| Compound ID | 1931 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR (inactive) |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Operculinic acid |
| PubChem ID | 44584575 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 1018.520 |
| Molecular Formula | C46H82O24 |
| SMILES | O([C@@H]1O[C@H]([C@H](O[C@@H]2O[C@H]([C@H](O)[C@@H](O)[C@H]2O)C)[C@@H](O)[C@H]1O[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO)C)[C@@H]1[C@@H](O)[C@@H](O)[C@@H](O[C@H]1C)O[C@@H]1[C@@H](O)[C@@H](O)[C@H](O[C@H]1O[C@H](CCCCCCCCCC(=O)O)CCCCC)C |
| XLogP | 1.041 |
| PSA | 372.360 |
| H-bond Donor | 13 |
| H-bond Acceptor | 24 |
| No. of Rotatable Bond Count | 25 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 24 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 1934 |
| Compound Structure |  |
| Plant Source | Ipomoea leptophylla Common Name:Bush Morning Glory, Manroot |
| Source Family | Convolvulaceae |
| Origin | North America |
| Plant Part Used | Leaf |
| Extract | Soluble extract |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | BACTEC 460 radiometric system |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Lauric acid |
| PubChem ID | 3893 |
| Ethnomedicinal Information | Treatment for stomach troubles, tuberculosis |
| PubMed ID [Source Literature] | 14640518 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 200.178 |
| Molecular Formula | C12H24O2 |
| SMILES | OC(=O)CCCCCCCCCCC |
| XLogP | 5.294 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Barnes CC, Smalley MK, Manfredi KP, Kindscher K, Loring H, Sheeley DM.Characterization of an anti-tuberculosis resin glycoside from the prairie medicinal plant Ipomoea leptophylla.J Nat Prod. 2003 Nov;66(11):1457-62
|
| Curator | |
| Compound ID | 2306 |
| Compound Structure |  |
| Plant Source | Pelargonium reniforme Common Name: |
| Source Family | Geraniaceae |
| Origin | Africa |
| Plant Part Used | Tuber |
| Extract | N - hexane |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linoleic Acid |
| PubChem ID | 5280450 |
| Ethnomedicinal Information | Tuberculosis, coughs |
| PubMed ID [Source Literature] | 15194133 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | OC(=O)CCCCCCC/C=CC/C=CCCCCC |
| XLogP | 7.865 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Seidel V, Taylor PW. In vitro activity of extracts and constituents of Pelagonium against rapidly growing mycobacteria. Int J Antimicrob Agents. 2004, Jun;23(6):613-9
|
| Curator | |
| Compound ID | 2415 |
| Compound Structure |  |
| Plant Source | Polyalthia cerasoides (Roxb.) Benth. ex Bedd Common Name: |
| Source Family | Annonaceae |
| Origin | Thailand |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.05 µg/ml), Kanamycin (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Octadeca - 9, 11, 13 - Triynoic Acid |
| PubChem ID | 11778027 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 17845001 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkyne, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 272.178 |
| Molecular Formula | C18H24O2 |
| SMILES | OC(=O)CCCCCCCC#CC#CC#CCCCC |
| XLogP | 6.542 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Kanokmedhakul S, Kanokmedhakul K, Lekphrom R.Bioactive constituents of the roots of Polyalthia cerasoides.J Nat Prod. 2007 Sep;70(9):1536-8
|
| Curator | |
| Compound ID | 2578 |
| Compound Structure |  |
| Plant Source | Scleropyrum pentandrum Common Name: |
| Source Family | Santalaceae |
| Origin | India, Malaysia, Philippines, Singapore, Sri Lanka |
| Plant Part Used | Twig |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.004 µg/ml), Isoniazid (0.06 µg/ml), Kanamycin sulphate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Scleropyric acid |
| PubChem ID | 11594149 |
| Ethnomedicinal Information | Malaria, tuberculosis |
| PubMed ID [Source Literature] | 16204994 |
| Extract Preparation | The pulverized, dry twigs (1.06 kg) were extracted successively with n - Hexane, CHCl3 and MeOH in a soxhlet extraction apparatus to yield the hexane (7.12 g), CHCl3 (3.50 g), and MeOH (12.42 g) extracts, respectively |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 264.209 |
| Molecular Formula | C17H28O2 |
| SMILES | OC(=O)CCCCCCCCCCC#CCCC=C |
| XLogP | 6.563 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn A, Buaprom M, Udtip S, Nuntawong N, Haritakun R, Kanokmedhakul S.Antimycobacterial and antiplasmodial unsaturated carboxylic acid from the twigs of Scleropyrum wallichianum.Chem Pharm Bull (Tokyo). 2005 Oct;53(10):1327-9
|
| Curator | |
| Compound ID | 3607 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (1 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linoleic acid |
| PubChem ID | 5280450 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | OC(=O)CCCCCCC/C=CC/C=CCCCCC |
| XLogP | 7.865 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3608 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (4 µg/ml), Isoniazid (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linoleic acid |
| PubChem ID | 5280450 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | OC(=O)CCCCCCC/C=CC/C=CCCCCC |
| XLogP | 7.865 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3609 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium phlei (ATCC 11758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linoleic acid |
| PubChem ID | 5280450 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | OC(=O)CCCCCCC/C=CC/C=CCCCCC |
| XLogP | 7.865 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3610 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linoleic acid |
| PubChem ID | 5280450 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 280.240 |
| Molecular Formula | C18H32O2 |
| SMILES | OC(=O)CCCCCCC/C=CC/C=CCCCCC |
| XLogP | 7.865 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3611 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (1 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleic acid |
| PubChem ID | 445639 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 282.256 |
| Molecular Formula | C18H34O2 |
| SMILES | OC(=O)CCCCCCC/C=CCCCCCCCC |
| XLogP | 8.192 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3612 |
| Compound Structure |  |
| Plant Source | Humulus lupulus Common Name: |
| Source Family | Cannabaceae |
| Origin | |
| Plant Part Used | Whole plant |
| Extract | Hexane |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Oleic acid |
| PubChem ID | 445639 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15478197 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 282.256 |
| Molecular Formula | C18H34O2 |
| SMILES | OC(=O)CCCCCCC/C=CCCCCCCCC |
| XLogP | 8.192 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 15 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Stavri M, Schneider R, O'Donnell G, Lechner D, Bucar F, Gibbons S.The antimycobacterial components of hops (Humulus lupulus) and their dereplication.Phytother Res. 2004 Sep;18(9):774-6
|
| Curator | Gppreetha, vikramjitmandal |
| Compound ID | 3988 |
| Compound Structure |  |
| Plant Source | Polyalthia evecta Common Name: |
| Source Family | Annonaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3.1 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | NPMC7a |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkyne, Fatty acid, Furanoid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 360.266 |
| Molecular Formula | C23H36O3 |
| SMILES | OC(=O)CCCC#CCCCCCCCCCCCCCc1ccco1 |
| XLogP | 8.462 |
| PSA | 50.440 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 16 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |
| Compound ID | 4101 |
| Compound Structure |  |
| Plant Source | Exocarpus latifolius Common Name: |
| Source Family | Santalaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 20 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Exocarpic acid |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 274.193 |
| Molecular Formula | C18H26O2 |
| SMILES | C(CCCCCCC(=O)O)C#CC#C/C=C/CCCC |
| XLogP | 6.906 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4102 |
| Compound Structure |  |
| Plant Source | Exocarpus latifolius Common Name: |
| Source Family | Santalaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC220 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Alkyne, Fatty acid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 290.188 |
| Molecular Formula | C18H26O3 |
| SMILES | OC(CCCCCCC(=O)O)C#CC#C/C=C/CCCC |
| XLogP | 5.509 |
| PSA | 57.530 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4103 |
| Compound Structure |  |
| Plant Source | Exocarpus latifolius Common Name: |
| Source Family | Santalaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC221 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkyne, Fatty acid, Monoglyceride |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 348.230 |
| Molecular Formula | C21H32O4 |
| SMILES | CCCC/C=C/C#CC#CCCCCCCCC(=O)OCC(O)CO |
| XLogP | 5.846 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 14 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4104 |
| Compound Structure |  |
| Plant Source | Polyalthia cerasoides Common Name: |
| Source Family | Annonaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC222 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Alkyne, Fatty acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 286.193 |
| Molecular Formula | C19H26O2 |
| SMILES | CCCCC#CC#CC#CCCCCCCCCC(=O)O |
| XLogP | 7.111 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4118 |
| Compound Structure |  |
| Plant Source | Ipomoea tyrianthina Common Name: |
| Source Family | Convolvulaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv ATCC 27296 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC240 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid, Acyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 1072.567 |
| Molecular Formula | C50H88O24 |
| SMILES | O[C@H]1[C@H](O)[C@@H](O[C@H]2[C@H](O[C@H]3[C@H](OC(=O)C(CC)C)[C@H](O)[C@@H](O[C@H]4[C@H](O)[C@@H](O)[C@H](OC(=O)C(C)C(O)C)[C@@H](C)O4)[C@H](C)O3)[C@@H](O)[C@H](O)[C@@H](CO)O2)[C@H](O[C@@](CCCCC)(O)CCCCCCCCCC(=O)O)O[C@@H]1C |
| XLogP | 2.908 |
| PSA | 366.040 |
| H-bond Donor | 11 |
| H-bond Acceptor | 24 |
| No. of Rotatable Bond Count | 31 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 24 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4119 |
| Compound Structure |  |
| Plant Source | Ipomoea tyrianthina Common Name: |
| Source Family | Convolvulaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv ATCC 27297 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC241 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aliphatic, Fatty acid, Acyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 1054.556 |
| Molecular Formula | C50H86O23 |
| SMILES | O[C@H]1[C@H](O)[C@@H](O[C@H]2[C@H](O[C@H]3[C@H](OC(=O)C(CC)C)[C@H](O)[C@@H](O[C@H]4[C@H](O)[C@@H](O)[C@H](OC(=O)/C(=C/C)/C)[C@@H](C)O4)[C@H](C)O3)[C@@H](O)[C@H](O)[C@@H](CO)O2)[C@H](O[C@@](CCCCC)(O)CCCCCCCCCC(=O)O)O[C@@H]1C |
| XLogP | 4.031 |
| PSA | 345.810 |
| H-bond Donor | 10 |
| H-bond Acceptor | 23 |
| No. of Rotatable Bond Count | 30 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 23 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |