| Compound ID | 1413 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Peracetyl - Strictosidine Lactam |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Carbazole, Pyran, Isoquinoline, O-Acetyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 650.284 |
| Molecular Formula | C35H42N2O10 |
| SMILES | C1cccc2c1c1c([nH]2)C2N(CC1)CC1=COC(C(C1C2)C=C)OC1O[C@H]([C@@H]([C@H]([C@@H]1OC(=O)C)CC(=O)C)OC(=O)C)COC(=O)C |
| XLogP | 3.192 |
| PSA | 142.690 |
| H-bond Donor | 1 |
| H-bond Acceptor | 12 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1415 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Peracetyl - Strictosidine Lactam |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Carbazole, Pyran, Isoquinoline, O-Acetyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 650.284 |
| Molecular Formula | C35H42N2O10 |
| SMILES | C1cccc2c1c1c([nH]2)C2N(CC1)CC1=COC(C(C1C2)C=C)OC1O[C@H]([C@@H]([C@H]([C@@H]1OC(=O)C)CC(=O)C)OC(=O)C)COC(=O)C |
| XLogP | 3.192 |
| PSA | 142.690 |
| H-bond Donor | 1 |
| H-bond Acceptor | 12 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1417 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Peracetyl - strictosidine lactam |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Carbazole, Pyran, Isoquinoline, O-Acetyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 650.284 |
| Molecular Formula | C35H42N2O10 |
| SMILES | C1cccc2c1c1c([nH]2)C2N(CC1)CC1=COC(C(C1C2)C=C)OC1O[C@H]([C@@H]([C@H]([C@@H]1OC(=O)C)CC(=O)C)OC(=O)C)COC(=O)C |
| XLogP | 3.192 |
| PSA | 142.690 |
| H-bond Donor | 1 |
| H-bond Acceptor | 12 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1419 |
| Compound Structure |  |
| Plant Source | Cephaelis dichroa Common Name: |
| Source Family | Rubiaceae |
| Origin | Mexico |
| Plant Part Used | Aerial |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Peracetyl - Strictosidine Lactam |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Alkaloid, Carbazole, Pyran, Isoquinoline, O-Acetyl, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 650.284 |
| Molecular Formula | C35H42N2O10 |
| SMILES | C1cccc2c1c1c([nH]2)C2N(CC1)CC1=COC(C(C1C2)C=C)OC1O[C@H]([C@@H]([C@H]([C@@H]1OC(=O)C)CC(=O)C)OC(=O)C)COC(=O)C |
| XLogP | 3.192 |
| PSA | 142.690 |
| H-bond Donor | 1 |
| H-bond Acceptor | 12 |
| No. of Rotatable Bond Count | 12 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1533 |
| Compound Structure |  |
| Plant Source | Coptis coinensia French Common Name: |
| Source Family | Ranunculaceae |
| Origin | China |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | 1:800 dilution |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Berberine bisulphate |
| PubChem ID | 12457 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 14778141 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Isoquinoline, Sulphate |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 336.124 |
| Molecular Formula | C20H19NO8S |
| SMILES | S(=O)(=O)(O)[O-].O1c2cc3CC[n+]4c(c3cc2OC1)cc1c(c4)c(OC)c(OC)cc1 |
| XLogP | 2.896 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Wang VF.In vitro antibacterial activity of some common Chinese herbs on Mycobacteria tuberculosis.Chin Med J. 1950 May-Jun;68(5-6):169-72
|
| Curator | |
| Compound ID | 1876 |
| Compound Structure |  |
| Plant Source | Hydrastis canadensis Common Name:Goldenseal |
| Source Family | Ranunculaceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium smegmatis (ATCC 607) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin sulfate (1.56 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Berberine |
| PubChem ID | 2353 |
| Ethnomedicinal Information | Berberine has been demonstrated to reduce the infectivity of bacteria, fungi and protozoa in animals and humans by inhibiting the adherence of microorganisms to the host cells |
| PubMed ID [Source Literature] | 9784149, 4906191 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Isoquinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 336.124 |
| Molecular Formula | C20H18NO4 |
| SMILES | O1c2cc3CC[n+]4c(c3cc2OC1)cc1c(c4)c(OC)c(OC)cc1 |
| XLogP | 2.896 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gentry EJ, Jampani HB, Keshavarz-Shokri A, Morton MD, Velde DV, Telikepalli H, Mitscher LA, Shawar R, Humble D, Baker W.Antitubercular natural products: berberine from the roots of commercial Hydrastis canadensis powder. Isolation of inactive 8-oxotetrahydrothalifendine, canadine, beta-hydrastine, and two new quinic acid esters, hycandinic acid esters-1 and -2.J Nat Prod. 1998 Oct;61(10):1187-93
2) Amin AH, Subbaiah TV, Abbasi KM.Berberine sulfate: antimicrobial activity, bioassay, and mode of action.Can J Microbiol. 1969 Sep;15(9):1067-76
|
| Curator | |
| Compound ID | 1877 |
| Compound Structure |  |
| Plant Source | Hydrastis canadensis Common Name:Goldenseal |
| Source Family | Ranunculaceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Berberine |
| PubChem ID | 2353 |
| Ethnomedicinal Information | Berberine has been demonstrated to reduce the infectivity of bacteria, fungi and protozoa in animals and humans by inhibiting the adherence of microorganisms to the host cells |
| PubMed ID [Source Literature] | 9784149, 4906191 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Isoquinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 336.124 |
| Molecular Formula | C20H18NO4 |
| SMILES | O1c2cc3CC[n+]4c(c3cc2OC1)cc1c(c4)c(OC)c(OC)cc1 |
| XLogP | 2.896 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gentry EJ, Jampani HB, Keshavarz-Shokri A, Morton MD, Velde DV, Telikepalli H, Mitscher LA, Shawar R, Humble D, Baker W.Antitubercular natural products: berberine from the roots of commercial Hydrastis canadensis powder. Isolation of inactive 8-oxotetrahydrothalifendine, canadine, beta-hydrastine, and two new quinic acid esters, hycandinic acid esters-1 and -2.J Nat Prod. 1998 Oct;61(10):1187-93
2) Amin AH, Subbaiah TV, Abbasi KM.Berberine sulfate: antimicrobial activity, bioassay, and mode of action.Can J Microbiol. 1969 Sep;15(9):1067-76
|
| Curator | |
| Compound ID | 1878 |
| Compound Structure |  |
| Plant Source | Hydrastis canadensis Common Name:Goldenseal |
| Source Family | Ranunculaceae |
| Origin | North America |
| Plant Part Used | Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium avium complex |
| Assay / Test Done | |
| Positive Control Used (conc.) | Streptomycin sulfate (6.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Berberine |
| PubChem ID | 2353 |
| Ethnomedicinal Information | Berberine has been demonstrated to reduce the infectivity of bacteria, fungi and protozoa in animals and humans by inhibiting the adherence of microorganisms to the host cells |
| PubMed ID [Source Literature] | 9784149, 4906191 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Isoquinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 336.124 |
| Molecular Formula | C20H18NO4 |
| SMILES | O1c2cc3CC[n+]4c(c3cc2OC1)cc1c(c4)c(OC)c(OC)cc1 |
| XLogP | 2.896 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Gentry EJ, Jampani HB, Keshavarz-Shokri A, Morton MD, Velde DV, Telikepalli H, Mitscher LA, Shawar R, Humble D, Baker W.Antitubercular natural products: berberine from the roots of commercial Hydrastis canadensis powder. Isolation of inactive 8-oxotetrahydrothalifendine, canadine, beta-hydrastine, and two new quinic acid esters, hycandinic acid esters-1 and -2.J Nat Prod. 1998 Oct;61(10):1187-93
2) Amin AH, Subbaiah TV, Abbasi KM.Berberine sulfate: antimicrobial activity, bioassay, and mode of action.Can J Microbiol. 1969 Sep;15(9):1067-76
|
| Curator | |
| Compound ID | 2635 |
| Compound Structure |  |
| Plant Source | Stephania dinklagei Common Name: |
| Source Family | Menispermaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 3.125 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Liriodenin |
| PubChem ID | 10144 |
| Ethnomedicinal Information | Cough, stomach troubles, diarrhoea, dysentery |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Isoquinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 275.058 |
| Molecular Formula | C17H9NO3 |
| SMILES | O1c2c3c4c(cc2OC1)ccnc4C(=O)c1c3cccc1 |
| XLogP | 3.275 |
| PSA | 48.420 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://plants.jstor.org/upwta/4_241
|
| Curator | |
| Compound ID | 2637 |
| Compound Structure |  |
| Plant Source | Stephania dinklagei Common Name: |
| Source Family | Menispermaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Liriodenin |
| PubChem ID | 10144 |
| Ethnomedicinal Information | Cough, stomach troubles, diarrhoea, dysentery |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Isoquinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 275.058 |
| Molecular Formula | C17H9NO3 |
| SMILES | O1c2c3c4c(cc2OC1)ccnc4C(=O)c1c3cccc1 |
| XLogP | 3.275 |
| PSA | 48.420 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://plants.jstor.org/upwta/4_241
|
| Curator | |
| Compound ID | 2639 |
| Compound Structure |  |
| Plant Source | Stephania dinklagei Common Name: |
| Source Family | Menispermaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Liriodenin |
| PubChem ID | 10144 |
| Ethnomedicinal Information | Cough, stomach troubles, diarrhoea, dysentery |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Isoquinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 275.058 |
| Molecular Formula | C17H9NO3 |
| SMILES | O1c2c3c4c(cc2OC1)ccnc4C(=O)c1c3cccc1 |
| XLogP | 3.275 |
| PSA | 48.420 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://plants.jstor.org/upwta/4_241
|
| Curator | |
| Compound ID | 2641 |
| Compound Structure |  |
| Plant Source | Stephania dinklagei Common Name: |
| Source Family | Menispermaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Liriodenin |
| PubChem ID | 10144 |
| Ethnomedicinal Information | Cough, stomach troubles, diarrhoea, dysentery |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Isoquinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 275.058 |
| Molecular Formula | C17H9NO3 |
| SMILES | O1c2c3c4c(cc2OC1)ccnc4C(=O)c1c3cccc1 |
| XLogP | 3.275 |
| PSA | 48.420 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://plants.jstor.org/upwta/4_241
|
| Curator | |
| Compound ID | 3395 |
| Compound Structure |  |
| Plant Source | Hydrastis canadensis Common Name: |
| Source Family | Ranunculaceae |
| Origin | North America |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Berberine |
| PubChem ID | 2353 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9828037 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Isoquinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 336.124 |
| Molecular Formula | C20H18NO4 |
| SMILES | O1c2cc3CC[n+]4c(c3cc2OC1)cc1c(c4)c(OC)c(OC)cc1 |
| XLogP | 2.896 |
| PSA | 40.800 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mitscher LA, Baker W.Tuberculosis: a search for novel therapy starting with natural products.Med Res Rev. 1998 Nov;18(6):363-74
|
| Curator | Wvarsha, keyamukherjee, rachanake |
| Compound ID | 4045 |
| Compound Structure |  |
| Plant Source | Goniothalamus laoticus Common Name: |
| Source Family | Annonaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (-)-nordicentrine |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Alkaloid, Isoquinoline, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 325.131 |
| Molecular Formula | C19H19NO4 |
| SMILES | [C@@H]12NCCc3c2c(c2c(C1)cc(c(c2)OC)OC)c1c(c3)OCO1 |
| XLogP | 1.925 |
| PSA | 48.950 |
| H-bond Donor | 1 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 5 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |