| Compound ID | 2381 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Brachyamide B |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 327.183 |
| Molecular Formula | C20H25NO3 |
| SMILES | C1N(CCC1)C(=O)/C=C/CCCC/C=C/c1cc2c(cc1)OCO2 |
| XLogP | 5.013 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2382 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fruit |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.050 µg/ml), Kanamycin sulfate (2.5 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 200 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentosine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 15234750 |
| Extract Preparation | The pulverized, dried fruits of Piper sarmentosum (2.39 kg) were extracted successively with hexane and MeOH in a Soxhlet apparatus. After removal of solvent in vacuo, the hexane extract (70.7 g) was subjected to quick CC (silica gel) eluting with hexane, hexane–CHCl3, CHCl3, CHCl3–MeOH and MeOH to give 6 main fractions |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 299.152 |
| Molecular Formula | C18H21NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 3.875 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Siriwattanakit P, Sukcharoenphol K, Wongvein C, Ruttanaweang P, Wongwattanavuch P, Suksamrarn A.Chemical constituents and bioactivity of Piper sarmentosum.J Ethnopharmacol. 2004 Aug;93(2-3):173-6
|
| Curator | |
| Compound ID | 2386 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | N - [9 - (3, 4 - Methylenedioxyphenyl) - 2E, 4E, 8E - Nonatrienoyl] Pyrrolidine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Phenylpropanoid, Pyrrolidine, Amide, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 325.168 |
| Molecular Formula | C20H23NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 4.569 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2387 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root, fruit |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentine |
| PubChem ID | 6440616 |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | N/A |
| Chemical Classification [Active Compound] | Alicyclic, Alkene, Pyrrolidine, Amide, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 221.178 |
| Molecular Formula | C14H23NO |
| SMILES | O=C(N1CCCC1)/C=C/C=C/CCCCC |
| XLogP | 4.039 |
| PSA | 20.310 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2388 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh Root |
| Extract | Ethanol |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Brachyamide B |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | N/A |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 327.183 |
| Molecular Formula | C20H25NO3 |
| SMILES | C1N(CCC1)C(=O)/C=C/CCCC/C=C/c1cc2c(cc1)OCO2 |
| XLogP | 5.013 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 8 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2389 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Roxb. Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Probably Southeast Asia, Malaysia |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Sarmentosine |
| PubChem ID | NR |
| Ethnomedicinal Information | Cough, anti - tuberculosis and anti - plasmodial activities |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Amide, Acid |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | N/A |
| Molecular Weight | 299.152 |
| Molecular Formula | C18H21NO3 |
| SMILES | C1c2c(ccc1/C=C/CC/C=C/C(=O)N1CCCC1)OCO2 |
| XLogP | 3.875 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | |
| Compound ID | 2963 |
| Compound Structure |  |
| Plant Source | Haloxylon salicornicum Bunge ex Boiss Common Name:NR |
| Source Family | Chenopodiaceae |
| Origin | Pakistan, Egypt, Jordan, Palestine, Iran, Iraq and Kuwait (in unfertile areas) |
| Plant Part Used | Whole plant |
| Extract | NR |
| Target Bacteria | Mycobacterium tuberculosis H37Rv |
| Assay / Test Done | Micro Broth Dilution Method |
| Positive Control Used (conc.) | Isoniazid (0.02 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Haloxyline B |
| PubChem ID | 11453345 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 20542692 |
| Extract Preparation | Methanol extract further partitioned with water and hexane. The water layer was further extracted with chloroform and subjected to silica gel column chromatography |
| Chemical Classification [Active Compound] | Alicyclic, Alkene, Pyrrolidine, Amide, Alcohol, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | Middlebrook 7H9 broth |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 435.371 |
| Molecular Formula | C27H49NO3 |
| SMILES | O[C@@H]1CCCN(C1)C(=O)/C=CC=C/CCCCCCCCCCCCCCCCCO |
| XLogP | 8.430 |
| PSA | 60.770 |
| H-bond Donor | 2 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 20 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Bibi N, Tanoli SA, Farheen S, Afza N, Siddiqi S, Zhang Y, Kazmi SU, Malik A.In vitro antituberculosis activities of the constituents isolated from Haloxylon salicornicum.Bioorg Med Chem Lett. 2010 Jul 15;20(14):4173-6
|
| Curator | KeyaMukherjee, vsheeba |
| Compound ID | 3415 |
| Compound Structure |  |
| Plant Source | Piper chaba Hunter Common Name: |
| Source Family | Piperaceae |
| Origin | |
| Plant Part Used | Stem |
| Extract | Hexane |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 12.5 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | Chabamide |
| PubChem ID | 11319094 |
| Ethnomedicinal Information | Chabamide showed antimalarial activity with an IC50 value of 2.7 µg/ml |
| PubMed ID [Source Literature] | 12357406 |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Alkaloid, Pyrrolidine |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 570.273 |
| Molecular Formula | C34H38N2O6 |
| SMILES | O=C(N1CCCCC1)[C@H]1[C@@H]([C@@H](C=CC1C(=O)N1CCCCC1)c1cc2OCOc2cc1)/C=C/c1cc2OCOc2cc1 |
| XLogP | 5.216 |
| PSA | 77.540 |
| H-bond Donor | 0 |
| H-bond Acceptor | 8 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 7 |
| No. of N | 2 |
| No. of O | 6 |
| No. of S | 0 |
| Reference(s) | 1) Rukachaisirikul T, Prabpai S, Champung P, Suksamrarn A.Chabamide, a novel piperine dimer from stems of Piper chaba.Planta Med. 2002 Sep;68(9):853-5
|
| Curator | Rachana, vikramjitmandal |
| Compound ID | 3728 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Thailand |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | 50 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sarmentine |
| PubChem ID | 6440616 |
| Ethnomedicinal Information | Antimycobacterial and antiplasmodial activity, antifungal |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Alicyclic, Alkene, Pyrrolidine, Amide, Alkaloid |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 221.178 |
| Molecular Formula | C14H23NO |
| SMILES | O=C(N1CCCC1)/C=C/C=C/CCCCC |
| XLogP | 4.039 |
| PSA | 20.310 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 1 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | KeyaMukherjee, rachanake |
| Compound ID | 3729 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Thailand |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | N - (3 - Phenylpropanoyl) Pyrrole |
| PubChem ID | 11074385 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Pyrrol, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 199.100 |
| Molecular Formula | C13H13NO |
| SMILES | O=C(n1cccc1)CCc1ccccc1 |
| XLogP | 4.579 |
| PSA | 22.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 2 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 1 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | KeyaMukherjee, gppreetha |
| Compound ID | 3738 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Thailand |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sarmentamide A |
| PubChem ID | 11528614 |
| Ethnomedicinal Information | NR |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Pyrrolidone, Amide |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 215.095 |
| Molecular Formula | C13H13NO2
|
| SMILES | O=C(N1CC=CC1=O)CCc1ccccc1 |
| XLogP | 3.518 |
| PSA | 37.380 |
| H-bond Donor | 0 |
| H-bond Acceptor | 3 |
| No. of Rotatable Bond Count | 4 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 2 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | Gppreetha |
| Compound ID | 3739 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Thailand |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sarmentamide B |
| PubChem ID | NR |
| Ethnomedicinal Information | Antimycobacterial and antiplasmodial activity, antifungal |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Phenylpropanoid, Pyrrolidine, Amide, O-Acetyl |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 285.136 |
| Molecular Formula | C17H19NO3 |
| SMILES | O=C(/C=C/c1ccccc1)N1C[C@@H]([C@H](C1)C(=O)C)C(=O)C |
| XLogP | 2.976 |
| PSA | 54.450 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 5 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | KeyaMukherjee, rachanake |
| Compound ID | 3740 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name:Cha Plu |
| Source Family | Piperaceae |
| Origin | Thailand |
| Plant Part Used | Fresh root |
| Extract | Ethanol (95 %) |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | Microplate Alamar Blue Assay (MABA) |
| Positive Control Used (conc.) | Isoniazid (0.04 - 0.09 µg/ml) and Kanamycin sulphate (2.0 - 5.0 µg/ml) |
| Inhibition [%] | NR |
| Activity [MIC] µg/ml | > 200 µg/ml |
| Activity (In terms of dilution) | NR |
| Activity (Zone of inhibition in mm) | NR |
| Active Compound Identified | Sarmentamide C |
| PubChem ID | 11514809 |
| Ethnomedicinal Information | Antimycobacterial and antiplasmodial activity, antifungal |
| PubMed ID [Source Literature] | 16462055 |
| Extract Preparation | The fresh roots of Piper sarmentosum (481 g) were ground and extracted with 95 % EtOH at room temperature. After filtration and evaporation, the ethanolic extract was obtained as a brown viscous oil (19.4 g). The oil was partitioned between water (200 ml) and EtOAc (3 x 200 ml) and the water layer was further partitioned with n - BuOH (3 x 200 ml). Evaporation of the EtOAc-, n-BuOH- and water - soluble fractions gave a dark brown oil (6.3 g), a brown oil (1.8 g) and a light brown oil (10.5 g), respectively. The EtOAc - soluble fraction (6.3 g) was separated by flash column chromatography using silica gel |
| Chemical Classification [Active Compound] | Aromatic, Alkene, Phenylpropanoid, Pyrrolidine, Amide, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | NR |
| Cytotoxicity Assay [AID] | NR |
| Molecular Weight | 291.147 |
| Molecular Formula | C16H21NO4 |
| SMILES | O=C(N1CCCC1)/C=C/c1c(OC)cc(OC)c(OC)c1 |
| XLogP | 1.744 |
| PSA | 48.000 |
| H-bond Donor | 0 |
| H-bond Acceptor | 5 |
| No. of Rotatable Bond Count | 6 |
| No. of Rings | 2 |
| No. of N | 1 |
| No. of O | 4 |
| No. of S | 0 |
| Reference(s) | 1) Tuntiwachwuttikul P, Phansa P, Pootaeng-On Y, Taylor WC.Chemical constituents of the roots of Piper sarmentosum.Chem Pharm Bull (Tokyo). 2006 Feb;54(2):149-51
|
| Curator | KeyaMukherjee, rachanake |
| Compound ID | 4046 |
| Compound Structure |  |
| Plant Source | Piper sarmentosum Common Name: |
| Source Family | Piperaceae |
| Origin | |
| Plant Part Used | |
| Extract | |
| Target Bacteria | Mycobacterium tuberculosis H37Ra |
| Assay / Test Done | |
| Positive Control Used (conc.) | |
| Inhibition [%] | |
| Activity [MIC] µg/ml | 25 µg/ml |
| Activity (In terms of dilution) | |
| Activity (Zone of inhibition in mm) | |
| Active Compound Identified | EJMC133 |
| PubChem ID | NR |
| Ethnomedicinal Information | |
| PubMed ID [Source Literature] | |
| Extract Preparation | |
| Chemical Classification [Active Compound] | Aromatic, Alkyl, Alkene, Alkaloid, Pyrrolidine, Ether |
| Media / Broth Used [Antimicrobial Assay/Test] | |
| Cytotoxicity Assay [AID] | |
| Molecular Weight | 325.168 |
| Molecular Formula | C20H23NO3 |
| SMILES | O=C(N1CCCC1)/C=C/C=C/CC/C=C/c1cc2OCOc2cc1 |
| XLogP | 4.569 |
| PSA | 38.770 |
| H-bond Donor | 0 |
| H-bond Acceptor | 4 |
| No. of Rotatable Bond Count | 7 |
| No. of Rings | 3 |
| No. of N | 1 |
| No. of O | 3 |
| No. of S | 0 |
| Reference(s) | 1) In silico Comparison of Antimycobacterial Natural Products with Known Antituberculosis Drugs. Marlene Espinoza-Moraga, Nicholas M. Njuguna, Grace Mugumbate, Julio Caballero, and Kelly Chibale. Journal of Chemical Information and Modeling 2013 53 (3), 649-660
2) García, A., Bocanegra-García, V., Palma-Nicolás, J. P., Rivera, G. Vennerstrom, J. L. Recent Advances in Antitubercular Natural Products. Eur. J. Med. Chem. 2012, 49, 1-23
|
| Curator | |