| Compound ID | 2033 |
| Compound Structure |  |
| Plant Source | Leucas volkensii Gurke Common Name: |
| Source Family | Labiatae |
| Origin | Kenya |
| Plant Part Used | Aerial |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Geraniol |
| PubChem ID | 637566 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 9491760 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 154.136 |
| Molecular Formula | C10H18O
|
| SMILES | OC/C=C(/CCC=C(C)C)C |
| XLogP | 2.524 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Rajab MS, Cantrell CL, Franzblau SG, Fischer NH.Antimycobacterial activity of (E)-phytol and derivatives: a preliminary structure-activity study.Planta Med. 1998 Feb;64(1):2-4
|
| Curator | |
| Compound ID | 2048 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (2.5 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Geranial |
| PubChem ID | 638011 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Monoterpene, Aldehyde |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 152.120 |
| Molecular Formula | C10H16O
|
| SMILES | O=C/C=C(/CCC=C(C)C)C |
| XLogP | 2.701 |
| PSA | 17.070 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2050 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (2.5 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 - 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Geraniol |
| PubChem ID | 637566 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 154.136 |
| Molecular Formula | C10H18O
|
| SMILES | OC/C=C(/CCC=C(C)C)C |
| XLogP | 2.524 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2053 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (2.5 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 ± 72 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Limonene (30.2 %) |
| PubChem ID | 22311 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(CCC(=CC1)C)C(=C)C |
| XLogP | 3.729 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2055 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (1.6 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cis - Verbenol (1.9 %) |
| PubChem ID | 87839 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 152.120 |
| Molecular Formula | C10H16O
|
| SMILES | O[C@@H]1[C@@H]2C([C@@H](C2)C(=C1)C)(C)C |
| XLogP | 2.147 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2056 |
| Compound Structure |  |
| Plant Source | Lippia alba (Miller) N. E.Brown Common Name: |
| Source Family | Verbenaceae |
| Origin | Colombia, Puerto Rico, India |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (1.6 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Trans - Verbenol (1.5 %) |
| PubChem ID | 89664 |
| Ethnomedicinal Information | Digestive troubles in general, nausea, bronchitis, sore throat, flu, cough, cold, hypertension, skin diseases, wounds, stomach ache, nervous complaints, folklore medicine of Puerto Rico |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 152.120 |
| Molecular Formula | C10H16O
|
| SMILES | O[C@@H]1[C@H]2C([C@H](C2)C(=C1)C)(C)C |
| XLogP | 2.147 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
2) Thierry Hennebelle, Sevser Sahpaz, Henry Joseph, François Bailleul.Ethnopharmacology of Lippia alba.Journal of Ethnopharmacology, Volume 116, Issue 2, 5 March 2008, Pages 211-222
|
| Curator | |
| Compound ID | 2353 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Terpinolene |
| PubChem ID | 11463 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1C(=C(C)C)CC=C(C1)C |
| XLogP | 3.326 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2354 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | γ - Terpinene |
| PubChem ID | 7461 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C(C1=CCC(=CC1)C)(C)C |
| XLogP | 3.852 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2363 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Phellandrene |
| PubChem ID | 7460 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(C(C)C)CC=C(C=C1)C |
| XLogP | 4.427 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2364 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Pinene (8.7 %) |
| PubChem ID | 6654 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(C2CC1C(=CC2)C)(C)C |
| XLogP | 4.177 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2365 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Limonene (5.3 %) |
| PubChem ID | 22311 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(CCC(=CC1)C)C(=C)C |
| XLogP | 3.729 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2366 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Linalool (4.7 %) |
| PubChem ID | 6549 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aliphatic, Alkene, Terpene, Monoterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 154.136 |
| Molecular Formula | C10H18O
|
| SMILES | OC(CCC=C(C)C)(C)C=C |
| XLogP | 2.468 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2368 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | β - Phellandrene |
| PubChem ID | 11142 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(C(C)C)CCC(=C)C=C1 |
| XLogP | 4.472 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 3959 |
| Compound Structure |  |
| Plant Source | Swinglea glutinosa Common Name:Tabog, Glutinous Swinglea |
| Source Family | Rutaceae |
| Origin | Colombia |
| Plant Part Used | Fruit peel |
| Extract | Essential oil (0.7 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 ± 36 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Terpineol |
| PubChem ID | 17100 |
| Ethnomedicinal Information | Skin affliction, tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 154.136 |
| Molecular Formula | C10H18O |
| SMILES | OC(C1CCC(=CC1)C)(C)C |
| XLogP | 2.369 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2658 |
| Compound Structure |  |
| Plant Source | Swinglea glutinosa Common Name: |
| Source Family | Rutaceae |
| Origin | Colombia |
| Plant Part Used | Fruit peel |
| Extract | Essential oil (0.7 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 ± 36 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | β - Pinene |
| PubChem ID | 14896 |
| Ethnomedicinal Information | Skin affliction, tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(C2CC1C(=C)CC2)(C)C |
| XLogP | 4.222 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2659 |
| Compound Structure |  |
| Plant Source | Swinglea glutinosa Common Name: |
| Source Family | Rutaceae |
| Origin | Colombia |
| Plant Part Used | Fruit peel |
| Extract | Essential oil (0.7 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 ± 36 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Pinene (12 %) |
| PubChem ID | 6654 |
| Ethnomedicinal Information | Skin affliction, tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(C2CC1C(=CC2)C)(C)C |
| XLogP | 4.177 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2660 |
| Compound Structure |  |
| Plant Source | Swinglea glutinosa Common Name: |
| Source Family | Rutaceae |
| Origin | Colombia |
| Plant Part Used | Fruit peel |
| Extract | Essential oil (0.7 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 ± 36 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sabinene |
| PubChem ID | 18818 |
| Ethnomedicinal Information | Skin affliction, tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C12(C(C1)C(=C)CC2)C(C)C |
| XLogP | 4.222 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2662 |
| Compound Structure |  |
| Plant Source | Swinglea glutinosa Common Name: |
| Source Family | Rutaceae |
| Origin | Colombia |
| Plant Part Used | Fruit peel |
| Extract | Essential oil (0.7 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 ± 36 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Limonene (4.4 %) |
| PubChem ID | 22311 |
| Ethnomedicinal Information | Skin affliction, tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C1(CCC(=CC1)C)C(=C)C |
| XLogP | 3.729 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2663 |
| Compound Structure |  |
| Plant Source | Swinglea glutinosa Common Name: |
| Source Family | Rutaceae |
| Origin | Colombia |
| Plant Part Used | Fruit peel |
| Extract | Essential oil (0.7 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 ± 36 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 8 - Cineol |
| PubChem ID | 2758 |
| Ethnomedicinal Information | Skin affliction, tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 154.136 |
| Molecular Formula | C10H18O
|
| SMILES | O1C2(CCC(C1(C)C)CC2)C |
| XLogP | 2.595 |
| PSA | 9.230 |
| H-bond Donor | 0 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2075 |
| Compound Structure |  |
| Plant Source | Lippia origanoides Common Name:Wild Marjoram |
| Source Family | Verbenaceae |
| Origin | USA |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (4.4 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 160 ± 72 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Thujene |
| PubChem ID | 12444322 |
| Ethnomedicinal Information | Treatment of influenza, colds and pulmonary infections |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16
|
| SMILES | C12([C@@H](C1)C(=CC2)C)C(C)C |
| XLogP | 4.177 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sáhez JG, MartÃz-Morales JR, Stashenko EE, Ribó. Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia. Biomedica. 2009 Mar;29(1):51-60
2) Santos, Francisco J B dos, Lopes, J Arimatia D, Cito, A M Graas L, de Oliveira, Evaldo H, Et al Composition and Biological Activity of Essential oils from Lippia origanoides H.B.K. Journal of Essential oil Research: JEOR, Sep/Oct 2004
|
| Curator | |
| Compound ID | 3849 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (bovine isolate [NCTC 8578]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 72.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Carvacrol |
| PubChem ID | 10364 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Terpene, Monoterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 150.104 |
| Molecular Formula | C10H14O |
| SMILES | Oc1cc(C(C)C)ccc1C |
| XLogP | 3.556 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3850 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (human isolate [ATCC 43015]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 72.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Carvacrol |
| PubChem ID | 10364 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Terpene, Monoterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 150.104 |
| Molecular Formula | C10H14O |
| SMILES | Oc1cc(C(C)C)ccc1C |
| XLogP | 3.556 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3851 |
| Compound Structure |  |
| Plant Source | Apple, Tea, Cinnamon, Cassia and other plants (not reported specifically) Common Name:NR |
| Source Family | NR |
| Origin | NR |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium subsp. paratuberculosis (raw - milk isolate [806R]) |
| Assay / Test Done | Macro - broth susceptibility testing using Bactec 460 system |
| Positive Control Used (conc.) | Rifampin (< 0.6 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 72.2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Carvacrol |
| PubChem ID | 10364 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 18676709 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Terpene, Monoterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 150.104 |
| Molecular Formula | C10H14O |
| SMILES | Oc1cc(C(C)C)ccc1C |
| XLogP | 3.556 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Wong SY, Grant IR, Friedman M, Elliott CT, Situ C.Antibacterial activities of naturally occurring compounds against Mycobacterium avium subsp. paratuberculosis.Appl Environ Microbiol. 2008 Oct;74(19):5986-90. Epub 2008 Aug 1
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3862 |
| Compound Structure |  |
| Plant Source | Achyrocline alata Common Name:NR |
| Source Family | Asteraceae (Compositae) |
| Origin | Colombia |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (0.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 62.5 ± 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Thymol (24.0 %) |
| PubChem ID | 6989 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Aromatic, Terpene, Monoterpene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 150.104 |
| Molecular Formula | C10H14O |
| SMILES | Oc1c(C(C)C)ccc(c1)C |
| XLogP | 3.556 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |
| Compound ID | 3865 |
| Compound Structure |  |
| Plant Source | Achyrocline alata Common Name:NR |
| Source Family | Asteraceae (Compositae) |
| Origin | Colombia |
| Plant Part Used | Leaf, stem |
| Extract | Essential oil (0.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Isoniazid (0.19 ± 0.07 µg/ml), Rifampin (0.3 ± 0.21 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 62.5 ± 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | α - Pinene (2.6%) |
| PubChem ID | 6654 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | The essential oils were extracted from a 300 g sample of plant leaves and stems by microwave - assisted hydrodistillation (30 min, 250 ml water), using a Clevenger - type distillation apparatus and a Dean - Stark distillation trap in a domestic microwave oven. Sodium sulfate was added as a drying agent to the decanted essential oil |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Monoterpene |
| Media / Broth Used [Antimicrobial Assay/Test] | Lowestein - Jensenn medium, Middlebrook 7H9 medium [The later was supplemented with 10 % OADC (Oleic Acid - Albumin - Dextrose - Catalase) and 0.001 % Tween 80] |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 136.125 |
| Molecular Formula | C10H16 |
| SMILES | C1(C2CC1C(=CC2)C)(C)C |
| XLogP | 4.177 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | KeyaMukherjee, Farzana Shamsudeen |