| Compound ID | 1412 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Strictosidine |
| PubChem ID | 161336 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Indole, Pyran, Ester, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 530.226 |
| Molecular Formula | C27H34N2O9
|
| SMILES | O([C@@H]1OC=C([C@@H](C[C@@H]2NCCc3c2[nH]c2c3cccc2)[C@H]1C=C)C(=O)OC)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO |
| XLogP | 1.559 |
| PSA | 162.730 |
| H-bond Donor | 6 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 5 |
| No. of N | 2 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1414 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Strictosidine |
| PubChem ID | 161336 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Indole, Pyran, Ester, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 530.226 |
| Molecular Formula | C27H34N2O9
|
| SMILES | O([C@@H]1OC=C([C@@H](C[C@@H]2NCCc3c2[nH]c2c3cccc2)[C@H]1C=C)C(=O)OC)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO |
| XLogP | 1.559 |
| PSA | 162.730 |
| H-bond Donor | 6 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 5 |
| No. of N | 2 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1416 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Strictosidine |
| PubChem ID | 161336 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Indole, Pyran, Ester, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 530.226 |
| Molecular Formula | C27H34N2O9
|
| SMILES | O([C@@H]1OC=C([C@@H](C[C@@H]2NCCc3c2[nH]c2c3cccc2)[C@H]1C=C)C(=O)OC)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO |
| XLogP | 1.559 |
| PSA | 162.730 |
| H-bond Donor | 6 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 5 |
| No. of N | 2 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1418 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Strictosidine |
| PubChem ID | 161336 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Indole, Pyran, Ester, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 530.226 |
| Molecular Formula | C27H34N2O9
|
| SMILES | O([C@@H]1OC=C([C@@H](C[C@@H]2NCCc3c2[nH]c2c3cccc2)[C@H]1C=C)C(=O)OC)[C@@H]1O[C@@H]([C@@H](O)[C@H](O)[C@H]1O)CO |
| XLogP | 1.559 |
| PSA | 162.730 |
| H-bond Donor | 6 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 5 |
| No. of N | 2 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 3376 |
| Compound Structure |  |
| Plant Source | Rauwolfia biauriculata Common Name:NR |
| Source Family | Apocynaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 100 µg/ml, 7H11 agar: > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Lochnerin |
| PubChem ID | 6436184 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Indole, Alkaloid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 324.184 |
| Molecular Formula | C20H24N2O2 |
| SMILES | OC[C@H]1[C@H]2N3[C@@H](C[C@H]1/C(=CC)/C3)c1[nH]c3c(c1C2)cc(OC)cc3 |
| XLogP | 1.784 |
| PSA | 48.490 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3377 |
| Compound Structure |  |
| Plant Source | Rauwolfia biauriculata Common Name:NR |
| Source Family | Apocynaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium 733 |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: > 100 µg/ml, 7H11 agar: > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Lochnerin |
| PubChem ID | 6436184 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Indole, Alkaloid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 324.184 |
| Molecular Formula | C20H24N2O2 |
| SMILES | OC[C@H]1[C@H]2N3[C@@H](C[C@H]1/C(=CC)/C3)c1[nH]c3c(c1C2)cc(OC)cc3 |
| XLogP | 1.784 |
| PSA | 48.490 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3378 |
| Compound Structure |  |
| Plant Source | Rauwolfia biauriculata Common Name:NR |
| Source Family | Apocynaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium kansasii (Clinical isolate 94 - 069) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: > 100 µg/ml, 7H11 agar: > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Lochnerin |
| PubChem ID | 6436184 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Indole, Alkaloid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 324.184 |
| Molecular Formula | C20H24N2O2 |
| SMILES | OC[C@H]1[C@H]2N3[C@@H](C[C@H]1/C(=CC)/C3)c1[nH]c3c(c1C2)cc(OC)cc3 |
| XLogP | 1.784 |
| PSA | 48.490 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 2 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3379 |
| Compound Structure |  |
| Plant Source | Tabernaemontana citrifolia Common Name:NR |
| Source Family | Apocynaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium 733 |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 100 µg/ml, 7H11 agar: > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ibogaine |
| PubChem ID | 197060 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Indole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 310.205 |
| Molecular Formula | C20H26N2O |
| SMILES | O(c1cc2c3c([nH]c2cc1)[C@H]1[C@H]2N(C[C@@H](C1)C[C@@H]2CC)CC3)C |
| XLogP | 3.580 |
| PSA | 28.260 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3380 |
| Compound Structure |  |
| Plant Source | Tabernaemontana citrifolia Common Name:NR |
| Source Family | Apocynaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium kansasii (Clinical isolate 94 - 069) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 100 µg/ml, 7H11 agar: 100 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Voacangine |
| PubChem ID | 73255 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Indole, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 368.210 |
| Molecular Formula | C22H28N2O3 |
| SMILES | O(C(=O)[C@]12[C@H]3N(C[C@H](C1)C[C@@H]3CC)CCc1c2[nH]c2c1cc(OC)cc2)C |
| XLogP | 3.286 |
| PSA | 54.560 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 2 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3381 |
| Compound Structure |  |
| Plant Source | Tabernaemontana citrifolia Common Name:NR |
| Source Family | Apocynaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 50 µg/ml, 7H11 agar: 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Voacangine |
| PubChem ID | 73255 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Indole, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 368.210 |
| Molecular Formula | C22H28N2O3 |
| SMILES | O(C(=O)[C@]12[C@H]3N(C[C@H](C1)C[C@@H]3CC)CCc1c2[nH]c2c1cc(OC)cc2)C |
| XLogP | 3.286 |
| PSA | 54.560 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 2 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3382 |
| Compound Structure |  |
| Plant Source | Tabernaemontana citrifolia Common Name:NR |
| Source Family | Apocynaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium 733 |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 50 µg/ml, 7H11 agar: > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Voacangine |
| PubChem ID | 73255 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Indole, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 368.210 |
| Molecular Formula | C22H28N2O3 |
| SMILES | O(C(=O)[C@]12[C@H]3N(C[C@H](C1)C[C@@H]3CC)CCc1c2[nH]c2c1cc(OC)cc2)C |
| XLogP | 3.286 |
| PSA | 54.560 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 2 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3383 |
| Compound Structure |  |
| Plant Source | Tabernaemontana citrifolia Common Name:NR |
| Source Family | Apocynaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium kansasii (Clinical isolate 94 - 069) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 50 µg/ml, 7H11 agar: 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ibogaine |
| PubChem ID | 197060 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Indole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 310.205 |
| Molecular Formula | C20H26N2O |
| SMILES | O(c1cc2c3c([nH]c2cc1)[C@H]1[C@H]2N(C[C@@H](C1)C[C@@H]2CC)CC3)C |
| XLogP | 3.580 |
| PSA | 28.260 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3538 |
| Compound Structure |  |
| Plant Source | Tabernaemontana citrifolia Common Name:NR |
| Source Family | Apocynaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 50 µg/ml, 7H11 agar: 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ibogaine |
| PubChem ID | 197060 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by Chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with Chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Indole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 310.205 |
| Molecular Formula | C20H26N2O |
| SMILES | O(c1cc2c3c([nH]c2cc1)[C@H]1[C@H]2N(C[C@@H](C1)C[C@@H]2CC)CC3)C |
| XLogP | 3.580 |
| PSA | 28.260 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 2 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Vikramjitmandal, rachanake |
| Compound ID | 3563 |
| Compound Structure |  |
| Plant Source | Cryptolepis sanguinolenta Common Name:Nibima |
| Source Family | Apocynaceae |
| Origin | West Africa |
| Plant Part Used | Root |
| Extract | Ammonia moistened chloroform |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | MTT Assay |
| Positive Control Used (conc.) | Ethambutol (8 µg/ml), Isoniazid (0.5 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cryptolepine hydrochloride |
| PubChem ID | 156093 |
| Ethnomedicinal Information | Antimycobacterial, antimalarial |
| PubMed ID [Source Literature] | 12722159 |
| Extract Preparation | Cryptolepine was isolated from Cryptolepis sanguinolenta roots and crystallized as the hydrochloride salt |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Indole
|
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton broth, Colombia blood agar, 7H9 Middle Brook medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 232.100 |
| Molecular Formula | C16H13ClN2 |
| SMILES | Cl.n1(c2c(nc3c2cccc3)cc2c1cccc2)C |
| XLogP | 4.596 |
| PSA | 15.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Gibbons S, Fallah F, Wright CW.Cryptolepine hydrochloride: a potent antimycobacterial alkaloid derived from Cryptolepis sanguinolenta.Phytother Res. 2003 Apr;17(4):434-6
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3564 |
| Compound Structure |  |
| Plant Source | Cryptolepis sanguinolenta Common Name:Nibima |
| Source Family | Apocynaceae |
| Origin | West Africa |
| Plant Part Used | Root |
| Extract | Ammonia moistened chloroform |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | MTT Assay |
| Positive Control Used (conc.) | Ethambutol (0.25 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cryptolepine hydrochloride |
| PubChem ID | 156093 |
| Ethnomedicinal Information | Antimycobacterial, antimalarial |
| PubMed ID [Source Literature] | 12722159 |
| Extract Preparation | Cryptolepine was isolated from Cryptolepis sanguinolenta roots and crystallized as the hydrochloride salt |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Indole
|
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton broth, Colombia blood agar, 7H9 Middle Brook medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 232.100 |
| Molecular Formula | C16H13ClN2 |
| SMILES | Cl.n1(c2c(nc3c2cccc3)cc2c1cccc2)C |
| XLogP | 4.596 |
| PSA | 15.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Gibbons S, Fallah F, Wright CW.Cryptolepine hydrochloride: a potent antimycobacterial alkaloid derived from Cryptolepis sanguinolenta.Phytother Res. 2003 Apr;17(4):434-6
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3565 |
| Compound Structure |  |
| Plant Source | Cryptolepis sanguinolenta Common Name:Nibima |
| Source Family | Apocynaceae |
| Origin | West Africa |
| Plant Part Used | Root |
| Extract | Ammonia moistened chloroform |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | MTT Assay |
| Positive Control Used (conc.) | Ethambutol (1 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cryptolepine hydrochloride |
| PubChem ID | 156093 |
| Ethnomedicinal Information | Antimycobacterial, antimalarial |
| PubMed ID [Source Literature] | 12722159 |
| Extract Preparation | Cryptolepine was isolated from Cryptolepis sanguinolenta roots and crystallized as the hydrochloride salt |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Indole
|
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton broth, Colombia blood agar, 7H9 Middle Brook medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 232.100 |
| Molecular Formula | C16H13ClN2 |
| SMILES | Cl.n1(c2c(nc3c2cccc3)cc2c1cccc2)C |
| XLogP | 4.596 |
| PSA | 15.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Gibbons S, Fallah F, Wright CW.Cryptolepine hydrochloride: a potent antimycobacterial alkaloid derived from Cryptolepis sanguinolenta.Phytother Res. 2003 Apr;17(4):434-6
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3566 |
| Compound Structure |  |
| Plant Source | Cryptolepis sanguinolenta Common Name:Nibima |
| Source Family | Apocynaceae |
| Origin | West Africa |
| Plant Part Used | Root |
| Extract | Ammonia moistened chloroform |
| Target Bacteria | Mycobacterium abscessus |
| Assay / Test Done | MTT Assay |
| Positive Control Used (conc.) | Ethambutol (128 µg/ml), Isoniazid (32 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cryptolepine hydrochloride |
| PubChem ID | 156093 |
| Ethnomedicinal Information | Antimycobacterial, antimalarial |
| PubMed ID [Source Literature] | 12722159 |
| Extract Preparation | Cryptolepine was isolated from Cryptolepis sanguinolenta roots and crystallized as the hydrochloride salt |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Indole
|
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton broth, Colombia blood agar, 7H9 Middle Brook medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 232.100 |
| Molecular Formula | C16H13ClN2 |
| SMILES | Cl.n1(c2c(nc3c2cccc3)cc2c1cccc2)C |
| XLogP | 4.596 |
| PSA | 15.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Gibbons S, Fallah F, Wright CW.Cryptolepine hydrochloride: a potent antimycobacterial alkaloid derived from Cryptolepis sanguinolenta.Phytother Res. 2003 Apr;17(4):434-6
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3567 |
| Compound Structure |  |
| Plant Source | Cryptolepis sanguinolenta Common Name:Nibima |
| Source Family | Apocynaceae |
| Origin | West Africa |
| Plant Part Used | Root |
| Extract | Ammonia moistened chloroform |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | MTT Assay |
| Positive Control Used (conc.) | Ethambutol (1 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cryptolepine hydrochloride |
| PubChem ID | 156093 |
| Ethnomedicinal Information | Antimycobacterial,AntimalAerial |
| PubMed ID [Source Literature] | 12722159 |
| Extract Preparation | Cryptolepine was isolated from Cryptolepis sanguinolenta roots and crystallized as the hydrochloride salt |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Indole
|
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton broth, Colombia blood agar, 7H9 Middle Brook medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 232.100 |
| Molecular Formula | C16H13ClN2 |
| SMILES | Cl.n1(c2c(nc3c2cccc3)cc2c1cccc2)C |
| XLogP | 4.596 |
| PSA | 15.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Gibbons S, Fallah F, Wright CW.Cryptolepine hydrochloride: a potent antimycobacterial alkaloid derived from Cryptolepis sanguinolenta.Phytother Res. 2003 Apr;17(4):434-6
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3568 |
| Compound Structure |  |
| Plant Source | Cryptolepis sanguinolenta Common Name:Nibima |
| Source Family | Apocynaceae |
| Origin | West Africa |
| Plant Part Used | Root |
| Extract | Ammonia moistened chloroform |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | MTT Assay |
| Positive Control Used (conc.) | Streptomycin sulphate (6.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Cryptolepine hydrochloride |
| PubChem ID | 156093 |
| Ethnomedicinal Information | Antimycobacterial,AntimalAerial |
| PubMed ID [Source Literature] | 12722159 |
| Extract Preparation | Cryptolepine was isolated from Cryptolepis sanguinolenta roots and crystallized as the hydrochloride salt |
| Chemical Classification [Active Compound] | Aromatic, Quinoline, Alkaloid, Indole
|
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton broth, Colombia blood agar, 7H9 Middle Brook medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 232.100 |
| Molecular Formula | C16H13ClN2 |
| SMILES | Cl.n1(c2c(nc3c2cccc3)cc2c1cccc2)C |
| XLogP | 4.596 |
| PSA | 15.600 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Gibbons S, Fallah F, Wright CW.Cryptolepine hydrochloride: a potent antimycobacterial alkaloid derived from Cryptolepis sanguinolenta.Phytother Res. 2003 Apr;17(4):434-6
|
| Curator | Wvarsha, rachanake |
| Compound ID | 4129 |
| Compound Structure |  |
| Plant Source | Cryptolepis sanguinolenta Common Name: |
| Source Family | Apocynaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cryptolepine |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Indole, Quinoline |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 233.108 |
| Molecular Formula | C16H13N2
|
| SMILES | C[n+]1c2c(cccc2)cc2c1c1ccccc1[nH]2 |
| XLogP | 4.611 |
| PSA | 19.670 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |
| Compound ID | 4130 |
| Compound Structure |  |
| Plant Source | Cryptolepis sanguinolenta Common Name: |
| Source Family | Apocynaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cryptolepine |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Indole, Quinoline |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 233.108 |
| Molecular Formula | C16H13N2
|
| SMILES | C[n+]1c2c(cccc2)cc2c1c1ccccc1[nH]2 |
| XLogP | 4.611 |
| PSA | 19.670 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |
| Compound ID | 4131 |
| Compound Structure |  |
| Plant Source | Cryptolepis sanguinolenta Common Name: |
| Source Family | Apocynaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cryptolepine |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Indole, Quinoline |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 233.108 |
| Molecular Formula | C16H13N2
|
| SMILES | C[n+]1c2c(cccc2)cc2c1c1ccccc1[nH]2 |
| XLogP | 4.611 |
| PSA | 19.670 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |