| Compound ID | 2352 |
| Compound Structure |  |
| Plant Source | Piper auritum Common Name:Eared Pepper, False Kava (Hawaii), False Kava - Kava, Hierba Santa, Hoja Santa |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (2.3 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 400 ± 220 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Methyl eugenol |
| PubChem ID | 7127 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 178.099 |
| Molecular Formula | C11H14O2
|
| SMILES | O(c1cc(CC=C)ccc1OC)C |
| XLogP | 3.003 |
| PSA | 18.460 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2386 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N - [9 - (3, 4 - Methylenedioxyphenyl) - 2E, 4E, 8E - Nonatrienoyl] Pyrrolidine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Phenylpropanoid, Pyrrolidine, Amide, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 325.168 |
| Molecular Formula | C20H23NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 4.569 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2826 |
| Compound Structure |  |
| Plant Source | Zanthoxylum wutaiense Common Name: |
| Source Family | Rutaceae |
| Origin | China |
| Plant Part Used | Root, wood |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 30 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Wutaiensal |
| PubChem ID | 25015068 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 18564877 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Benzofuranoid, Aldehyde, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 262.121 |
| Molecular Formula | C15H18O4 |
| SMILES | O1[C@H](C(O)(C)C)Cc2c1c(OC)cc(c2)/C=C/C=O |
| XLogP | 1.873 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Huang HY, Ishikawa T, Peng CF, Tsai IL, Chen IS.Constituents of the root wood of Zanthoxylum wutaiense with antitubercular activity.J Nat Prod. 2008 Jul;71(7):1146-51
|
| Curator | |
| Compound ID | 3625 |
| Compound Structure |  |
| Plant Source | Piper sanctum (Miq.) Schl. Common Name: |
| Source Family | Piperaceae |
| Origin | Southcentral region of Mexico |
| Plant Part Used | Leaf |
| Extract | Dichloromethane:Methanol (1:1) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Z - Piperolide |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620234 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 260.105 |
| Molecular Formula | C15H16O4 |
| SMILES | O1/C(=C(/C=C/c2ccccc2)\OC)/C(CC1=O)OC |
| XLogP | 4.339 |
| PSA | 44.760 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mata R, Morales I, Pérez O, Rivero-Cruz I, Acevedo L, Enriquez-Mendoza I, Bye R, Franzblau S, Timmermann B.Antimycobacterial compounds from Piper sanctum.J Nat Prod. 2004 Dec;67(12):1961-8
|
| Curator | Rachana, Keyamukherjee, vikramjitmandal |
| Compound ID | 3629 |
| Compound Structure |  |
| Plant Source | Piper sanctum (Miq.) Schl. Common Name: |
| Source Family | Piperaceae |
| Origin | Southcentral region of Mexico |
| Plant Part Used | Stem |
| Extract | Dichloromethane:Methanol (1:1) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N - Trans - Feruloyltyramine |
| PubChem ID | 5280537 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620234 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Amide, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 313.131 |
| Molecular Formula | C18H19NO4 |
| SMILES | O(c1cc(/C=C/C(=O)NCCc2ccc(O)cc2)ccc1O)C |
| XLogP | 2.691 |
| PSA | 78.790 |
| H-bond Donor | 3 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mata R, Morales I, Pérez O, Rivero-Cruz I, Acevedo L, Enriquez-Mendoza I, Bye R, Franzblau S, Timmermann B.Antimycobacterial compounds from Piper sanctum.J Nat Prod. 2004 Dec;67(12):1961-8
|
| Curator | Rachana, Keyamukherjee, vikramjitmandal |
| Compound ID | 3630 |
| Compound Structure |  |
| Plant Source | Piper sanctum (Miq.) Schl. Common Name: |
| Source Family | Piperaceae |
| Origin | Southcentral region of Mexico |
| Plant Part Used | Stem |
| Extract | Dichloromethane:Methanol (1:1) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.25 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N-trans-(p-coumaroyl)tyramine |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620234 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Amide, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | Against Vero cells (ATCCCCL-
81) in the CellTiter 96 aqueous nonradioactive cell
proliferation assay |
| Molecular Weight | 283.121 |
| Molecular Formula | C17H17NO3 |
| SMILES | C1c(ccc(c1)/C=C/C(=O)NCCc1ccc(cc1)O)O |
| XLogP | 3.346 |
| PSA | 69.560 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Mata R, Morales I, Pérez O, Rivero-Cruz I, Acevedo L, Enriquez-Mendoza I, Bye R, Franzblau S, Timmermann B.Antimycobacterial compounds from Piper sanctum.J Nat Prod. 2004 Dec;67(12):1961-8
|
| Curator | Rachana, Keyamukherjee, vikramjitmandal |
| Compound ID | 3729 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Thailand |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | N - (3 - Phenylpropanoyl) Pyrrole |
| PubChem ID | 11074385 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Pyrrol, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 199.100 |
| Molecular Formula | C13H13NO |
| SMILES | O=C(n1cccc1)CCc1ccccc1 |
| XLogP | 4.579 |
| PSA | 22.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | KeyaMukherjee, gppreetha |
| Compound ID | 3738 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Thailand |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sarmentamide A |
| PubChem ID | 11528614 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Pyrrolidone, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 215.095 |
| Molecular Formula | C13H13NO2
|
| SMILES | O=C(N1CC=CC1=O)CCc1ccccc1 |
| XLogP | 3.518 |
| PSA | 37.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | Gppreetha |
| Compound ID | 3739 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Thailand |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sarmentamide B |
| PubChem ID | NR |
| Ethnomedicinal Information | Antimycobacterial and antiplasmodial activity, antifungal |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Pyrrolidine, Amide, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 285.136 |
| Molecular Formula | C17H19NO3 |
| SMILES | O=C(/C=C/c1ccccc1)N1C[C@@H]([C@H](C1)C(=O)C)C(=O)C |
| XLogP | 2.976 |
| PSA | 54.450 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | KeyaMukherjee, rachanake |
| Compound ID | 3740 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Thailand |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sarmentamide C |
| PubChem ID | 11514809 |
| Ethnomedicinal Information | Antimycobacterial and antiplasmodial activity, antifungal |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Phenylpropanoid, Pyrrolidine, Amide, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 291.147 |
| Molecular Formula | C16H21NO4 |
| SMILES | O=C(N1CCCC1)/C=C/c1c(OC)cc(OC)c(OC)c1 |
| XLogP | 1.744 |
| PSA | 48.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | KeyaMukherjee, rachanake |
| Compound ID | 4072 |
| Compound Structure |  |
| Plant Source | Camchaya calcarea Common Name: |
| Source Family | Asteraceae (Compositae) |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC168 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Phenylpropanoid, Ester, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 194.058 |
| Molecular Formula | C10H10O4
|
| SMILES | O=C(OC)/C=C/c1cc(O)c(O)cc1 |
| XLogP | 1.462 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |
| Compound ID | 4149 |
| Compound Structure |  |
| Plant Source | Pimpinella sp. Common Name: |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare, Mycobacterium smegmatis, Mycobacterium aurum, Mycobacterium phlei |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25-10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | NPMC10 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 248.141 |
| Molecular Formula | C15H20O3 |
| SMILES | C[C@@H](CC)C(=O)Oc1ccc([C@@]2(C)O[C@@H]2C)cc1 |
| XLogP | 3.891 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |
| Compound ID | 4150 |
| Compound Structure |  |
| Plant Source | Pimpinella sp. Common Name: |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare, Mycobacterium smegmatis, Mycobacterium aurum, Mycobacterium phlei |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25-10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | NPMC11 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Epoxy |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 246.126 |
| Molecular Formula | C15H18O3 |
| SMILES | C/C(=CC)/C(=O)Oc1ccc([C@@]2(C)O[C@@H]2C)cc1 |
| XLogP | 3.773 |
| PSA | 38.830 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |