana Shamsudeen, Vikramjitmandal |
| Compound ID | 3869 |
| Compound Structure |  |
| Plant Source | Achyrocline alata Common Name:NR |
| Source Family | Asteraceae (Compositae) |
| Origin | Colombia |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (0.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 62.5 ± 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Caryophyllene oxide (2.2 %) |
| PubChem ID | 14350 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 220.183 |
| Molecular Formula | C15H24O |
| SMILES | O1C2(C1CCC(=C)C1C(C(C1)(C)C)CC2)C |
| XLogP | 4.607 |
| PSA | 12.530 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 1484 |
| Compound Structure |  |
| Plant Source | Clavija procera Common Name: |
| Source Family | Theophrastaceae |
| Origin | Peru |
| Plant Part Used | Stems, bark |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis (H37Rv) |
| Assay / Test Done | Tetrazolium Microplate Assay (TEMA) |
| Positive Control Used (conc.) | Isoniazid (0.125 µg/ml), Rifampicin (0.063 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3.1 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Aegicerin |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 16724857 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene,Triterpene, Epoxy, Furanoid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 456.360 |
| Molecular Formula | C30H48O3
|
| SMILES | C1CC(C(C2C1(C1C(CC2)(C2(C3(CC1)C1C(C(=O)C2)(CCC(C1)(C)C)CO3)C)C)C)(C)C)O |
| XLogP | 7.411 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rojas R, Caviedes L, Aponte JC, Vaisberg AJ, Lewis WH, Lamas G, Sarasara C, Gilman RH, Hammond GB.Aegicerin, the first oleanane triterpene with wide-ranging antimycobacterial activity, isolated from Clavija procera.J Nat Prod. 2006 May;69(5):845-6
|
| Curator | |