| Compound ID | 3364 |
| Compound Structure |  |
| Plant Source | Amyris elemifera Common Name:NR |
| Source Family | Rutaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 25 µg/ml, 7H11 agar: 25 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Texalin |
| PubChem ID | 473253 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine, Oxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 266.069 |
| Molecular Formula | C15H10N2O3 |
| SMILES | O1c2c(OC1)ccc(c2)c1oc(nc1)c1cccnc1 |
| XLogP | 2.463 |
| PSA | 57.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3365 |
| Compound Structure |  |
| Plant Source | Amyris elemifera Common Name:NR |
| Source Family | Rutaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium avium 733 |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 25 µg/ml, 7H11 agar: 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Texalin |
| PubChem ID | 473253 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine, Oxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 266.069 |
| Molecular Formula | C15H10N2O3 |
| SMILES | O1c2c(OC1)ccc(c2)c1oc(nc1)c1cccnc1 |
| XLogP | 2.463 |
| PSA | 57.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3366 |
| Compound Structure |  |
| Plant Source | Amyris elemifera Common Name:NR |
| Source Family | Rutaceae |
| Origin | Guadeloupe |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium kansasii (Clinical isolate 94 - 069) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | NR |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Bactec: 25 µg/ml, 7H11 agar: 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Texalin |
| PubChem ID | 473253 |
| Ethnomedicinal Information | Antimycobacterial |
| PubMed ID [Source Literature] | 9626931 |
| Extract Preparation | The dried powdered material was moistened with 25 % NH4OH, and extracted by chloroform. The organic phase was treated with 2 % HCl, the acid layer was washed with petroleum ether, basified with 25 % NH4OH, and extracted with chloroform. The organic phase was washed with water, and dried over Na2SO4. The organic extracts were evaporated and subjected to chromatography on silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine, Oxazole, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | Fresh Loëwenstein - Jensen (LJ) slants, Middlebrook 7H11 agar medium |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 266.069 |
| Molecular Formula | C15H10N2O3 |
| SMILES | O1c2c(OC1)ccc(c2)c1oc(nc1)c1cccnc1 |
| XLogP | 2.463 |
| PSA | 57.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 4 |
| No. of N | 2 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rastogi N, Abaul J, Goh KS, Devallois A, Philogène E, Bourgeois P.Antimycobacterial activity of chemically defined natural substances from the Caribbean flora in Guadeloupe.FEMS Immunol Med Microbiol. 1998 Apr;20(4):267-73
|
| Curator | Wvarsha, rachanake |
| Compound ID | 3902 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3903 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3904 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (32 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3905 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | ND |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3906 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3907 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine - N - Oxide |
| PubChem ID | NR |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Alkaloid, Pyridine-N-Oxide, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 172.997 |
| Molecular Formula | C6H7NOS2 |
| SMILES | C1cc[n+](c(c1)SSC)[O-] |
| XLogP | 1.646 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3908 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium tuberculosis H37Rv (ATCC 27 294) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | 100 % |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3909 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3910 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (32 µg/ml), Isoniazid (0.25 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3911 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Not Tested |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 4 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3912 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 2 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3913 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | Bulb |
| Extract | Chloroform |
| Target Bacteria | Mycobacterium bovis (BCG - Bacillus Calmette Guerin) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol, Isoniazid |
| Inhibition [%] | 90 % |
| Activity [MIC] µg/ml | 0.01 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - [(Methylthiomethyl) Dithio] Pyridine - N - Oxide |
| PubChem ID | 45267926 |
| Ethnomedicinal Information | Promotion of wound healing |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | A 4.43 kg quantity of macerated bulbs was extracted exhaustively with hexane, chloroform and methanol |
| Chemical Classification [Active Compound] | Aromatic, Dithiol, Pyridine-N-Oxide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 218.985 |
| Molecular Formula | C7H9NOS3 |
| SMILES | S(SCSC)c1[n+]([O-])cccc1 |
| XLogP | 2.259 |
| PSA | 102.840 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 3 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3920 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium fortuitum |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine |
| PubChem ID | 173923 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Pyridine, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 157.002 |
| Molecular Formula | C6H7NS2 |
| SMILES | S(SC)c1ncccc1 |
| XLogP | 2.407 |
| PSA | 63.490 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 0 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3922 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium smegmatis (mc2 2700) |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | Not tested |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine |
| PubChem ID | 173923 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Pyridine, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 157.002 |
| Molecular Formula | C6H7NS2 |
| SMILES | S(SC)c1ncccc1 |
| XLogP | 2.407 |
| PSA | 63.490 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 0 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3923 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium phlei |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 16 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine |
| PubChem ID | 173923 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Pyridine, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 157.002 |
| Molecular Formula | C6H7NS2 |
| SMILES | S(SC)c1ncccc1 |
| XLogP | 2.407 |
| PSA | 63.490 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 0 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |
| Compound ID | 3925 |
| Compound Structure |  |
| Plant Source | Allium stipitatum Regel Common Name:Ornamental Onion, Glory of Pamir |
| Source Family | Amaryllidaceae |
| Origin | Spalding, Lincolnshire, UK |
| Plant Part Used | NR |
| Extract | NR |
| Target Bacteria | Mycobacterium smegmatis |
| Assay / Test Done | NR |
| Positive Control Used (conc.) | Ethambutol (2 µg/ml), Isoniazid (128 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 8 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | 2 - (Methyldithio) Pyridine |
| PubChem ID | 173923 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 19093848 |
| Extract Preparation | NR |
| Chemical Classification [Active Compound] | Aromatic, Pyridine, Disulfide |
| Media / Broth Used [Antimicrobial Assay/Test] | Columbia blood agar (Oxoid) |
| Cytotoxicity Assay [AID] | Sulforhodamine B Short - Term Cytotoxicity Assay |
| Molecular Weight | 157.002 |
| Molecular Formula | C6H7NS2 |
| SMILES | S(SC)c1ncccc1 |
| XLogP | 2.407 |
| PSA | 63.490 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 2 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 0 |
| No. of S | 2 |
| Reference(s) | 1) O'Donnell G, Poeschl R, Zimhony O, Gunaratnam M, Moreira JB, Neidle S, Evangelopoulos D, Bhakta S, Malkinson JP, Boshoff HI, Lenaerts A, Gibbons S.Bioactive pyridine-N-oxide disulfides from Allium stipitatum.J Nat Prod. 2009 Mar 27;72(3):360-5
|
| Curator | Vikramjitmandal |