| Compound ID | 1218 |
| Compound Structure |  |
| Plant Source | Artocarpus lakoocha Roxb.Artocarpus lacucha Buch.-Ham Common Name:Monkey Jack (English), Lakuch, Kshudra Panas, Granthiphala, Pitanaasha (Sanskrit) |
| Source Family | Moraceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml) and Kanamycin sulphate (2 – 5 µg/ml)) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Lakoochin A |
| PubChem ID | 3012524 |
| Ethnomedicinal Information | Leprosy, used as folkmedicine for other diseases |
| PubMed ID [Source Literature] | 15043440 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Stilbene, Furanoid, Phenol, Prenylated, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 406.214 |
| Molecular Formula | C26H30O4 |
| SMILES | O1c(c2c(CC=C(C)C)c(OC)cc(OC)c2CC=C(C)C)cc2c1cc(O)cc2 |
| XLogP | 5.873 |
| PSA | 51.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Puntumchai A, Kittakoop P, Rajviroongit S, Vimuttipong S, Likhitwitayawuid K, Thebtaranonth Y.Lakoochins A and B, new antimycobacterial stilbene derivatives from Artocarpus lakoocha.J Nat Prod. 2004 Mar;67(3):485-6
2) Pushpangadan P, Atal CK.Ethno-medico-botanical investigations in Kerala I. Some primitive tribals of western ghats and their herbal medicine.J Ethnopharmacol. 1984 Jun;11(1):59-77
|
| Curator | |
| Compound ID | 1219 |
| Compound Structure |  |
| Plant Source | Artocarpus lakoocha Roxb.Artocarpus lacucha Buch.-Ham Common Name:Monkey Jack (English), Lakuch, Kshudra Panas, Granthiphala, Pitanaasha (Sanskrit) |
| Source Family | Moraceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml) and Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Lakoochin B |
| PubChem ID | 6479925 |
| Ethnomedicinal Information | Leprosy, used as folkmedicine for other diseases |
| PubMed ID [Source Literature] | 15043440 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Stilbene, Furanoid, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 446.246 |
| Molecular Formula | C29H34O4 |
| SMILES | O1c(c2c(C/C=C(/CCC=C(C)C)C)c(O)cc(O)c2CC=C(C)C)cc2c1cc(O)cc2 |
| XLogP | 6.657 |
| PSA | 73.830 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Puntumchai A, Kittakoop P, Rajviroongit S, Vimuttipong S, Likhitwitayawuid K, Thebtaranonth Y.Lakoochins A and B, new antimycobacterial stilbene derivatives from Artocarpus lakoocha.J Nat Prod. 2004 Mar;67(3):485-6
2) Pushpangadan P, Atal CK.Ethno-medico-botanical investigations in Kerala I. Some primitive tribals of western ghats and their herbal medicine.J Ethnopharmacol. 1984 Jun;11(1):59-77
|
| Curator | |
| Compound ID | 1243 |
| Compound Structure |  |
| Plant Source | Bauhinia saccocalyx Common Name: |
| Source Family | Fabaceae |
| Origin | Thailand |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 6.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bauhinoxepins A |
| PubChem ID | 11723631 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Oxapin, Benzopyran, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero, human epidermoid carcinoma in the mouth (KB) and human breast cancer cells (BC) |
| Molecular Weight | 322.121 |
| Molecular Formula | C20H18O4
|
| SMILES | O1C(C=Cc2c1c(c(O)c1Oc3c(C=Cc21)c(O)ccc3)C)(C)C |
| XLogP | 3.407 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Prasat Kittakoop, Sombat Nopichai, Nuntawan Thongon, Panarat Charoenchai, Yodhathai Thebtaranonth.Bauhinoxepins A and B: New Antimycobacterial Dibenzo[b,f]oxepins from Bauhinia saccocalyx.Helvetica Chimica Acta, Volume 87, Issue 1, pages 175–179, January 2004
|
| Curator | |
| Compound ID | 1244 |
| Compound Structure |  |
| Plant Source | Bauhinia saccocalyx Common Name: |
| Source Family | Fabaceae |
| Origin | Thailand |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bauhinoxepins B |
| PubChem ID | 3009552 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Oxapin, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero, human epidermoid carcinoma in the mouth (KB) and human breast cancer cells (BC) |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4
