| Compound ID | 1218 |
| Compound Structure |  |
| Plant Source | Artocarpus lakoocha Roxb.Artocarpus lacucha Buch.-Ham Common Name:Monkey Jack (English), Lakuch, Kshudra Panas, Granthiphala, Pitanaasha (Sanskrit) |
| Source Family | Moraceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml) and Kanamycin sulphate (2 – 5 µg/ml)) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Lakoochin A |
| PubChem ID | 3012524 |
| Ethnomedicinal Information | Leprosy, used as folkmedicine for other diseases |
| PubMed ID [Source Literature] | 15043440 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Stilbene, Furanoid, Phenol, Prenylated, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 406.214 |
| Molecular Formula | C26H30O4 |
| SMILES | O1c(c2c(CC=C(C)C)c(OC)cc(OC)c2CC=C(C)C)cc2c1cc(O)cc2 |
| XLogP | 5.873 |
| PSA | 51.830 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Puntumchai A, Kittakoop P, Rajviroongit S, Vimuttipong S, Likhitwitayawuid K, Thebtaranonth Y.Lakoochins A and B, new antimycobacterial stilbene derivatives from Artocarpus lakoocha.J Nat Prod. 2004 Mar;67(3):485-6
2) Pushpangadan P, Atal CK.Ethno-medico-botanical investigations in Kerala I. Some primitive tribals of western ghats and their herbal medicine.J Ethnopharmacol. 1984 Jun;11(1):59-77
|
| Curator | |
| Compound ID | 1219 |
| Compound Structure |  |
| Plant Source | Artocarpus lakoocha Roxb.Artocarpus lacucha Buch.-Ham Common Name:Monkey Jack (English), Lakuch, Kshudra Panas, Granthiphala, Pitanaasha (Sanskrit) |
| Source Family | Moraceae |
| Origin | India |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.040 – 0.090 µg/ml) and Kanamycin sulphate (2 – 5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Lakoochin B |
| PubChem ID | 6479925 |
| Ethnomedicinal Information | Leprosy, used as folkmedicine for other diseases |
| PubMed ID [Source Literature] | 15043440 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Stilbene, Furanoid, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against KB and BC - 1 cell lines |
| Molecular Weight | 446.246 |
| Molecular Formula | C29H34O4 |
| SMILES | O1c(c2c(C/C=C(/CCC=C(C)C)C)c(O)cc(O)c2CC=C(C)C)cc2c1cc(O)cc2 |
| XLogP | 6.657 |
| PSA | 73.830 |
| H-bond Donor | 3 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Puntumchai A, Kittakoop P, Rajviroongit S, Vimuttipong S, Likhitwitayawuid K, Thebtaranonth Y.Lakoochins A and B, new antimycobacterial stilbene derivatives from Artocarpus lakoocha.J Nat Prod. 2004 Mar;67(3):485-6
2) Pushpangadan P, Atal CK.Ethno-medico-botanical investigations in Kerala I. Some primitive tribals of western ghats and their herbal medicine.J Ethnopharmacol. 1984 Jun;11(1):59-77
|
| Curator | |
| Compound ID | 1244 |
| Compound Structure |  |
| Plant Source | Bauhinia saccocalyx Common Name: |
| Source Family | Fabaceae |
| Origin | Thailand |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Bauhinoxepins B |
| PubChem ID | 3009552 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Oxapin, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero, human epidermoid carcinoma in the mouth (KB) and human breast cancer cells (BC) |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4
|
| SMILES | O1c2c(c(O)c(CC=C(C)C)cc2)C=Cc2c1c(OC)c(c(O)c2)C |
| XLogP | 3.996 |
| PSA | 58.920 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Prasat Kittakoop, Sombat Nopichai, Nuntawan Thongon, Panarat Charoenchai, Yodhathai Thebtaranonth.Bauhinoxepins A and B: New Antimycobacterial Dibenzo[b,f]oxepins from Bauhinia saccocalyx.Helvetica Chimica Acta, Volume 87, Issue 1, pages 175–179, January 2004
|
| Curator | |
| Compound ID | 1282 |
| Compound Structure |  |
| Plant Source | Borrichia frutescens L. Common Name:Sea Daisy |
| Source Family | Asteraceae (Compositae) |
| Origin | USA |
| Plant Part Used | Flower, leaf, stem |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Fusidic acid (4 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 64 - 128 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | (23R)-3-Oxolanosta-8,24-dien-23-Ol |
| PubChem ID | 469546 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 8988597 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Tetracyclic, Steroid, Ketone, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | Against Vero cells |
| Molecular Weight | 440.365 |
| Molecular Formula | C30H48O2
|
| SMILES | O=C1C([C@H]2[C@@](C3=C([C@]4([C@@]([C@H](CC4)[C@@H](C[C@@H](O)C=C(C)C)C)(CC3)C)C)CC2)(CC1)C)(C)C |
| XLogP | 7.784 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Cantrell CL, Lu T, Fronczek FR, Fischer NH, Adams LB, Franzblau SG.Antimycobacterial cycloartanes from Borrichia frutescens.J Nat Prod. 1996 Dec;59(12):1131-6
|
| Curator | |
| Compound ID | 1724 |
| Compound Structure |  |
| Plant Source | Eysenhardtia platycarpa Common Name: |
| Source Family | Fabaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7 - Dihydroxy - 8 - Prenyl - Flavanone |
| PubChem ID | 3144815 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C(CC(=O)c2c1c(CC=C(C)C)c(O)cc2O)c1ccccc1 |
| XLogP | 3.963 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1725 |
| Compound Structure |  |
| Plant Source | Eysenhardtia platycarpa Common Name: |
| Source Family | Fabaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.06 µg/ml), Ethambutol (2 µg/ml), Rifampin (0.06 µg/ml), Streptomycin (0.50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7 - Dihydroxy - 6 - Methyl - 8 - Prenyl - Flavanone |
| PubChem ID | 14188388 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4
|
| SMILES | O1C(CC(=O)c2c1c(c(O)c(c2O)C)CC=C(C)C)c1ccccc1 |
| XLogP | 4.075 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1726 |
| Compound Structure |  |
| Plant Source | Eysenhardtia platycarpa Common Name: |
| Source Family | Fabaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7 - Dihydroxy - 8 - Prenyl - Flavanone |
| PubChem ID | 3144815 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C(CC(=O)c2c1c(CC=C(C)C)c(O)cc2O)c1ccccc1 |
| XLogP | 3.963 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1727 |
| Compound Structure |  |
| Plant Source | Eysenhardtia platycarpa Common Name: |
| Source Family | Fabaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (345) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (3.125 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7 - Dihydroxy - 6 - Methyl - 8 - Prenyl - Flavanone |
| PubChem ID | 14188388 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4
|
| SMILES | O1C(CC(=O)c2c1c(c(O)c(c2O)C)CC=C(C)C)c1ccccc1 |
| XLogP | 4.075 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1728 |
| Compound Structure |  |
| Plant Source | Eysenhardtia platycarpa Common Name: |
| Source Family | Fabaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7 - Dihydroxy - 8 - Prenyl - Flavanone |
| PubChem ID | 3144815 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C(CC(=O)c2c1c(CC=C(C)C)c(O)cc2O)c1ccccc1 |
| XLogP | 3.963 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1729 |
| Compound Structure |  |
| Plant Source | Eysenhardtia platycarpa Common Name: |
| Source Family | Fabaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M12) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (12.50 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7 - Dihydroxy - 6 - Methyl - 8 - Prenyl - Flavanone |
| PubChem ID | 14188388 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4
|
| SMILES | O1C(CC(=O)c2c1c(c(O)c(c2O)C)CC=C(C)C)c1ccccc1 |
| XLogP | 4.075 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1730 |
| Compound Structure |  |
| Plant Source | Eysenhardtia platycarpa Common Name: |
| Source Family | Fabaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7 - Dihydroxy - 8 - Prenyl - Flavanone |
| PubChem ID | 3144815 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 324.136 |
| Molecular Formula | C20H20O4
|
| SMILES | O1C(CC(=O)c2c1c(CC=C(C)C)c(O)cc2O)c1ccccc1 |
| XLogP | 3.963 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1731 |
| Compound Structure |  |
| Plant Source | Eysenhardtia platycarpa Common Name: |
| Source Family | Fabaceae |
| Origin | Mexico |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis (M20) |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Streptomycin (25 µg/ml), Isoniazid (< 50 µg/ml), Ethambutol (12.50 µg/ml), Rifampin (< 50 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 5, 7 - Dihydroxy - 6 - Methyl - 8 - Prenyl - Flavanone |
| PubChem ID | 14188388 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Flavonoid, Phenol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 338.152 |
| Molecular Formula | C21H22O4
|
| SMILES | O1C(CC(=O)c2c1c(c(O)c(c2O)C)CC=C(C)C)c1ccccc1 |
| XLogP | 4.075 |
| PSA | 66.760 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 3 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) María del Rayo Camacho-Corona, Juan Manuel de Jesús Favela-Hernández, Omar González-Santiago, Elvira Garza-González, Gloria María Molina-Salinas, Salvador Said-Fernández, Guillermo Delgado, Julieta Luna-Herrerae.Evaluation of Some Plant-derived Secondary Metabolites Against Sensitive and Multidrug-resistant Mycobacterium tuberculosis.J. Mex. Chem. Soc. 2009, 53(2), 71-75
|
| Curator | |
| Compound ID | 1738 |
| Compound Structure |  |
| Plant Source | Ferula communis Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Saudi Arabia |
| Plant Part Used | Rhizome |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | |
| Positive Control Used (conc.) | Amikacin (0.25 µg/ml), Streptomycin (10 µg/ml), Isoniazid (10 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1.25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | Anti-mycobacterial |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3
|
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Mohammed A. Al-Yahya, Ilias Muhammad, Humayun H. Mirza, Farouk S. El-Feraly.Antibacterial constituents from the rhizomes of Ferula communis.Phytotherapy Research.12/1998;12(5):335-339
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Ferula+communis
|
| Curator | |
| Compound ID | 1739 |
| Compound Structure |  |
| Plant Source | Ferula communis Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Saudi Arabia |
| Plant Part Used | Rhizome |
| Extract | |
| Target Bacteria | Mycobacterium intracellulare |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ferchromone |
| PubChem ID | NR |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tricyclic, Terpene, Sesquiterpene, Chromone, Prenylated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 384.230 |
| Molecular Formula | C24H32O4
|
| SMILES | C1c2c(ccc1)OC1C(C2=O)CC([C@@](O1)(CC/C=C(/CCC=C(C)C)C)C)O |
| XLogP | 5.430 |
| PSA | 55.760 |
| H-bond Donor | 1 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 0 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Mohammed A. Al-Yahya, Ilias Muhammad, Humayun H. Mirza, Farouk S. El-Feraly.Antibacterial constituents from the rhizomes of Ferula communis.Phytotherapy Research.12/1998;12(5):335-339
2) http://www.pfaf.org/user/Plant.aspx?LatinName=Ferula+communis
|
| Curator | |
| Compound ID | 2204 |
| Compound Structure |  |
| Plant Source | Morinda citrifolia L. Common Name:Indian Mulberry (English), Ashyuka, Akshi, Atchy (Sanskrit) |
| Source Family | Rubiaceae |
| Origin | Indo - Pacific region |
| Plant Part Used | Leaf |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Broth dilution assay using BACTEC system |
| Positive Control Used (conc.) | Rifampin (0.125 µg/ml) |
| Inhibition [%] | Crude ethanol extract - 89 % and hexane fraction - 95 % |
| Activity [MIC] µg/ml | > 64 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Cycloartenol |
| PubChem ID | 17750995 |
| Ethnomedicinal Information | Asthma, joint pains, immune problems, pain relief, cellular regeneration, tuberculosis, respiratory disorders |
| PubMed ID [Source Literature] | 12410555 |
| Extract Preparation | Dried leaves were extracted with ethanol to give a green, syrupy extract which was further partitioned into hexane DCM , EtOAc and n - BuOH fractions |
| Chemical Classification [Active Compound] | Alicyclic, Pentacyclic, Terpene, Triterpene, Cycloartane, Prenylated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | Bactec 12B broth |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 426.386 |
| Molecular Formula | C30H50O
|
| SMILES | O[C@@H]1C([C@H]2[C@@]3([C@]4(C3)[C@H]([C@]3([C@](CC4)([C@H](CC3)[C@@H](CCC=C(C)C)C)C)C)CC2)CC1)(C)C |
| XLogP | 11.921 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 5 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Saludes JP, Garson MJ, Franzblau SG, Aguinaldo AM.Antitubercular constituents from the hexane fraction of Morinda citrifolia Linn. (Rubiaceae).Phytother Res. 2002 Nov;16(7):683-5
2) http://www.motherherbs.com/morinda-citrifolia.html
|
| Curator | |
| Compound ID | 2317 |
| Compound Structure |  |
| Plant Source | Peucedanum ostruthium Koch Common Name:Masterwort |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | China |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium aurum (PI 104 482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 1 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ostruthin |
| PubChem ID | 5281420 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 298.157 |
| Molecular Formula | C19H22O3 |
| SMILES | O1c2c(cc(C/C=C(/CCC=C(C)C)C)c(O)c2)ccc1=O |
| XLogP | 5.348 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | |
| Compound ID | 2318 |
| Compound Structure |  |
| Plant Source | Peucedanum ostruthium Koch Common Name:Masterwort |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | China |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium fortuitum (ATCC 6841) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ostruthin |
| PubChem ID | 5281420 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 298.157 |
| Molecular Formula | C19H22O3 |
| SMILES | O1c2c(cc(C/C=C(/CCC=C(C)C)C)c(O)c2)ccc1=O |
| XLogP | 5.348 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | |
| Compound ID | 2319 |
| Compound Structure |  |
| Plant Source | Peucedanum ostruthium Koch Common Name:Masterwort |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | China |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium phlei (ATCC 11 758) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ostruthin |
| PubChem ID | 5281420 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 298.157 |
| Molecular Formula | C19H22O3 |
| SMILES | O1c2c(cc(C/C=C(/CCC=C(C)C)C)c(O)c2)ccc1=O |
| XLogP | 5.348 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | |
| Compound ID | 2320 |
| Compound Structure |  |
| Plant Source | Peucedanum ostruthium Koch Common Name:Masterwort |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | China |
| Plant Part Used | Root |
| Extract | |
| Target Bacteria | Mycobacterium smegmatis (ATCC 14468) |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ostruthin |
| PubChem ID | 5281420 |
| Ethnomedicinal Information | Has folkloric reputation for the topical treatment of athletes foot |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 298.157 |
| Molecular Formula | C19H22O3 |
| SMILES | O1c2c(cc(C/C=C(/CCC=C(C)C)C)c(O)c2)ccc1=O |
| XLogP | 5.348 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | |
| Compound ID | 2362 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sesquisabinene hydrate |
| PubChem ID | 6428435 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Bicyclic, Terpene, Sesquiterpene, Alcohol, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O
|
| SMILES | O[C@]1(C2[C@](C2)(CC1)C(CCC=C(C)C)C)C |
| XLogP | 4.683 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 2370 |
| Compound Structure |  |
| Plant Source | Piper bogotense Common Name: |
| Source Family | Piperaceae |
| Origin | Colombia |
| Plant Part Used | Leaf |
| Extract | Essential oil (0.2 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Macrodilution method in glass tubes |
| Positive Control Used (conc.) | Rifampin (0.50 µg/ml), Isoniazid (0.03 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 130 ± 95 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | α - Bisabolol |
| PubChem ID | 10586 |
| Ethnomedicinal Information | Tuberculosis |
| PubMed ID [Source Literature] | 19753839 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene, Prenylated, Alcohol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 222.198 |
| Molecular Formula | C15H26O
|
| SMILES | OC(C1CCC(=CC1)C)(CCC=C(C)C)C |
| XLogP | 4.085 |
| PSA | 20.230 |
| H-bond Donor | 1 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 0 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Bueno-Sánchez JG, Martínez-Morales JR, Stashenko EE, Ribón W.Anti-tubercular activity of eleven aromatic and medicinal plants occurring in Colombia.Biomedica. 2009 Mar;29(1):51-60
|
| Curator | |
| Compound ID | 1799 |
| Compound Structure |  |
| Plant Source | Garcinia mangostana Common Name:Mangosteen |
| Source Family | Clusiaceae |
| Origin | Thailand, Malaysia |
| Plant Part Used | Arils and seed |
| Extract | Methanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Rifampicin (0.003 - 0.0047 µg/ml), Isoniazid (0.025 - 0.05 µg/ml), Kanamycin sulfate (1.25 - 2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 9 - Hydroxycalabaxanthone |
| PubChem ID | NR |
| Ethnomedicinal Information | Treatment of diarrhea and dysentery and for skin diseases, to lower fever and for urinary disorders |
| PubMed ID [Source Literature] | 12843596 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Tetracyclic, Xanthanoid, Benzopyran, Prenylated, Ether, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 422.173 |
| Molecular Formula | C25H26O6 |
| SMILES | C1(c(c(cc2c1c(=O)c1c(o2)cc2c(c1O)C=CC(O2)(C)C)O)OC)CCC=C(C)C |
| XLogP | 3.609 |
| PSA | 85.220 |
| H-bond Donor | 2 |
| H-bond Acceptor | 1 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 4 |
| No. of N | 0 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Suksamrarn S, Suwannapoch N, Phakhodee W, Thanuhiranlert J, Ratananukul P, Chimnoi N, Suksamrarn A.Antimycobacterial activity of prenylated xanthones from the fruits of Garcinia mangostana.Chem Pharm Bull (Tokyo). 2003 Jul;51(7):857-9
2) http://www.montosogardens.com/garcinia_mangostana.htm
|
| Curator | |
| Compound ID | 3973 |
| Compound Structure |  |
| Plant Source | Rudbeckia laciniata Common Name:Thimbleweed |
| Source Family | Asteraceae (Compositae) |
| Origin | Eastern North America |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium avium |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | NR |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | 2,10-bisaboladiene- 1,4-endoperoxide |
| PubChem ID | 10082849 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 16243360 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Alicyclic, Terpene, Sesquiterpene, Peroxy, Prenylated |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 236.178 |
| Molecular Formula | C15H24O2 |
| SMILES | O1O[C@@H]2C[C@@H](C(CCC=C(C)C)C)[C@@H]1C=C2C |
| XLogP | 4.400 |
| PSA | 18.460 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 0 |
| No. of N | 0 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Pauli GF, Case RJ, Inui T, Wang Y, Cho S, Fischer NH, Franzblau SG.New perspectives on natural products in TB drug research.Life Sci. 2005 Dec 22;78(5):485-94
|
| Curator | |
| Compound ID | 3048 |
| Compound Structure |  |
| Plant Source | Peucedanum osthruthin Koch Common Name: |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | |
| Plant Part Used | Root |
| Extract | Dichloromethane |
| Target Bacteria | Mycobacterium abscessus (ATCC 19 977) |
| Assay / Test Done | |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 32 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Ostruthin |
| PubChem ID | 5281420 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 12709907 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 298.157 |
| Molecular Formula | C19H22O3
|
| SMILES | O1c2c(cc(C/C=C(/CCC=C(C)C)C)c(O)c2)ccc1=O |
| XLogP | 5.348 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Schinkovitz A, Gibbons S, Stavri M, Cocksedge MJ, Bucar F.Ostruthin: an antimycobacterial coumarin from the Roots of Peucedanum ostruthium. Planta Med. 2003 Apr;69(4):369-7
|
| Curator | |
| Compound ID | 3074 |
| Compound Structure |  |
| Plant Source | Ferula communis L. Common Name:Giant Fennel |
| Source Family | Apiaceae (Umbelliferae) |
| Origin | Cagliari, Sardinia, Italy |
| Plant Part Used | Root |
| Extract | Acetone |
| Target Bacteria | Mycobacterium aurum (Pasteur Institute 104482) |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol (0.5 µg/ml), Isoniazid (2 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Ferulenol |
| PubChem ID | 54679300 |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | 15620264 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Bicyclic, Alkyl, Alkene, Coumarin, Prenylated, Phenol |
| Media / Broth Used [Antimicrobial Assay/Test] | Mueller - Hinton Broth |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 366.219 |
| Molecular Formula | C24H30O3 |
| SMILES | O1c2c(c(O)c(C/C=C(/CC/C=C(/CCC=C(C)C)C)C)c1=O)cccc2 |
| XLogP | 8.182 |
| PSA | 37.300 |
| H-bond Donor | 1 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 2 |
| No. of N | 0 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Appendino G, Mercalli E, Fuzzati N, Arnoldi L, Stavri M, Gibbons S, Ballero M, Maxia A.Antimycobacterial coumarins from the sardinian giant fennel (Ferula communis).J Nat Prod. 2004 Dec;67(12):2108-10
|
| Curator | Vsheeba, vikramjitmandal |