| Compound ID | 2383 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sesamin |
| PubChem ID | 72307 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polycyclic, Lignan, Furanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 354.110 |
| Molecular Formula | C20H18O6 |
| SMILES | O1[C@@H]([C@@H]2[C@@H]([C@H](OC2)c2cc3OCOc3cc2)C1)c1cc2OCOc2cc1 |
| XLogP | 2.576 |
| PSA | 55.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 3726 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Thailand |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Horsfieldin |
| PubChem ID | NR |
| Ethnomedicinal Information | Antimycobacterial and antiplasmodial activity, antifungal |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Pentacyclic, Lignan, Furanoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 356.126 |
| Molecular Formula | C20H20O6 |
| SMILES | O1CC2C(C1c1cc(c(cc1)OC)O)CO[C@H]2c1ccc2OCOc2c1 |
| XLogP | 2.130 |
| PSA | 66.380 |
| H-bond Donor | 1 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | KeyaMukherjee, rachanake |
| Compound ID | 4065 |
| Compound Structure |  |
| Plant Source | Beilschmiedia tsangii Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis 90-221387 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 30 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Epoxybeilschmin A |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Lignan, Furanoid, Epoxy, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 430.163 |
| Molecular Formula | C23H26O8 |
| SMILES | C[C@H]1[C@@]2(C)[C@](c3cc(OC)c4OCOc4c3)(O2)O[C@@H]1c1cc(OC)c(OC)c(OC)c1 |
| XLogP | 2.537 |
| PSA | 77.140 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4066 |
| Compound Structure |  |
| Plant Source | Beilschmiedia tsangii Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis 90-221388 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 40 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Epoxybeilschmin B |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Lignan, Furanoid, Epoxy, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 446.194 |
| Molecular Formula | C24H30O8 |
| SMILES | C[C@H]1[C@@]2(C)[C@](c3cc(OC)c(OC)c(OC)c3)(O2)O[C@@H]1c1cc(OC)c(OC)c(OC)c1 |
| XLogP | 2.610 |
| PSA | 77.140 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4067 |
| Compound Structure |  |
| Plant Source | Beilschmiedia tsangii Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis 90-221389 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Beilschmin D |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Lignan, Furanoid, Epoxy, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 414.131 |
| Molecular Formula | C22H22O8 |
| SMILES | C[C@H]1[C@@]2(C)[C@](c3cc(OC)c4OCOc4c3)(O2)O[C@@H]1c1cc2OCOc2c(OC)c1 |
| XLogP | 2.464 |
| PSA | 77.140 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4068 |
| Compound Structure |  |
| Plant Source | Beilschmiedia tsangii Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis 90-221390 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Beilschmin A |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Lignan, Furanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 416.184 |
| Molecular Formula | C23H28O7 |
| SMILES | C[C@H]1[C@H](C)[C@H](c2cc(OC)c3OCOc3c2)O[C@@H]1c1cc(OC)c(OC)c(OC)c1 |
| XLogP | 3.007 |
| PSA | 64.610 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4069 |
| Compound Structure |  |
| Plant Source | Beilschmiedia tsangii Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis 90-221391 |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 7.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Beilschmin B |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Lignan, Furanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 432.215 |
| Molecular Formula | C24H32O7 |
| SMILES | C[C@H]1[C@H](C)[C@H](c2cc(OC)c(OC)c(OC)c2)O[C@@H]1c1cc(OC)c(OC)c(OC)c1 |
| XLogP | 3.080 |
| PSA | 64.610 |
| H-bond Donor | 0 |
| H-bond Acceptor | 7 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4070 |
| Compound Structure |  |
| Plant Source | Litsea hypophaea Common Name: |
| Source Family | Lauraceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (6.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.6 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Feruloyltyramine |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Lignan, Amide, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 343.142 |
| Molecular Formula | C19H21NO5 |
| SMILES | Oc1c(OC)cc(/C=C/C(=O)NCCc2ccc(O)c(OC)c2)cc1 |
| XLogP | 2.247 |
| PSA | 88.020 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |