| Compound ID | 2383 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sesamin |
| PubChem ID | 72307 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polycyclic, Lignan, Furanoid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 354.110 |
| Molecular Formula | C20H18O6 |
| SMILES | O1[C@@H]([C@@H]2[C@@H]([C@H](OC2)c2cc3OCOc3cc2)C1)c1cc2OCOc2cc1 |
| XLogP | 2.576 |
| PSA | 55.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 6 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2747 |
| Compound Structure |  |
| Plant Source | Triclisia patens Common Name: |
| Source Family | Menispermaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Phaeanthine |
| PubChem ID | 73664 |
| Ethnomedicinal Information | Dropsy, swellings, oedema, gout, leprosy, malnutrition, debility, pain - killers, paralysis, epilepsy, convulsions, spasm, pulmonary troubles, sedatives |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polycyclic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 622.304 |
| Molecular Formula | C38H42N2O6
|
| SMILES | O1c2c3[C@H](N(CCc3cc(OC)c2OC)C)Cc2cc(Oc3ccc(C[C@H]4N(CCc5c4cc1c(OC)c5)C)cc3)c(OC)cc2 |
| XLogP | 6.098 |
| PSA | 61.860 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://plants.jstor.org/upwta/4_253
|
| Curator | |
| Compound ID | 2748 |
| Compound Structure |  |
| Plant Source | Triclisia patens Common Name: |
| Source Family | Menispermaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Phaeanthine |
| PubChem ID | 73664 |
| Ethnomedicinal Information | Dropsy, swellings, oedema, gout, leprosy, malnutrition, debility, pain - killers, paralysis, epilepsy, convulsions, spasm, pulmonary troubles, sedatives |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polycyclic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 622.304 |
| Molecular Formula | C38H42N2O6
|
| SMILES | O1c2c3[C@H](N(CCc3cc(OC)c2OC)C)Cc2cc(Oc3ccc(C[C@H]4N(CCc5c4cc1c(OC)c5)C)cc3)c(OC)cc2 |
| XLogP | 6.098 |
| PSA | 61.860 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://plants.jstor.org/upwta/4_253
|
| Curator | |
| Compound ID | 2749 |
| Compound Structure |  |
| Plant Source | Triclisia patens Common Name: |
| Source Family | Menispermaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Phaeanthine |
| PubChem ID | 73664 |
| Ethnomedicinal Information | Dropsy, swellings, oedema, gout, leprosy, malnutrition, debility, pain - killers, paralysis, epilepsy, convulsions, spasm, pulmonary troubles, sedatives |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polycyclic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 622.304 |
| Molecular Formula | C38H42N2O6
|
| SMILES | O1c2c3[C@H](N(CCc3cc(OC)c2OC)C)Cc2cc(Oc3ccc(C[C@H]4N(CCc5c4cc1c(OC)c5)C)cc3)c(OC)cc2 |
| XLogP | 6.098 |
| PSA | 61.860 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://plants.jstor.org/upwta/4_253
|
| Curator | |
| Compound ID | 2750 |
| Compound Structure |  |
| Plant Source | Triclisia patens Common Name: |
| Source Family | Menispermaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 100 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Phaeanthine |
| PubChem ID | 73664 |
| Ethnomedicinal Information | Dropsy, swellings, oedema, gout, leprosy, malnutrition, debility, pain - killers, paralysis, epilepsy, convulsions, spasm, pulmonary troubles, sedatives |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Polycyclic, Quinoline, Alkaloid, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 622.304 |
| Molecular Formula | C38H42N2O6
|
| SMILES | O1c2c3[C@H](N(CCc3cc(OC)c2OC)C)Cc2cc(Oc3ccc(C[C@H]4N(CCc5c4cc1c(OC)c5)C)cc3)c(OC)cc2 |
| XLogP | 6.098 |
| PSA | 61.860 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 6 |
| No. of N | 2 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
2) http://plants.jstor.org/upwta/4_253
|
| Curator | |
| Compound ID | 3413 |
| Compound Structure |  |
| Plant Source | Physalis angulata L. Common Name:Camapu, Gooseberry, Hogweed, Balloon Cherry (English) |
| Source Family | Solanaceae |
| Origin | Brazil |
| Plant Part Used | Aerial |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 128 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Physalin B |
| PubChem ID | 5488849 |
| Ethnomedicinal Information | Tumors, gastric troubles, diuretic, earache |
| PubMed ID [Source Literature] | 12203265 |
| Extract Preparation | Aerial parts of P. angulata (83.56 g) were extracted with CHCl3. After solvent removal, the crude CHCl3 extract A (3.65 g) was fractionated over a silica gel column using Hex – AcOEt (7:3 - 3:7) |
| Chemical Classification [Active Compound] | Alicyclic, Polycyclic, Steroid, Lactone, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook liquid medium 7H9 |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 510.189 |
| Molecular Formula | C28H30O9 |
| SMILES | O1C23C4C5(CC6OC(=O)C5COC1(C4=O)C1C(CCC2(O)C(=O)OC36C)C2(C(=CC1)CC=CC2=O)C)C |
| XLogP | 0.685 |
| PSA | 125.430 |
| H-bond Donor | 1 |
| H-bond Acceptor | 9 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 8 |
| No. of N | 0 |
| No. of O | 9 |
| No. of S | 0 |
| Reference(s) | 1) Januário AH, Filho ER, Pietro RC, Kashima S, Sato DN, França SC.Antimycobacterial physalins from Physalis angulata L. (Solanaceae).Phytother Res. 2002 Aug;16(5):445-8
2) Jain, S.K., 1991. Dictionary of Indian Folk Medicine and Ethnobotany. Deep Publications, New Delhi, India
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3414 |
| Compound Structure |  |
| Plant Source | Physalis angulata L. Common Name:Camapu, Gooseberry, Hogweed, Balloon Cherry (English) |
| Source Family | Solanaceae |
| Origin | Brazil |
| Plant Part Used | Aerial |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampin (0.2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Physalin D |
| PubChem ID | 431071 |
| Ethnomedicinal Information | Tumors, gastric troubles, diuretic, earache |
| PubMed ID [Source Literature] | 12203265 |
| Extract Preparation | Aerial parts of P. angulata (83.56 g) were extracted with CHCl3. After solvent removal, the crude CHCl3 extract A (3.65 g) was fractionated over a silica gel column using Hex – AcOEt (7:3 3:7) |
| Chemical Classification [Active Compound] | Alicyclic, Polycyclic, Steroid, Lactone, Ketone, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook liquid medium 7H9 |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 544.194 |
| Molecular Formula | C28H32O11 |
| SMILES | O1C23C4C5(CC6OC(=O)C5COC1(C1C(C5(C(O)(C(O)C1)CC=CC5=O)C)CCC2(O)C(=O)OC36C)C4=O)C |
| XLogP | -0.989 |
| PSA | 165.890 |
| H-bond Donor | 3 |
| H-bond Acceptor | 11 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 8 |
| No. of N | 0 |
| No. of O | 11 |
| No. of S | 0 |
| Reference(s) | 1) Januário AH, Filho ER, Pietro RC, Kashima S, Sato DN, França SC.Antimycobacterial physalins from Physalis angulata L. (Solanaceae).Phytother Res. 2002 Aug;16(5):445-8
2) Jain, S.K., 1991. Dictionary of Indian Folk Medicine and Ethnobotany. Deep Publications, New Delhi, India
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3553 |
| Compound Structure |  |
| Plant Source | Colubrina retusa (Ditter) Common Name: |
| Source Family | Rhamnaceae |
| Origin | Venezuela |
| Plant Part Used | Stem |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare (ATCC 23068) |
| Assay / Test Done | OADC - Supplemented Middlebrook Broth |
| Positive Control Used (conc.) | Rifampin (0.3 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 10 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Jujubogenin 3 - O - α - L - Arabinofuranosyl (1-->2) - [3 - O - (Trans) - P - Coumaroyl - β - D - Glucopyranosyl (1-->3)] - α - L - Arabinopyranoside |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 10514332 |
| Extract Preparation | Air dried stem were powdered, extracted at 37°C in ethanol, suspended in water and then again extracted with chloroform and then with butanol and finally evaporated to dryness to yield the compound |
| Chemical Classification [Active Compound] | Alicyclic, Polycyclic, Steroid, Pyran, Cinnamate, Sugar |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 1044.529 |
| Molecular Formula | C55H80O19 |
| SMILES | C1C[C@@H](C(C2[C@]1(C1[C@@](CC2)(C23C(CC1)C1C(C2)(OC(C[C@@]1(O)C)C=C(C)C)OC3)C)C)(C)C)OC1OC[C@@H]([C@@H]([C@@H]1OC1O[C@@H]([C@@H]([C@@H]1O)O)CO)O[C@@H]1OC([C@@H]([C@@H](C1O)OC(=O)/C=C/c1ccc(cc1)O)O)CO)O |
| XLogP | 5.255 |
| PSA | 282.210 |
| H-bond Donor | 9 |
| H-bond Acceptor | 19 |
| No. of Rotatable Bond Count | 13 |
| No. of Rings | 10 |
| No. of N | 0 |
| No. of O | 19 |
| No. of S | 0 |
| Reference(s) | 1) ElSohly HN, Danner S, Li XC, Nimrod AC, Clark AM.New antimycobacterial saponin from Colubrina retusa.J Nat Prod. 1999 Sep;62(9):1341-2
|
| Curator | Farzana-shamsudeen, vikramjitmandal |
| Compound ID | 3991 |
| Compound Structure |  |
| Plant Source | Embelia Schimperi Common Name: |
| Source Family | Myrsinaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | One strain of H37Rv, 21 sensitive clinical strains, two clinical isolates resistant to isoniazid, and 13 MDR clinical strains |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml (inactive) |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Protoprimulagenin A |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Polycyclic, Terpene,Triterpene, Furanoid, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 458.376 |
| Molecular Formula | C30H50O3
|
| SMILES | CC1(C)[C@@H](O)CC[C@@]2(C)C1CC[C@]1(C)C2CC[C@@]23OC[C@@]4([C@@H](C[C@@]12C)O)C3CC(C)(C)CC4 |
| XLogP | 8.018 |
| PSA | 49.690 |
| H-bond Donor | 2 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 0 |
| No. of Rings | 6 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) Rogoza, L. N.; Salakhutdinov, N. F.; Tolstikov, G. A. Anti-tubercular Activity of Natural Products: Recent Developments. In Opportunity, Challenge and Scope of Natural Products in Medicinal Chemistry; Tiwari, V. K. Ed.; Research Signpost: India, 2011; pp 103-120
|
| Curator | |
| Compound ID | 4043 |
| Compound Structure |  |
| Plant Source | Clausena harmandiana Common Name: |
| Source Family | Rutaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Hirsutellone F |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Polycyclic, Dimeric, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 890.451 |
| Molecular Formula | C56H62N2O8
|
| SMILES | C=C[C@H]1C=C[C@H]2[C@H]3[C@@H](CC[C@@H](C)C3)[C@@H]3Oc4ccc(C[C@@]5(O)[C@@H](N6C(=O)[C@H]7Cc8ccc(cc8)O[C@@H]8[C@@H]9[C@@H](C(=O)C7C6=O)[C@H](C=CC9[C@H]6[C@H]8CC[C@H](C6)C)C=C)[C@H](C(=O)N5)C(=O)[C@@H]1[C@H]23)cc4 |
| XLogP | 9.483 |
| PSA | 139.310 |
| H-bond Donor | 2 |
| H-bond Acceptor | 10 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 10 |
| No. of N | 2 |
| No. of O | 8 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |