| Compound ID | 1056 |
| Compound Structure |  |
| Plant Source | Adhatoda vasica Nees Common Name:Malabar Nut Tree (English), Vasaka (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bromhexine |
| PubChem ID | 2442 |
| Ethnomedicinal Information | Treatment of tuberculosis, asthma and also as expectorants, bronchial disorders such as acute and chronic cough, bronchitis |
| PubMed ID [Source Literature] | 8778507 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Cyclohexane, Amine, Haloginated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 373.999 |
| Molecular Formula | C14H20Br2N2
|
| SMILES | Brc1c(N)c(CN(C2CCCCC2)C)cc(Br)c1 |
| XLogP | 4.004 |
| PSA | 29.260 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Grange JM, Snell NJ.Activity of bromhexine and ambroxol, semi-synthetic derivatives of vasicine from the Indian shrub Adhatoda vasica, against Mycobacterium tuberculosis in vitro.J Ethnopharmacol. 1996 Jan;50(1):49-53
|
| Curator | |
| Compound ID | 1057 |
| Compound Structure |  |
| Plant Source | Adhatoda vasica Nees Common Name:Malabar Nut Tree (English), Vasaka (Sanskrit) |
| Source Family | Acanthaceae |
| Origin | India |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth Dilution Assay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ambroxol |
| PubChem ID | 2132 |
| Ethnomedicinal Information | Treatment of tuberculosis, asthma and also as expectorants, bronchial disorders such as acute and chronic cough, bronchitis |
| PubMed ID [Source Literature] | 8778507 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Cyclohexane, Amine, Haloginated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 375.979 |
| Molecular Formula | C13H18Br2N2O
|
| SMILES | Brc1c(N)c(CNC2CCC(O)CC2)cc(Br)c1 |
| XLogP | 2.524 |
| PSA | 58.280 |
| H-bond Donor | 3 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 2 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Grange JM, Snell NJ.Activity of bromhexine and ambroxol, semi-synthetic derivatives of vasicine from the Indian shrub Adhatoda vasica, against Mycobacterium tuberculosis in vitro.J Ethnopharmacol. 1996 Jan;50(1):49-53
|
| Curator | |
| Compound ID | 2862 |
| Compound Structure |  |
| Plant Source | Helichrysum aureonitens Common Name:Golden Everlasting |
| Source Family | Asteraceae (Compositae) |
| Origin | Africa |
| Plant Part Used | Callus tissue from young leaf |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27264) |
| Assay / Test Done | Radiorespirometric BACTEC Assay |
| Positive Control Used (conc.) | Isoniazid (0.2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 1000 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 4 - Chloro - 2 - (Hepta - 1, 3, 5 - Triyn - 1 - yl) - Phenol |
| PubChem ID | NR |
| Ethnomedicinal Information | Anticancer activity, inhibition on DNA topoisomerase I |
| PubMed ID [Source Literature] | 19881282 |
| Extract Preparation | Cell suspension culture |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkyne, Phenol, Haloginated |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | Against Vero and Human prostate epithelial carcinoma DU 145 cell lines |
| Molecular Weight | 214.019 |
| Molecular Formula | C13H7ClO |
| SMILES | C1(cc(c(cc1)O)C#CC#CC#CC)Cl |
| XLogP | 3.971 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Ziaratnia SM, Ohyama K, Hussein AA, Muranaka T, Lall N, Kunert KJ, Meyer JJ.Isolation and identification of a novel chlorophenol from a cell suspension culture of Helichrysum aureonitens.Chem Pharm Bull (Tokyo). 2009 Nov;57(11):1282-3
|
| Curator | Gppreetha, keyamukherjee, reshmi |
| Compound ID | 4020 |
| Compound Structure |  |
| Plant Source | Plectranthus grandidentatus Common Name: |
| Source Family | Lamiaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (MDR strain) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.78 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC37 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Terpene, Diterpene, Quinone, Haloginated, Benzoyl, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 528.191 |
| Molecular Formula | C29H33ClO7
|
| SMILES | C[C@@]12[C@H](C(C)(CCC1)C)[C@H](O)[C@H](C1=C2C(=O)C(=C(C1=O)C(C)C)OC(=O)c1ccc(Cl)cc1)OC(=O)C |
| XLogP | 5.839 |
| PSA | 106.970 |
| H-bond Donor | 1 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |