| Compound ID | 1084 |
| Compound Structure |  |
| Plant Source | Ailanthus altissima (Mill.) Swingle syn. Altissima glandulsa Desf. Common Name:Tree of Heaven, Ailanto (English), Aralu (Sanskrit) |
| Source Family | Simaroubaceae |
| Origin | India, China |
| Plant Part Used | Mother tinture |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin (0.031 µg/ml) |
| Inhibition [%] | 19 % |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Shinjulactone K |
| PubChem ID | 460541 |
| Ethnomedicinal Information | Used for treating mental illness, nausea and headache, treating cardiac palpitation, asthma and epilepsy |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Terpene, Triterpene, Quassinoid, Lactone, O-Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 408.215 |
| Molecular Formula | C22H32O7 |
| SMILES | O1[C@H]2[C@@]3([C@@H]([C@@]4([C@@H](C2)[C@@H](C[C@H](O)C4=O)C)C)[C@H](O)[C@H](OC(=O)C)[C@@H]([C@@H]3CC1=O)C)C |
| XLogP | 1.595 |
| PSA | 110.130 |
| H-bond Donor | 2 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) Rahman S, Fukamiya N, Okano M, Tagahara K, Lee KH.Anti-tuberculosis activity of quassinoids.Chem Pharm Bull (Tokyo). 1997 Sep;45(9):1527-9
|
| Curator | |
| Compound ID | 1085 |
| Compound Structure |  |
| Plant Source | Ailanthus altissima (Mill.) Swingle syn. Altissima glandulsa Desf. Common Name:Tree of Heaven, Ailanto (English), Aralu (Sanskrit) |
| Source Family | Simaroubaceae |
| Origin | India, China |
| Plant Part Used | Mother tinture |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin (0.031 µg/ml) |
| Inhibition [%] | 17 % |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ailanthone |
| PubChem ID | 72965 |
| Ethnomedicinal Information | Used for treating mental illness, nausea and headache, treating cardiac palpitation, asthma and epilepsy |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Quassinoid, Furanoid, Lactone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 376.152 |
| Molecular Formula | C20H24O7 |
| SMILES | O1[C@]2(O)[C@H]3[C@]4([C@H](OC(=O)C[C@H]4C(=C)[C@H]2O)C[C@@H]2[C@@]3([C@H](O)C(=O)C=C2C)C)C1 |
| XLogP | -0.429 |
| PSA | 113.290 |
| H-bond Donor | 3 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) Rahman S, Fukamiya N, Okano M, Tagahara K, Lee KH.Anti-tuberculosis activity of quassinoids.Chem Pharm Bull (Tokyo). 1997 Sep;45(9):1527-9
|
| Curator | |
| Compound ID | 1086 |
| Compound Structure |  |
| Plant Source | Ailanthus altissima (Mill.) Swingle syn. Altissima glandulsa Desf. Common Name:Tree of Heaven, Ailanto (English), Aralu (Sanskrit) |
| Source Family | Simaroubaceae |
| Origin | India, China |
| Plant Part Used | Mother tinture |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin (0.031 µg/ml) |
| Inhibition [%] | 15 % |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Shinjudilactone |
| PubChem ID | 460534 |
| Ethnomedicinal Information | Used for treating mental illness, nausea and headache, treating cardiac palpitation, asthma and epilepsy |
| PubMed ID [Source Literature] | 17276637 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Quassinoid, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 376.152 |
| Molecular Formula | C20H24O7 |
| SMILES | O1[C@H]2[C@]34[C@@H]([C@@]5([C@@H](C2)C(=CC(=O)[C@H]5O)C)C)[C@](O)(C([C@@H]3CC1=O)C)C(=O)OC4 |
| XLogP | 0.413 |
| PSA | 110.130 |
| H-bond Donor | 2 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Gautam R, Saklani A, Jachak SM.Indian medicinal plants as a source of antimycobacterial agents.J Ethnopharmacol. 2007 Mar 21;110(2):200-34
2) Rahman S, Fukamiya N, Okano M, Tagahara K, Lee KH.Anti-tuberculosis activity of quassinoids.Chem Pharm Bull (Tokyo). 1997 Sep;45(9):1527-9
|
| Curator | |
| Compound ID | 1751 |
| Compound Structure |  |
| Plant Source | Ficus nervosa Synonym : Ficus angustifolia Roxb Common Name:Wild Banyan Tree (English) |
| Source Family | Moraceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Middlebrook 7 H10 agar method |
| Positive Control Used (conc.) | Ethambutol (6.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | >= 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (S) - Lasiodiplodin |
| PubChem ID | NR |
| Ethnomedicinal Information | Used in treatment of cough and asthma |
| PubMed ID [Source Literature] | 20658670 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Lactone, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 292.167 |
| Molecular Formula | C17H24O4
|
| SMILES | C1c(cc(c2c1CCCCCCC[C@@H](OC2=O)C)OC)O |
| XLogP | 5.001 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Chen LW, Cheng MJ, Peng CF, Chen IS. Secondary Metabolites and Antimycobacterial Activities from the Roots of Ficus nervosa, Chemistry & Biodiversity Volume 7, Issue 7, pages 1814–1821, July 2010
|
| Curator | |
| Compound ID | 1928 |
| Compound Structure |  |
| Plant Source | Inula racemosa Hook. f. syn. Inula helenium L. Common Name:Elecampane (English), Pushkaramula, Pushkara, Paushkara, Padmapatra, Kaashmira, Kushtha - bheda (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Root |
| Extract | Hexane, dichloromethane, methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Alantolactone |
| PubChem ID | 72724 |
| Ethnomedicinal Information | Tuberculosis, lung disorders, cough, expectorant,Random screening,bronchitis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2
|
| SMILES | O1[C@@H]2C[C@@]3(C(=C[C@@H]2C(=C)C1=O)[C@H](CCC3)C)C |
| XLogP | 3.443 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1929 |
| Compound Structure |  |
| Plant Source | Inula racemosa Hook. f. syn. Inula helenium L. Common Name:Elecampane (English), Pushkaramula, Pushkara, Paushkara, Padmapatra, Kaashmira, Kushtha - bheda (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India, USA |
| Plant Part Used | Root |
| Extract | Hexane, dichloromethane, methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Isoalantolactone |
| PubChem ID | 73285 |
| Ethnomedicinal Information | Tuberculosis, lung disorders, cough, expectorant, random screening, bronchitis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2
|
| SMILES | O1[C@@H]2C[C@@]3([C@@H](C[C@@H]2C(=C)C1=O)C(=C)CCC3)C |
| XLogP | 3.681 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1930 |
| Compound Structure |  |
| Plant Source | Inula racemosa Hook. f. syn. Inula helenium L. Common Name:Elecampane (English), Pushkaramula, Pushkara, Paushkara, Padmapatra, Kaashmira, Kushtha - bheda (Sanskrit) |
| Source Family | Asteraceae (Compositae) |
| Origin | India |
| Plant Part Used | Root |
| Extract | Hexane, dichloromethane, methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 11, 13 - Dihydroisoalantolactone |
| PubChem ID | 474517 |
| Ethnomedicinal Information | Tuberculosis, lung disorders, cough, expectorant, random screening, bronchitis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 234.162 |
| Molecular Formula | C15H22O2
|
| SMILES | O1[C@H]2[C@H](C[C@@H]3[C@@](C2)(CCCC3=C)C)C(C1=O)C |
| XLogP | 3.863 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 2100 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Costunolide |
| PubChem ID | 5281437 |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2
|
| SMILES | O1[C@H]2[C@@H](CC/C(=C/CC/C(=C/2)/C)/C)C(=C)C1=O |
| XLogP | 3.308 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2101 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Parthenolide |
| PubChem ID | 7251185 |
| Ethnomedicinal Information | Cytotoxic, anti-tumor, anti-bacterial, anti-fungal, anti-inflammatory, european fever, migraine |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1[C@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC/C(=C/CC2)/C)C |
| XLogP | 2.449 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2102 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1,10-Epoxycostunolide |
| PubChem ID | 6474991 |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1C2([C@H]1CC/C(=C/[C@H]1OC(=O)C(=C)[C@@H]1CC2)/C)C |
| XLogP | 2.082 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2103 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Clarithroycin (1 - 2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Costunolide |
| PubChem ID | 5281437 |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2
|
| SMILES | O1[C@H]2[C@@H](CC/C(=C/CC/C(=C/2)/C)/C)C(=C)C1=O |
| XLogP | 3.308 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2104 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Clarithroycin (1 - 2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Parthenolide |
| PubChem ID | 7251185 |
| Ethnomedicinal Information | Cytotoxic, anti-tumor, anti-bacterial, anti-fungal, anti-inflammatory, european fever, migraine |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1[C@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC/C(=C/CC2)/C)C |
| XLogP | 2.449 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2105 |
| Compound Structure |  |
| Plant Source | Magnolia grandiflora L. Common Name:Bull Bay, Great Laurel Magnolia, Southern Magnolia (English), Him - Champaa (Sanskrit) |
| Source Family | Magnoliaceae |
| Origin | India, USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | |
| Positive Control Used (conc.) | Clarithroycin (1 - 2 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1,10-Epoxycostunolide |
| PubChem ID | 6474991 |
| Ethnomedicinal Information | Stimulant, diaphoretic, tonic, malaria, rheumatism, random screening, Other u - methylene - g - lactone - bearing sesquiterpene lactones are moderately active against MT with MICs of 64, |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Epoxy, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1C2([C@H]1CC/C(=C/[C@H]1OC(=O)C(=C)[C@@H]1CC2)/C)C |
| XLogP | 2.082 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2288 |
| Compound Structure |  |
| Plant Source | Parmelia saxatilis L. Common Name:Lichen |
| Source Family | Parmeliaceae |
| Origin | British Columbia |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium aurum |
| Assay / Test Done | |
| Positive Control Used (conc.) | Rifampin (2 µg/ml), Streptomycin (0.25 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 250 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Salazinic acid |
| PubChem ID | 5320418 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 9795033 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Depside, Aldehyde, Lactone, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 388.043 |
| Molecular Formula | C18H12O10
|
| SMILES | O1c2c3c(c(O)c(c2OC(=O)c2c1c(c(O)cc2C)C=O)CO)C(=O)OC3O |
| XLogP | 0.720 |
| PSA | 159.820 |
| H-bond Donor | 4 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 10 |
| No. of S | 0 |
| Reference(s) | 1) Ingólfsdóttir K, Chung GA, Skúlason VG, Gissurarson SR, Vilhelmsdóttir M.Antimycobacterial activity of lichen metabolites in vitro.Eur J Pharm Sci. 1998 Apr;6(2):141-4
|
| Curator | |
| Compound ID | 2113 |
| Compound Structure |  |
| Plant Source | Magnolia virginiana Common Name: |
| Source Family | Magnoliaceae |
| Origin | USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Costunolide |
| PubChem ID | 5281437 |
| Ethnomedicinal Information | In the treatment of malaria and is also taken internally in the treatment of colds, bronchial diseases, upper respiratory tract infections, rheumatism and gout |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2
|
| SMILES | O1[C@H]2[C@@H](CC/C(=C/CC/C(=C/2)/C)/C)C(=C)C1=O |
| XLogP | 3.308 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2114 |
| Compound Structure |  |
| Plant Source | Magnolia virginiana Common Name: |
| Source Family | Magnoliaceae |
| Origin | USA |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Parthenolide |
| PubChem ID | 7251185 |
| Ethnomedicinal Information | Cytotoxic, anti-tumor, anti-bacterial, anti-fungal, anti-inflammatory, european fever, migraine |
| PubMed ID [Source Literature] | 9747541 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3
|
| SMILES | O1[C@]2([C@H]1[C@H]1OC(=O)C(=C)[C@@H]1CC/C(=C/CC2)/C)C |
| XLogP | 2.449 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Fischer NH, Lu T, Cantrell CL, Castañeda-Acosta J, Quijano L, Franzblau SG.Antimycobacterial evaluation of germacranolides.Phytochemistry. 1998 Sep;49(2):559-64
|
| Curator | |
| Compound ID | 2432 |
| Compound Structure |  |
| Plant Source | Potamogeton malaianus Common Name:Curly Pondweed (English) |
| Source Family | Potamogetonaceae |
| Origin | India |
| Plant Part Used | |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Potamogetonin |
| PubChem ID | 6453492 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 11277765 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, Furanoid, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 314.188 |
| Molecular Formula | C20H26O3 |
| SMILES | CC12CCCC3(C1CCC(=C)C3CCC4=COC=C4)C(=O)OC2 |
| XLogP | 4.183 |
| PSA | 39.440 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Kittakoop P, Wanasith S, Watts P, Kramyu J, Tanticharoen M, Thebtaranonth Y.Potent antiviral potamogetonyde and potamogetonol, new furanoid labdane diterpenes from Potamogeton malaianus.J Nat Prod. 2001 Mar;64(3):385-8
|
| Curator | |
| Compound ID | 2433 |
| Compound Structure |  |
| Plant Source | Potamogeton malaianus Common Name:Curly Pondweed (English) |
| Source Family | Potamogetonaceae |
| Origin | India |
| Plant Part Used | |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 15,16-epoxy-12-oxo-8(17),13(16),14-labdatrien-20,19-olide |
| PubChem ID | 5478978 |
| Ethnomedicinal Information | Anti-inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 11277765 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Diterpene, Terpene, Furanoid, Lactone, Ketone, Acetyl, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 328.167 |
| Molecular Formula | C20H24O4
|
| SMILES | O1C[C@]2([C@@H]3[C@]([C@@H](C(=C)CC3)CC(=O)c3ccoc3)(CCC2)C1=O)C |
| XLogP | 2.899 |
| PSA | 56.510 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Kittakoop P, Wanasith S, Watts P, Kramyu J, Tanticharoen M, Thebtaranonth Y.Potent antiviral potamogetonyde and potamogetonol, new furanoid labdane diterpenes from Potamogeton malaianus.J Nat Prod. 2001 Mar;64(3):385-8
|
| Curator | |
| Compound ID | 2509 |
| Compound Structure |  |
| Plant Source | Rudbeckia submentosa Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Root, leaf, stem, flower |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Alloalantolactone |
| PubChem ID | 474518 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 232.146 |
| Molecular Formula | C15H20O2
|
| SMILES | O1[C@@H]2C[C@@]3(C(=C(CCC3)C)C[C@@H]2C(=C)C1=O)C |
| XLogP | 2.891 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
|
| Curator | |
| Compound ID | 2510 |
| Compound Structure |  |
| Plant Source | Rudbeckia submentosa Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Root, leaf, stem, flower |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | Rifampin (0.25 - 0.125 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3 - Oxoalloalatolactone |
| PubChem ID | 474519 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 10364842 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone, Ketone |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3
|
| SMILES | O1[C@@H]2C[C@@]3(C(=C(C(=O)CC3)C)C[C@@H]2C(=C)C1=O)C |
| XLogP | 0.918 |
| PSA | 43.370 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Abate L, Fronczek FR, Franzblau SG, Quijano L, Fischer NH.Antimycobacterial eudesmanolides from Inula helenium and Rudbeckia subtomentosa.Planta Med. 1999 May;65(4):351-5
|
| Curator | |
| Compound ID | 2620 |
| Compound Structure |  |
| Plant Source | Solidago rugosa Mill Common Name:Wrinkleleaf Goldenrod |
| Source Family | Asteraceae (Compositae) |
| Origin | North America |
| Plant Part Used | Root, Aerial |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Monoacetate |
| PubChem ID | 3035155 |
| Ethnomedicinal Information | Anti - inflammatory, tuberculosis |
| PubMed ID [Source Literature] | 7772306 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Lactone, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 806.445 |
| Molecular Formula | C43H66O14
|
| SMILES | OC12[C@H]3[C@@H]([C@@]4([C@H](CC3)C[C@@H](O[C@H]3O[C@@H]([C@@H](O[C@H]5O[C@@H]([C@@H](OC(=O)C)[C@@H](O)C5)C)[C@@H](O[C@H]5O[C@@H]([C@@H](O)[C@@H](O)C5)C)C3)C)CC4)C)CC[C@@]1([C@H](CC2)C1=CC(=O)OC1)C |
| XLogP | 4.155 |
| PSA | 188.900 |
| H-bond Donor | 4 |
| H-bond Acceptor | 14 |
| No. of Rotatable Bond Count | 9 |
| No. of Rings | 8 |
| No. of N | 0 |
| No. of O | 14 |
| No. of S | 0 |
| Reference(s) | 1) Lu T, Vargas D, Franzblau SG, Fischer NH. Diterpenes from Solidago rugosa.Phytochemistry.1995 Jan;38(2):451-6
|
| Curator | |
| Compound ID | 2836 |
| Compound Structure |  |
| Plant Source | Zingiber officinale Rosc. Common Name:Ginger (English), Fresh Rhizome - Aardraka, Aadrikaa, Shrngibera (Sanskrit) |
| Source Family | Zingiberaceae |
| Origin | India, Malaysia |
| Plant Part Used | Rhizome |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 6 - Gingerol |
| PubChem ID | 3473 |
| Ethnomedicinal Information | Leprosy, expectorant, asthma, bronchitis, cough, phthisis, tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Butenolide, Lactone, Alkene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 294.183 |
| Molecular Formula | C17H26O4 |
| SMILES | OC(CCCCC)CC(=O)CCc1cc(OC)c(O)cc1 |
| XLogP | 2.887 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 10 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) R.D. Hiserodt,S.G. Franzblau and R.T. Rosen.Isolation of 6-, 8-, and 10-Gingerol from Ginger Rhizome by HPLC and Preliminary Evaluation of Inhibition of Mycobacterium avium and Mycobacterium tuberculosis.J. Agric. Food Chem., 1998, 46 (7), pp 2504–2508
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
3) Jain, S.K., Tarafder, C.R., 1970. Medicinal plant lore of the Santals. A revival of P.O. Boddings, work. Economic Botany 24, 241–278.
|
| Curator | |
| Compound ID | 3057 |
| Compound Structure |  |
| Plant Source | Ajuga remota Benth. Common Name:NR |
| Source Family | Lamiaceae |
| Origin | NR |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ajugarin - I |
| PubChem ID | 173866 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10630115 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Diterpene, Acetyl, Lactone, Epoxide |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 434.230 |
| Molecular Formula | C24H34O7
|
| SMILES | O1[C@]2([C@]3([C@@H]([C@]([C@@H](C[C@@H]3OC(=O)C)C)(CCC3=CC(=O)OC3)C)CCC2)COC(=O)C)C1 |
| XLogP | 3.862 |
| PSA | 91.430 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Rajab MS, Franzblau SG, Fronczek FR, Fischer NH.Antimycobacterial ergosterol-5,8-endoperoxide from Ajuga remota.Planta Med. 1999 Dec;65(8):732-4
|
| Curator | |
| Compound ID | 3058 |
| Compound Structure |  |
| Plant Source | Ajuga remota Benth. Common Name:NR |
| Source Family | Lamiaceae |
| Origin | NR |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ajugarin - II |
| PubChem ID | 3085250 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10630115 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Diterpene, O-Acetyl, Lactone, Epoxy, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 392.220 |
| Molecular Formula | C22H32O6
|
| SMILES | O1[C@]2([C@]3([C@@H]([C@]([C@@H](C[C@@H]3O)C)(CCC3=CC(=O)OC3)C)CCC2)COC(=O)C)C1 |
| XLogP | 3.122 |
| PSA | 85.360 |
| H-bond Donor | 1 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Rajab MS, Franzblau SG, Fronczek FR, Fischer NH.Antimycobacterial ergosterol-5,8-endoperoxide from Ajuga remota.Planta Med. 1999 Dec;65(8):732-4
|
| Curator | |
| Compound ID | 3061 |
| Compound Structure |  |
| Plant Source | Costus Common Name:NR |
| Source Family | Costaceae |
| Origin | NR |
| Plant Part Used | Root |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Radiorespirometric Bioassay |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Dehydrocostus lactone |
| PubChem ID | 73174 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 9784148 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Alicyclic, Tricyclic, Terpene, Sesquiterpene, Lactone |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 230.131 |
| Molecular Formula | C15H18O2 |
| SMILES | O1[C@@H]2[C@@H]3[C@@H](CCC3=C)C(=C)CC[C@H]2C(=C)C1=O |
| XLogP | 2.451 |
| PSA | 26.300 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Nuñez IS, Castañeda-Acosta J, Foroozesh M, Fronczek FR, Fischer NH, Franzblau SG.Antimycobacterial activities of dehydrocostus lactone and its oxidation products.J Nat Prod. 1998 Oct;61(10):1181-6
|
| Curator | Farzana-shamsudeen, gppreetha |