|
| SMILES | O1c2c(c(O)c(CC=C(C)C)cc2)C=Cc2c1c(OC)c(c(O)c2)C |
| XLogP | 3.996 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Prasat Kittakoop, Sombat Nopichai, Nuntawan Thongon, Panarat Charoenchai, Yodhathai Thebtaranonth.Bauhinoxepins A and B: New Antimycobacterial Dibenzo[b,f]oxepins from Bauhinia saccocalyx.Helvetica Chimica Acta, Volume 87, Issue 1, pages 175–179, January 2004
|
| Curator | |
| Compound ID | 1354 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mangiferin |
| PubChem ID | 5281647 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 422.085 |
| Molecular Formula | C19H18O11 |
| SMILES | O1[C@H]([C@H](O)[C@@H](O)[C@H](O)[C@H]1CO)c1c(O)c2c(oc3c(c2=O)cc(O)c(O)c3)cc1O |
| XLogP | -2.646 |
| PSA | 188.140 |
| H-bond Donor | 8 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 11 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1355 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1,3,5-Trihydroxyxanthone |
| PubChem ID | 25200626 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 243.029 |
| Molecular Formula | C13H7O5 |
| SMILES | O1c2c(c(=O)c3c1c([O-])ccc3)c(O)cc(O)c2 |
| XLogP | 0.296 |
| PSA | 80.590 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1356 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3 - Dihydroxy - 5 - Methoxy - 9H - Xanthen - 9 - One |
| PubChem ID | 12026489 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 258.053 |
| Molecular Formula | C14H10O5 |
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)cccc2OC |
| XLogP | 0.815 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1357 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1 - Hydroxy - 3, 5 - Dimethoxyxanthen - 9 - One |
| PubChem ID | 5479773 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 272.068 |
| Molecular Formula | C15H12O5 |
| SMILES | O1c2c(c(=O)c3c1c(OC)ccc3)c(O)cc(OC)c2 |
| XLogP | 1.334 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2.
|
| Curator | |
| Compound ID | 1358 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 5, 6 - Tetrahydroxyxanthen - 9 - One |
| PubChem ID | 5479774 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 260.032 |
| Molecular Formula | C13H8O6
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)ccc(O)c2O |
| XLogP | -0.238 |
| PSA | 97.990 |
| H-bond Donor | 4 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1359 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 6 - Trihydroxy - 5 - Methoxyxanthen - 9 - One |
| PubChem ID | 5493675 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 274.048 |
| Molecular Formula | C14H10O6
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)ccc(O)c2OC |
| XLogP | -0.148 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1360 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 5 - Trihydroxy - 6 - Methoxyxanthen - 9 - One |
| PubChem ID | 5479775 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 274.048 |
| Molecular Formula | C14H10O6
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)ccc(OC)c2O |
| XLogP | -0.148 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1361 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 3, 5 - Dimethoxy - 1, 6 - Dihydroxyxanthone |
| PubChem ID | 5281630 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 288.063 |
| Molecular Formula | C15H12O6
|
| SMILES | O1c2c(c(=O)c3c1cc(OC)cc3O)ccc(O)c2OC |
| XLogP | 0.371 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1362 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 3, 5, 6, 7 - Pentahydroxyxanthen - 9 - One |
| PubChem ID | 10333643 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 276.027 |
| Molecular Formula | C13H8O7
|
| SMILES | O1c2c(c(=O)c3c1cc(O)cc3O)cc(O)c(O)c2O |
| XLogP | -0.772 |
| PSA | 118.220 |
| H-bond Donor | 5 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1363 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 6, 7 - Trihydroxy - 3, 5 - Dimethoxyxanthen - 9 - One |
| PubChem ID | 5479777 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 304.058 |
| Molecular Formula | C15H12O7
|
| SMILES | O1c2c(c(=O)c3c1cc(OC)cc3O)cc(O)c(O)c2OC |
| XLogP | -0.163 |
| PSA | 96.220 |
| H-bond Donor | 3 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1364 |
| Compound Structure |  |
| Plant Source | Canscora decussata Schult. Common Name:Daakuni, Sankhaapushpi, Dandotpala (Sanskrit) |
| Source Family | Gentaniaceae |
| Origin | India |
| Plant Part Used | Mother tinture |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Tube Dilution Test |
| Positive Control Used (conc.) | Streptomycin sulphate (0.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 1, 7 - Dihydroxy - 3, 5, 6 - Trimethoxyxanthen - 9 - One |
| PubChem ID | 5491588 |
| Ethnomedicinal Information | Tuberculosis, leprosy |
| PubMed ID [Source Literature] | 807707, 565403 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Xanthonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 318.074 |
| Molecular Formula | C16H14O7
|
| SMILES | O1c2c(c(=O)c3c1cc(OC)cc3O)cc(O)c(OC)c2OC |
| XLogP | -0.073 |
| PSA | 85.220 |
| H-bond Donor | 2 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 7 |
| No. of S | 0 |
| Reference(s) | 1) Ghosal S, Chaudhuri RK.Chemical constituents of Gentianaceae XVI: antitubercular activity of xanthones of Canscora decussata Schult.J Pharm Sci. 1975 May;64(5):888-9
2) Ghosal S, Biswas K, Chaudhuri RK.Chemical constituents of Gentianaceae XXIV: Anti-Mycobacterium tuberculosis activity of naturally occurring xanthones and synthetic analogs.J Pharm Sci. 1978 May;67(5):721-2
|
| Curator | |
| Compound ID | 1440 |
| Compound Structure |  |
| Plant Source | Chromolaena odorata Common Name:Siam Weed, Christmas Bush, Common Floss Flower |
| Source Family | Asteraceae (Compositae) |
| Origin | Neotropics, Worldwide |
| Plant Part Used | Flower |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin sulphate (2.50 µg/ml), Isoniazid (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Isosakuranetin |
| PubChem ID | 160481 |
| Ethnomedicinal Information | Treat skin wounds |
| PubMed ID [Source Literature] | 15202555, 10811796 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.084 |
| Molecular Formula | C16H14O5 |
| SMILES | O1[C@@H](CC(=O)c2c1cc(O)cc2O)c1ccc(OC)cc1 |
| XLogP | 1.416 |
| PSA | 75.990 |
| H-bond Donor | 2 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn, A., Chotipong, A., Suavansri, T., Boongird, S., Timsuksai, P., Vimuttipong, S., et al. (2004). Antimycobacterial activity and cytotoxicity of flavonoids from the flowers of Chromolaena odorata. Arch Pharm Res 27, 507u511
2) Schmidt GJ, Schilling EE.Phylogeny and biogeography of Eupatorium (Asteraceae: Eupatorieae) based on nuclear ITS sequence data.Am J Bot. 2000 May;87(5):716-26
|
| Curator | |
| Compound ID | 1441 |
| Compound Structure |  |
| Plant Source | Chromolaena odorata Common Name:Siam Weed, Christmas Bush, Common Floss Flower |
| Source Family | Asteraceae (Compositae) |
| Origin | Neotropics, Worldwide |
| Plant Part Used | Flower |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin sulphate (2.50 µg/ml), Isoniazid (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 4` - Hydroxy - 5, 6, 7 - Trimethoxyflavanone |
| PubChem ID | 244387 |
| Ethnomedicinal Information | Treats skin wounds |
| PubMed ID [Source Literature] | 15202555, 10811796 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 330.110 |
| Molecular Formula | C18H18O6 |
| SMILES | O1C(CC(=O)c2c1cc(OC)c(OC)c2OC)c1ccc(O)cc1 |
| XLogP | 1.491 |
| PSA | 74.220 |
| H-bond Donor | 1 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn, A., Chotipong, A., Suavansri, T., Boongird, S., Timsuksai, P., Vimuttipong, S., et al. (2004). Antimycobacterial activity and cytotoxicity of flavonoids from the flowers of Chromolaena odorata. Arch Pharm Res 27, 507u511
2) Schmidt GJ, Schilling EE.Phylogeny and biogeography of Eupatorium (Asteraceae: Eupatorieae) based on nuclear ITS sequence data.Am J Bot. 2000 May;87(5):716-26
|
| Curator | |
| Compound ID | 1442 |
| Compound Structure |  |
| Plant Source | Chromolaena odorata Common Name:Siam Weed, Christmas Bush, Common Floss Flower |
| Source Family | Asteraceae (Compositae) |
| Origin | Neotropics, Worldwide |
| Plant Part Used | Flower |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin sulphate (2.50 µg/ml), Isoniazid (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Acacetin |
| PubChem ID | 5280442 |
| Ethnomedicinal Information | Treats skin wounds |
| PubMed ID [Source Literature] | 15202555, 10811796 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 284.068 |
| Molecular Formula | C16H12O5 |
| SMILES | O1c2c(c(=O)cc1c1ccc(OC)cc1)c(O)cc(O)c2 |
| XLogP | 1.645 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn, A., Chotipong, A., Suavansri, T., Boongird, S., Timsuksai, P., Vimuttipong, S., et al. (2004). Antimycobacterial activity and cytotoxicity of flavonoids from the flowers of Chromolaena odorata. Arch Pharm Res 27, 507u511
2) Schmidt GJ, Schilling EE.Phylogeny and biogeography of Eupatorium (Asteraceae: Eupatorieae) based on nuclear ITS sequence data.Am J Bot. 2000 May;87(5):716-26
|
| Curator | |
| Compound ID | 1443 |
| Compound Structure |  |
| Plant Source | Chromolaena odorata Common Name:Siam Weed, Christmas Bush, Common Floss Flower |
| Source Family | Asteraceae (Compositae) |
| Origin | Neotropics, Worldwide |
| Plant Part Used | Flower |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Kanamycin sulphate (2.50 µg/ml), Isoniazid (0.06 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Luteolin |
| PubChem ID | 5280445 |
| Ethnomedicinal Information | Treats skin wounds |
| PubMed ID [Source Literature] | 15202555, 10811796 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 286.048 |
| Molecular Formula | C15H10O6 |
| SMILES | O1c2c(c(=O)cc1c1cc(O)c(O)cc1)c(O)cc(O)c2 |
| XLogP | 0.592 |
| PSA | 97.990 |
| H-bond Donor | 4 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn, A., Chotipong, A., Suavansri, T., Boongird, S., Timsuksai, P., Vimuttipong, S., et al. (2004). Antimycobacterial activity and cytotoxicity of flavonoids from the flowers of Chromolaena odorata. Arch Pharm Res 27, 507u511
2) Schmidt GJ, Schilling EE.Phylogeny and biogeography of Eupatorium (Asteraceae: Eupatorieae) based on nuclear ITS sequence data.Am J Bot. 2000 May;87(5):716-26
|
| Curator | |
| Compound ID | 1475 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Nor - Dentatin |
| PubChem ID | 5495613 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Benzopyran, Alkene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 312.136 |
| Molecular Formula | C19H20O4
|
| SMILES | O1c2c(C(C)(C)C=C)c3oc(=O)ccc3c(O)c2C=CC1(C)C |
| XLogP | 4.293 |
| PSA | 46.530 |
| H-bond Donor | 1 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1476 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Clausenidin |
| PubChem ID | 5315947 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Coumarin, Chromone, Alkene, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 328.131 |
| Molecular Formula | C19H20O5
|
| SMILES | O1C(CC(=O)c2c1c(C(C)(C)C=C)c1oc(=O)ccc1c2O)(C)C |
| XLogP | 3.411 |
| PSA | 63.600 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 5 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1478 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Mukonal |
| PubChem ID | 504068 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Aldehyde, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 211.063 |
| Molecular Formula | C13H9NO2
|
| SMILES | Oc1cc2[nH]c3c(c2cc1C=O)cccc3 |
| XLogP | 2.984 |
| PSA | 53.090 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 1 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1480 |
| Compound Structure |  |
| Plant Source | Clausena excavata Burm. f. Common Name:Clausena (English) |
| Source Family | Rutaceae |
| Origin | India |
| Plant Part Used | Rhizome |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml), Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 2 - Hydroxy - 3 - Formyl - 7 - Methoxycarbazole |
| PubChem ID | 189687 |
| Ethnomedicinal Information | Fever, indigestion, malaria, colic, muscular pain, diuretic and as tonic; the allied species C. wampi Blanco for bronchitis, in Thai folk medicine for cold |
| PubMed ID [Source Literature] | 12624822 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Alkaloid, Carbazole, Aldehyde, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 241.074 |
| Molecular Formula | C14H11NO3
|
| SMILES | O(c1cc2[nH]c3c(c2cc1)cc(c(O)c3)C=O)C |
| XLogP | 2.329 |
| PSA | 62.320 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Sunthitikawinsakul A, Kongkathip N, Kongkathip B, Phonnakhu S, Daly JW, Spande TF, Nimit Y, Rochanaruangrai S.Coumarins and carbazoles from Clausena excavata exhibited antimycobacterial and antifungal activities.Planta Med. 2003 Feb;69(2):155-7
2) Kirtikar, K.R., Basu, B.D., 1935. Indian Medicinal Plants, vols. 1–4. Lalit Mohan Basu, Allahabad, India
|
| Curator | |
| Compound ID | 1523 |
| Compound Structure |  |
| Plant Source | Combretum molle R. Br. Ex G. Don Common Name:Velvet Leaf Willow, Velvet Leaf Combretum, Velvet Bush Willow |
| Source Family | Combretaceae |
| Origin | Africa |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 0.6 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Punicalagin |
| PubChem ID | 16149716 |
| Ethnomedicinal Information | Cough, tuberculosis, juice drunk to treat chest complaints |
| PubMed ID [Source Literature] | 15110681 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polyphenol, Ellagitannin, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 0.000 |
| Molecular Formula | C48H28O30
|
| SMILES | O1[C@H]2[C@@H](OC(=O)c3c(c4c5c6c7c(c(c8c(C(=O)OC2)cc(O)c(O)c8O)c(O)c(O)c7oc5=O)c(=O)oc6c(O)c4O)c(O)c(O)c(O)c3)[C@@H]2OC(=O)c3c(c4c(C(=O)O[C@H]2[C@H]1O)cc(O)c(O)c4O)c(O)c(O)c(O)c3 |
| XLogP | 0.000 |
| PSA | 0.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 0 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 0 |
| No. of S | 0 |
| Reference(s) | 1) Okunade AL, Elvin-Lewis MP, Lewis WH.Natural antimycobacterial metabolites: current status.Phytochemistry. 2004 Apr;65(8):1017-32
|
| Curator | |
| Compound ID | 1657 |
| Compound Structure |  |
| Plant Source | Erythrina indica Common Name: |
| Source Family | Leguminosae |
| Origin | Ibadan, Nigeria |
| Plant Part Used | Root bark |
| Extract | Phenol |
| Target Bacteria | Mycobacterium smegmatis (ATCC 607) |
| Assay / Test Done | Agar Dilution - Streak Assay |
| Positive Control Used (conc.) | Streptomycin (1.7 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 400 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cajanin |
| PubChem ID | 5281706 |
| Ethnomedicinal Information | Trachoma, Elephantiasis, Microbial infections |
| PubMed ID [Source Literature] | 10820816 |
| Extract Preparation | Dried and ground root bark of Erythrina indica was successively extracted with a mixture of dichloro-methane-MeOH (1:1) and methanol. The dichloro-methane-MeOH (1:1) extract was concentrated to dryness |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 300.063 |
| Molecular Formula | C16H12O6
|
| SMILES | O1c2c(c(=O)c(c3c(O)cc(O)cc3)c1)c(O)cc(OC)c2 |
| XLogP | 0.781 |
| PSA | 86.990 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Waffo AK, Azebaze GA, Nkengfack AE, Fomum ZT, Meyer M, Bodo B, van Heerden FR.Indicanines B and C, two isoflavonoid derivatives from the root bark of Erythrina indica.Phytochemistry. 2000 Apr;53(8):981-5
|
| Curator | |
