| Compound ID | 1974 |
| Compound Structure |  |
| Plant Source | Karwinskia humboldtiana Common Name:Wild Cherry |
| Source Family | Rhamnaceae |
| Origin | USA |
| Plant Part Used | Root |
| Extract | Dichloromethane, ethanol (95 %) |
| Target Bacteria | Mycobacterium smegmatis (ATCC 607) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Karwinaphthol B |
| PubChem ID | 442522 |
| Ethnomedicinal Information | Seeds are poisonous but fruit pulp is edible. Used locally in Mexico to treat convulsions |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Isochroman, Benzopyran, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 288.136 |
| Molecular Formula | C17H20O4
|
| SMILES | O1[C@@H](c2c(C[C@@H]1C)cc1c(c2O)c(OC)cc(OC)c1)C |
| XLogP | 2.444 |
| PSA | 47.920 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Gollapudi SR, Oburn DS, Drake S. 1985. Antimicrobial agents from higher plants: Two dimethylbenzisochromans from Karawinskia humboldtiana. Phytochemistry 24: 1681±1683.
2) Usher G. 1974. A Dictionary of Plants Used by Man. Macmillan: New York; 82
|
| Curator | |
